Learn More
N-(tert-Butoxycarbonyl)-L-valine N'-methoxy-N'-methylamide, 97%, ACROS Organics™
Brand: Acros Organics 440580050
Code : 29
Additional Details : CAS Number : 87694-52-8 Weight : 0.05500kg
| Quantity | 5g |
|---|
Chemical Identifiers
| 87694-52-8 | |
| 260.34 | |
| s-2-boc-amino-n-methoxy-n,3-dimethylbutanamide, n-boc-l-valine n'-methoxy-n'-methylamide, n-tert-butoxycarbonyl-l-valine n'-methoxy-n'-methylamide, tert-butyl s-1-methoxy methyl amino-3-methyl-1-oxobutan-2-yl carbamate, tert-butyl n-1s-1-methoxy methyl carbamoyl-2-methylpropyl carbamate, boc-val-n och3 ch3, n-boc-l-valinen'-methoxy-n'-methylamide, n-alpha-t-butyloxycarbonyl-n-methyl-n-methoxy-l-valine amide, 2s-2-tert-butoxy carbonylamino-n-methoxy-3-methyl-n-methylbutanamide | |
| tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| C12H24N2O4 | |
| RRBFCGUIFHFYQK-VIFPVBQESA-N | |
| 10083961 | |
| CC(C)C(C(=O)N(C)OC)NC(=O)OC(C)(C)C |
Specifications
| N-(tert-Butoxycarbonyl)-L-valine N'-methoxy-N'-methylamide | |
| Authentic | |
| 248°C | |
| 34°C to 37°C | |
| 87694-52-8 | |
| 100.0 | |
| C12H24N2O4 | |
| RRBFCGUIFHFYQK-VIFPVBQESA-N | |
| tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate | |
| 10083961 | |
| Low Melting Solid or Liquid |
| 113°C | |
| -15 | |
| White to Yellow | |
| 5g | |
| 96.0 | |
| 96% min. (GC) | |
| s-2-boc-amino-n-methoxy-n,3-dimethylbutanamide, n-boc-l-valine n'-methoxy-n'-methylamide, n-tert-butoxycarbonyl-l-valine n'-methoxy-n'-methylamide, tert-butyl s-1-methoxy methyl amino-3-methyl-1-oxobutan-2-yl carbamate, tert-butyl n-1s-1-methoxy methyl carbamoyl-2-methylpropyl carbamate, boc-val-n och3 ch3, n-boc-l-valinen'-methoxy-n'-methylamide, n-alpha-t-butyloxycarbonyl-n-methyl-n-methoxy-l-valine amide, 2s-2-tert-butoxy carbonylamino-n-methoxy-3-methyl-n-methylbutanamide | |
| CC(C)C(C(=O)N(C)OC)NC(=O)OC(C)(C)C | |
| 260.34 | |
| 260.34 | |
| 97% |
Safety and Handling
- N-(tert-Butoxycarbonyl)-L-valine N'-methoxy-N'-methylamine