Learn More
Staurosporine, Fisher BioReagents
Brand: Fisher Bioreagents BP2541-500
Code : A0
Additional Details : CAS Number : 62996-74-1 Weight : 0.01000kg
| Packaging | Poly Micro Tube |
|---|---|
| Quantity | 500μg |
Description
Staurosporine is a potent protein kinase inhibitor useful for studies on protein phosphorylation in the regulation of cellular functions.Chemical Identifiers
| 62996-74-1 | |
| 466.541 | |
| staurosporine, kinome_3629 | |
| CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC |
| C28H26N4O3 | |
| HKSZLNNOFSGOKW-ZYSRIHRCSA-N | |
| 49831000 |
Specifications
| 500μg | |
| Pass Test | |
| Pass Test | |
| 270°C | |
| 62996-74-1 | |
| C28H26N4O3 | |
| staurosporine, kinome_3629 | |
| CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC | |
| 49831000 | |
| Solid |
| Staurosporine | |
| Poly Micro Tube | |
| White | |
| From Streptomyces sp. | |
| > 98.0 % | |
| 15, 8928 | |
| HKSZLNNOFSGOKW-ZYSRIHRCSA-N | |
| 466.541 | |
| 466.5 | |
| > 98.0% |
Safety and Handling
- Staurosporine
Signal Word
- Warning
Hazard Category
- Carcinogenicity Category 2
Hazard Statement
- H351-Suspected of causing cancer.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.