Learn More
2,3-Diaminonaphthalene, 97%, ACROS Organics™
Brand: Acros Organics 159590010
Code : 29
Additional Details : CAS Number : 771-97-1 Weight : 0.00100kg
Packaging | Glass bottle |
---|---|
Quantity | 1g |
Chemical Identifiers
771-97-1 | |
158.2 | |
2,3-diaminonaphthalene, 2,3-naphthalenediamine, 2,3-naphthylenediamine, unii-2bnz6brs87, 2bnz6brs87, ccris 8399, zlchem 848, 2,3-diaminonapthalene, 2,3 diaminonapthalene, pubchem15532 | |
naphthalene-2,3-diamine |
C10H10N2 | |
XTBLDMQMUSHDEN-UHFFFAOYSA-N | |
69872 | |
C1=CC=C2C=C(C(=CC2=C1)N)N |
Specifications
2,3-Diaminonaphthalene | |
>110°C | |
Glass bottle | |
Brown to Brown-Green | |
1g | |
96% min. (HPLC) | |
C10H6(NH2)2 | |
2,3-diaminonaphthalene, 2,3-naphthalenediamine, 2,3-naphthylenediamine, unii-2bnz6brs87, 2bnz6brs87, ccris 8399, zlchem 848, 2,3-diaminonapthalene, 2,3 diaminonapthalene, pubchem15532 | |
XTBLDMQMUSHDEN-UHFFFAOYSA-N | |
naphthalene-2,3-diamine | |
69872 | |
Crystalline Powder |
1.0968g/mL | |
Authentic | |
1.0968 | |
193.0°C to 199.0°C | |
771-97-1,91-59-8 | |
C10H10N2 | |
13,207 | |
Solubility in water: < 0.1% (20°C). | |
C1=CC=C2C=C(C(=CC2=C1)N)N | |
158.2 | |
158.2 | |
97% |