Learn More
Pyronin Y, pure, high purity biological stain, ACROS Organics™
Brand: Acros Organics 200100250
Code : 29
Additional Details : CAS Number : 92-32-0 Weight : 0.02500kg
Packaging | Glass bottle |
---|---|
Quantity | 25g |
Chemical Identifiers
92-32-0 | |
302.802 | |
INCIMLINXXICKS-UHFFFAOYSA-M | |
7085 | |
[6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;chloride |
C17H19ClN2O | |
MFCD00011725 | |
C.I. 45005, Pyronin G | |
CHEBI:87347 | |
CN(C)C1=CC2=C(C=C1)C=C3C=CC(=[N+](C)C)C=C3O2.[Cl-] |
Specifications
Pyronin Y | |
92-32-0 | |
50% min. | |
MFCD00011725 | |
15, 8119 | |
INCIMLINXXICKS-UHFFFAOYSA-M | |
CN(C)C1=CC2=C(C=C1)C=C3C=CC(=[N+](C)C)C=C3O2.[Cl-] | |
302.802 | |
7085 | |
302.79 | |
Pure | |
Green |
Pure | |
1.23 to 1.7 | |
C17H19ClN2O | |
18, V,10, 181 | |
C.I. 45005, Pyronin G | |
Authentic | |
[6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;chloride | |
546 to 551nm (in 50% ethanol) | |
CHEBI:87347 | |
Crystalline Powder | |
Glass bottle | |
25g |
Safety and Handling
- Pyronin Y
Signal Word
- Warning
Hazard Category
- Germ cell mutagenicity Category 2
Hazard Statement
- H341-Suspected of causing genetic defects.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.