Learn More
Dibenzothiophene, 98%, ACROS Organics™
Brand: Acros Organics 112542500
Code : 29
Additional Details : CAS Number : 132-65-0 Weight : 0.30000kg Transport : UN number : 3077 Chem class : 9 Pack group : III
| Packaging | Plastic bottle |
|---|---|
| Quantity | 250g |
Chemical Identifiers
| 132-65-0 | |
| 184.26 | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| 3023 | |
| dibenzothiophene |
| C12H8S | |
| MFCD00004969 | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| CHEBI:23681 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
Specifications
| Dibenzothiophene | |
| Authentic | |
| 332°C to 333°C | |
| 97°C to 100°C | |
| 132-65-0 | |
| C12H8S | |
| 17,72 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol,benzene,chloroform | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 | |
| 184.26 | |
| CHEBI:23681 | |
| Crystalline Powder and/or Chunks |
| 170°C | |
| Plastic bottle | |
| Gray-Green to White | |
| 250g | |
| 97.5% min. (GC) | |
| MFCD00004969 | |
| diphenylene sulfide, dibenzo b,d thiophene, 9-thiafluorene, alpha-thiafluorene, 2,2'-biphenylylene sulfide, usan, unii-z3d4aj1r48, 1,1'-biphenyl-2,2'-diyl sulfide, .alpha.-thiafluorene | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| dibenzothiophene | |
| 3023 | |
| 184.26 | |
| 98% |