Learn More
(R)-N-BOC-α-Ethylalanine, 98%, 98% ee, ACROS Organics™
Brand: Acros Organics 441061000
Code : 29
Additional Details : CAS Number : 123254-58-0 Weight : 0.05010kg
Quantity | 100mg |
---|
Chemical Identifiers
123254-58-0 | |
217.27 | |
boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
(2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
C10H19NO4 | |
SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
14284791 | |
CCC(C)(C(=O)O)NC(=O)OC(C)(C)C |
Specifications
(R)-N-BOC-α-Ethylalanine | |
Authentic | |
-12 | |
104°C to 112°C | |
98% ee | |
97.5 | |
98% | |
boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
CCC(C)(C(=O)O)NC(=O)OC(C)(C)C | |
217.27 | |
217.27 | |
98%,98% ee |
98% min. (HPLC) | |
Glass Bottle | |
White to Yellow | |
100mg | |
123254-58-0 | |
100.0 | |
C10H19NO4 | |
SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
(2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | |
14284791 | |
Powder |
Safety and Handling
- (R)-N-BOC-alpha-Ethylalanine