Reactive Nonmetal Salts
Filtered Search Results
Sulfaguanidine, 98%, Thermo Scientific Chemicals
CAS: 57-67-0 Molecular Formula: C7H10N4O2S Molecular Weight (g/mol): 214.25 MDL Number: MFCD00038136 InChI Key: BRBKOPJOKNSWSG-UHFFFAOYSA-N Synonym: sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil PubChem CID: 5324 IUPAC Name: 2-(4-aminophenyl)sulfonylguanidine SMILES: C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N
| PubChem CID | 5324 |
|---|---|
| CAS | 57-67-0 |
| Molecular Weight (g/mol) | 214.25 |
| MDL Number | MFCD00038136 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N |
| Synonym | sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil |
| IUPAC Name | 2-(4-aminophenyl)sulfonylguanidine |
| InChI Key | BRBKOPJOKNSWSG-UHFFFAOYSA-N |
| Molecular Formula | C7H10N4O2S |
| Linear Formula | PBr2 |
|---|---|
| Molecular Weight (g/mol) | 270.69 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Phosphorus tribromide |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Density | 1.4880g/mL |
| PubChem CID | 24614 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00011436 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| Molecular Formula | Br3P |
| EINECS Number | 232-178-2 |
| Formula Weight | 270.69 |
| Specific Gravity | 1.488 |
Phosphorus pentoxide, 99+%, for analysis
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric anhydride IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphoric anhydride |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Phosphorus tribromide, 99%
CAS: 7789-60-8 Molecular Formula: Br3P Molecular Weight (g/mol): 270.69 MDL Number: MFCD00011436 InChI Key: IPNPIHIZVLFAFP-UHFFFAOYSA-N Synonym: phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine PubChem CID: 24614 IUPAC Name: tribromophosphane SMILES: P(Br)(Br)Br
| PubChem CID | 24614 |
|---|---|
| CAS | 7789-60-8 |
| Molecular Weight (g/mol) | 270.69 |
| MDL Number | MFCD00011436 |
| SMILES | P(Br)(Br)Br |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Molecular Formula | Br3P |
Phosphorus oxybromide, 95%
CAS: 7789-59-5 Molecular Formula: Br3OP Molecular Weight (g/mol): 286.69 InChI Key: UXCDUFKZSUBXGM-UHFFFAOYSA-N Synonym: phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 PubChem CID: 24613 SMILES: O=P(Br)(Br)Br
| PubChem CID | 24613 |
|---|---|
| CAS | 7789-59-5 |
| Molecular Weight (g/mol) | 286.69 |
| SMILES | O=P(Br)(Br)Br |
| Synonym | phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 |
| InChI Key | UXCDUFKZSUBXGM-UHFFFAOYSA-N |
| Molecular Formula | Br3OP |
Phosphorus pentoxide, 98%, extra pure
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric anhydride IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphoric anhydride |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Hydrazine sulfate, ACS reagent
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
Phosphorus pentoxide, 98+%, ACS reagent
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric anhydride IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphoric anhydride |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Nitrosonium hexafluorophosphate, 95%
CAS: 16921-91-8 Molecular Formula: F6NOP Molecular Weight (g/mol): 174.97 MDL Number: MFCD00040324 InChI Key: SAKPNYRUBHJGAR-UHFFFAOYSA-N Synonym: nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium PubChem CID: 10910083 IUPAC Name: azanylidyneoxidanium;hexafluorophosphate SMILES: N#[O+].F[P-](F)(F)(F)(F)F
| PubChem CID | 10910083 |
|---|---|
| CAS | 16921-91-8 |
| Molecular Weight (g/mol) | 174.97 |
| MDL Number | MFCD00040324 |
| SMILES | N#[O+].F[P-](F)(F)(F)(F)F |
| Synonym | nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium |
| IUPAC Name | azanylidyneoxidanium;hexafluorophosphate |
| InChI Key | SAKPNYRUBHJGAR-UHFFFAOYSA-N |
| Molecular Formula | F6NOP |
Phosphoric acid, 85% w/w aq. soln., ACS
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: MFCD00011340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | MFCD00011340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Phosphorus(V) oxide, 98%
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphorus pentoxide IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphorus pentoxide |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Oxone∣r, monopersulfate
CAS: 70693-62-8 Molecular Formula: H3K5O18S4 Molecular Weight (g/mol): 614.74 MDL Number: MFCD00040551 InChI Key: HJKYXKSLRZKNSI-UHFFFAOYSA-I Synonym: Potassium peroxymonosulfate,Potassium monopersulfate triple salt
| CAS | 70693-62-8 |
|---|---|
| Molecular Weight (g/mol) | 614.74 |
| MDL Number | MFCD00040551 |
| Synonym | Potassium peroxymonosulfate,Potassium monopersulfate triple salt |
| InChI Key | HJKYXKSLRZKNSI-UHFFFAOYSA-I |
| Molecular Formula | H3K5O18S4 |
Phosphorus pentabromide, 95%
CAS: 7789-69-7 Molecular Formula: Br5P Molecular Weight (g/mol): 430.49 MDL Number: MFCD00011437 InChI Key: QRKVRHZNLKTPGF-UHFFFAOYSA-N Synonym: phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide PubChem CID: 62678 IUPAC Name: pentabromo-$l^{5}-phosphane SMILES: P(Br)(Br)(Br)(Br)Br
| PubChem CID | 62678 |
|---|---|
| CAS | 7789-69-7 |
| Molecular Weight (g/mol) | 430.49 |
| MDL Number | MFCD00011437 |
| SMILES | P(Br)(Br)(Br)(Br)Br |
| Synonym | phosphorus pentabromide,phosphorane, pentabromo,unii-3d9wis0bqw,pentabromophosphorane,phosphorus v bromide,3d9wis0bqw,pentabromo,phosphorpentabromid,phosphoruspentabromide,phosphorouspentabromide |
| IUPAC Name | pentabromo-$l^{5}-phosphane |
| InChI Key | QRKVRHZNLKTPGF-UHFFFAOYSA-N |
| Molecular Formula | Br5P |
Sulfuryl chloride, 1.0M solution in dichloromethane, AcroSeal™
CAS: 7791-25-5 | Cl2O2S | 134.96 g/mol
| Linear Formula | SO2Cl2 |
|---|---|
| Molecular Weight (g/mol) | 134.96 |
| ChEBI | CHEBI:29291 |
| Chemical Name or Material | Sulfuryl chloride |
| SMILES | ClS(Cl)(=O)=O |
| Merck Index | 15, 9110 |
| InChI Key | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| Density | 1.3520g/mL |
| Appearance | Clear pale yellow solution |
| PubChem CID | 24648 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 1M, exact strength on the certificate of analysis |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011451 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Toxic if inhaled. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| IUPAC Name | sulfuryl dichloride |
| Molecular Formula | Cl2O2S |
| EINECS Number | 232-245-6 |
| Formula Weight | 134.97 |
| Specific Gravity | 1.352 |
Phosphonitrilic chloride trimer, 98%
CAS: 940-71-6 Molecular Formula: Cl6N3P3 Molecular Weight (g/mol): 347.65 MDL Number: MFCD00006474 InChI Key: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC Name: 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene SMILES: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| PubChem CID | 220225 |
|---|---|
| CAS | 940-71-6 |
| Molecular Weight (g/mol) | 347.65 |
| MDL Number | MFCD00006474 |
| SMILES | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| IUPAC Name | 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene |
| InChI Key | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| Molecular Formula | Cl6N3P3 |