Learn More
4,5-Dihydroxynaphthalene-2,7-disulfonic Acid, Disodium Salt Dihydrate, 98%, ACROS Organics™
4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate, 98%, C10H6Na2O8S2.2H2O, CAS Number-5808-22-0
Brand: Acros Organics 155191000
Code : 29
Additional Details : CAS Number : 5808-22-0 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Description
4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate, 98%, C10H6Na2O8S2.2H2O, CAS Number-5808-22-0
Chemical Identifiers
| 5808-22-0 | |
| 318.27 | |
| HLVXFWDLRHCZEI-UHFFFAOYSA-L | |
| 124202444 | |
| OC1=CC(=CC2=CC(=CC(O)=C12)S([O-])(=O)=O)S([O-])(=O)=O |
| C10H6O8S2 | |
| MFCD00150612 | |
| chromotropic acid sodium salt, 4,5-dihydroxy-2,7-naphthalenedisulfonate, di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid, 4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g | |
| 4,5-dihydroxynaphthalene-2,7-disulfonic acid;sodium;dihydrate |
Specifications
| 4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate | |
| 0.02% max. (in water) | |
| (for NO3 and HCHO determination) passes | |
| >300.0°C | |
| 5808-22-0 | |
| 100.0 | |
| C10H6O8S2 | |
| 11, 307 | |
| chromotropic acid sodium salt, 4,5-dihydroxy-2,7-naphthalenedisulfonate, di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid, 4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g | |
| HLVXFWDLRHCZEI-UHFFFAOYSA-L | |
| 4,5-dihydroxynaphthalene-2,7-disulfonic acid;sodium;dihydrate | |
| 124202444 | |
| Powder |
| Authentic | |
| Glass bottle | |
| Beige-Gray to White or Brown | |
| 100g | |
| 97.5 | |
| 98% | |
| MFCD00150612 | |
| 15, 2245 | |
| Solubility in water: very soluble | |
| OC1=CC(=CC2=CC(=CC(O)=C12)S([O-])(=O)=O)S([O-])(=O)=O | |
| 318.27 | |
| 400.28 | |
| 98% |
Safety and Handling
- 4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.