Filtered Search Results
Search results for "electrophoresis"
Sodium Dodecyl Sulfate (SDS), White Powder, Electrophoresis, Fisher BioReagents™
Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Sodium Lauryl Sulfate,SDS PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC Name: sodium dodecyl sulfate SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | Sodium Lauryl Sulfate,SDS |
| IUPAC Name | sodium dodecyl sulfate |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
| Name Note | 10X Solution |
|---|---|
| Concentration or Composition (by Analyte or Components) | Tris (<5.0%), Acetic Acid (1.0%), and EDTA (<1%). |
| CAS | 77-86-1 |
| Protease | Protease free |
| Physical Form | Liquid |
| Chemical Name or Material | Tris-Acetate-EDTA |
| Grade | Electrophoresis |
| Synonym | TAE |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| DNase | DNase free |
| Recommended Storage | RT |
| Filtered Through | Filtered through a 0.2-micron filter. |
| ChemAlert Storage Symbol | Gray |
SDS Solution, 20% Sodium Dodecyl Sulfate Solution, Molecular Biology/Electrophoresis, Fisher BioReagents™
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Sodium lauryl sulfate,SDS PubChem CID: 3423265 ChEBI: CHEBI:8984 SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | Sodium lauryl sulfate,SDS |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
SDS Solution, 10% Sodium Dodecyl Sulfate Solution, Molecular Biology/Electrophoresis, Fisher BioReagents™
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M PubChem CID: 3423265 ChEBI: CHEBI:8984 SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
TBE Buffer, Tris-Borate-EDTA, 10X Solution, Electrophoresis, Fisher BioReagents™
CAS: 10043-35-3 Synonym: TBE
| CAS | 10043-35-3 |
|---|---|
| Synonym | TBE |
| Color | Undesignated |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Tris-Glycine-SDS |
| Grade | Electrophoresis |
| Identification | Pass Test |
| DNase | DNase free |
| Filtered Through | Filtered through a 0.2-micron filter. |
| ChemAlert Storage Symbol | Gray |
| Name Note | 10X Solution |
| Concentration or Composition (by Analyte or Components) | 0.25M Tris Base, 1.92M Glycine, and 1.0% (w/v) SDS. |
| CAS | 151-21-3 |
| Protease | Protease free |
| Synonym | TG-SDS |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
TAE Buffer, Tris-Acetate-EDTA, 50X Solution, Electrophoresis, Fisher BioReagents™
Tris-Acetate-EDTA, CAS Number-77-86-1, 60-00-4, 6850-28-8, TAE, 4L, Gray, Tris (24%), Acetic Acid (5.0%), and EDTA (<2%)., DNase free, Pass Test, Filtered through a 0.2-micron filter., Electrophoresis, 50X Solution, Poly CUBE, Liquid, Protease free, DNase-, RNase- and Protease-Free, RT
| Name Note | 50X Solution |
|---|---|
| Concentration or Composition (by Analyte or Components) | Tris (24%), Acetic Acid (5.0%), and EDTA (<2%). |
| CAS | 6850-28-8 |
| Protease | Protease free |
| Physical Form | Liquid |
| Grade | Electrophoresis |
| Synonym | TAE |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| DNase | DNase free |
| Recommended Storage | RT |
| Filtered Through | Filtered through a 0.2-micron filter. |
| ChemAlert Storage Symbol | Gray |
TEMED (Electrophoresis), Fisher BioReagents
CAS: 110-18-9 Molecular Formula: C6H16N2 Molecular Weight (g/mol): 116.208 InChI Key: KWYHDKDOAIKMQN-UHFFFAOYSA-N Synonym: temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl PubChem CID: 8037 ChEBI: CHEBI:32850 IUPAC Name: N,N,N',N'-tetramethylethane-1,2-diamine SMILES: CN(C)CCN(C)C
| PubChem CID | 8037 |
|---|---|
| CAS | 110-18-9 |
| Molecular Weight (g/mol) | 116.208 |
| ChEBI | CHEBI:32850 |
| SMILES | CN(C)CCN(C)C |
| Synonym | temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl |
| IUPAC Name | N,N,N',N'-tetramethylethane-1,2-diamine |
| InChI Key | KWYHDKDOAIKMQN-UHFFFAOYSA-N |
| Molecular Formula | C6H16N2 |
Dithiothreitol (White Crystals or Powder/Electrophoresis), Fisher BioReagents™
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Acrylamide: Bis-Acrylamide 29:1 (40% Solution/Electrophoresis), Fisher BioReagents
CAS: 79-06-1 | C3H5NO | 71.08 g/mol
Triton™ X-100 (Electrophoresis), Fisher BioReagents™
CAS: 9002-93-1 Molecular Formula: C16H26O2 Molecular Weight (g/mol): 250.38 MDL Number: MFCD00132505 InChI Key: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyethylene Glycol p-tert-Octylphenyl Ether PubChem CID: 5590 SMILES: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| PubChem CID | 5590 |
|---|---|
| CAS | 9002-93-1 |
| Molecular Weight (g/mol) | 250.38 |
| MDL Number | MFCD00132505 |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| Synonym | Polyethylene Glycol p-tert-Octylphenyl Ether |
| InChI Key | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molecular Formula | C16H26O2 |
Boric Acid (Crystalline/Electrophoresis), Fisher BioReagents
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Ammonium Persulfate (Colorless-to-White Crystals/Electrophoresis), Fisher BioReagents™
CAS: 7727-54-0 Molecular Formula: H8N2O8S2 Molecular Weight (g/mol): 228.19 MDL Number: MFCD00003390 InChI Key: ROOXNKNUYICQNP-UHFFFAOYSA-N Synonym: ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french PubChem CID: 62648 IUPAC Name: diazanium;sulfonatooxy sulfate SMILES: [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O
| PubChem CID | 62648 |
|---|---|
| CAS | 7727-54-0 |
| Molecular Weight (g/mol) | 228.19 |
| MDL Number | MFCD00003390 |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| Synonym | ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french |
| IUPAC Name | diazanium;sulfonatooxy sulfate |
| InChI Key | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| Molecular Formula | H8N2O8S2 |
| Color | Undesignated |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Tris-Glycine |
| Grade | Electrophoresis |
| DNase | DNase free |
| Filtered Through | Filtered through a 0.2-micron filter. |
| ChemAlert Storage Symbol | Gray |
| Name Note | 10X Solution |
| Concentration or Composition (by Analyte or Components) | Components: Tris (2-3%) and Glycine (13-14%). 0.25M Tris Base and 1.92M Glycine. |
| CAS | 56-40-6 |
| Protease | Protease free |
| Synonym | TG |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |