Learn More
Diethyl phenylmalonate, 98%, ACROS Organics™
Brand: Acros Organics 150261000
Code : 29
Additional Details : CAS Number : 83-13-6 Weight : 0.15900kg
Packaging | Glass bottle |
---|---|
Quantity | 100mL |
Chemical Identifiers
83-13-6 | |
236.27 | |
FGYDHYCFHBSNPE-UHFFFAOYSA-N | |
66514 | |
CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC |
C13H16O4 | |
MFCD00009144 | |
diethyl phenylmalonate, diethyl 2-phenylmalonate, phenylmalonic acid diethyl ester, propanedioic acid, phenyl-, diethyl ester, diethylphenylmalonate, 1,3-diethyl 2-phenylpropanedioate, malonic acid, phenyl-, diethyl ester, propanedioic acid, 2-phenyl-, 1,3-diethyl ester, diethyl 2-phenylpropane-1,3-dioate, diethyl-phenylmalonate | |
diethyl 2-phenylpropanedioate |
Specifications
Diethyl phenylmalonate | |
>112°C | |
Glass bottle | |
1.09 | |
170.0°C to 172.0°C (14.0mmHg) | |
16.0°C to 17.0°C | |
83-13-6 | |
C13H16O4 | |
MFCD00009144 | |
diethyl phenylmalonate, diethyl 2-phenylmalonate, phenylmalonic acid diethyl ester, propanedioic acid, phenyl-, diethyl ester, diethylphenylmalonate, 1,3-diethyl 2-phenylpropanedioate, malonic acid, phenyl-, diethyl ester, propanedioic acid, 2-phenyl-, 1,3-diethyl ester, diethyl 2-phenylpropane-1,3-dioate, diethyl-phenylmalonate | |
FGYDHYCFHBSNPE-UHFFFAOYSA-N | |
diethyl 2-phenylpropanedioate | |
66514 | |
Liquid After Melting |
1.0900g/mL | |
Authentic | |
1.4903 to 1.4923 | |
0.05% max. | |
Colorless to Yellow | |
100mL | |
97.5% min. (GC) | |
C2H5O2CCH(C6H5)CO2C2H5 | |
09, 854 | |
Solubility in water: immiscible | |
CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC | |
236.27 | |
236.27 | |
98% |