Learn More
D(+)-Biotin, 98%, ACROS Organics™
Brand: Acros Organics 230090250
Code : 29
Additional Details : CAS Number : 58-85-5 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 58-85-5 | |
| 244.31 | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 171548 | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| C10H16N2O3S | |
| MFCD00005541 | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| CHEBI:15956 | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 |
Specifications
| D(+)-Biotin | |
| + 89.00 (20.00°C c=1,0.1N NaOH) | |
| 231.0°C to 233.0°C | |
| 58-85-5 | |
| C10H16N2O3S | |
| 15,1236 | |
| Solubility in water: 0.22g/L (25°C). Other solubilities: more soluble in hot water and dil. alkali,0.8g/L alcohol,insoluble in most other common organic solvents | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 | |
| 244.31 | |
| CHEBI:15956 | |
| 98% |
| Glass bottle | |
| + 89.00 | |
| 25g | |
| 98% | |
| MFCD00005541 | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid | |
| 171548 | |
| 244.31 |