Learn More
L(+)-Ascorbic Acid, 99%, Thermo Scientific™
Brand: Thermo Scientific Acros 105020025
Code : 29
Additional Details : CAS Number : 50-81-7 Weight : 2.55000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 2.5kg |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 50-81-7 | |
| 176.13 | |
| CIWBSHSKHKDKBQ-JLAZNSOCSA-N | |
| 54670067 | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| C6H8O6 | |
| MFCD00064328 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CHEBI:29073 | |
| C(C(C1C(=C(C(=O)O1)O)O)O)O |
Specifications
| L(+)-Ascorbic acid | |
| 50-81-7 | |
| 2.1 to 2.6 (5% aq. soln.) | |
| 190.0°C to 192.0°C | |
| Authentic | |
| MFCD00064328 | |
| Plastic bottle | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| (5% in water) Passes test | |
| C(C(C1C(=C(C(=O)O1)O)O)O)O | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | |
| 176.13 | |
| CHEBI:29073 | |
| Crystalline Powder or Crystals | |
| 99% |
| 99% | |
| (5% aq. soln.) Passes Test | |
| White | |
| 98.5% min. (Iodimetry) | |
| C6H8O6 | |
| 18, IV, 3038 | |
| 15, 819 | |
| 2.5kg | |
| CIWBSHSKHKDKBQ-JLAZNSOCSA-N | |
| + 20.50 (20.00°C c=10,H2O) | |
| + 20.50 | |
| 54670067 | |
| 176.13 | |
| 0.1% max. |
RUO – Research Use Only