Organic acids and derivatives
Filtered Search Results
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
Citric acid monohydrate, 99+%, ACS reagent
CAS: 5949-29-1 Molecular Formula: C6H8O7·H2O Molecular Weight (g/mol): 210.15 InChI Key: YASYEJJMZJALEJ-UHFFFAOYSA-N Synonym: citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp PubChem CID: 22230 ChEBI: CHEBI:31404 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O
| PubChem CID | 22230 |
|---|---|
| CAS | 5949-29-1 |
| Molecular Weight (g/mol) | 210.15 |
| ChEBI | CHEBI:31404 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Synonym | citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| InChI Key | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7·H2O |
Propyl gallate, 98%
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.2 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N Synonym: propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate PubChem CID: 4947 ChEBI: CHEBI:10607 IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 4947 |
|---|---|
| CAS | 121-79-9 |
| Molecular Weight (g/mol) | 212.2 |
| ChEBI | CHEBI:10607 |
| MDL Number | MFCD00002196 |
| SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
1-Octanesulfonic acid, sodium salt monohydrate, 98%
CAS: 207596-29-0 Molecular Formula: C8H19NaO4S Molecular Weight (g/mol): 234.29 MDL Number: MFCD00149551 InChI Key: MBURIAHQXJQKRE-UHFFFAOYSA-M Synonym: sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate PubChem CID: 23666339 IUPAC Name: sodium;octane-1-sulfonate;hydrate SMILES: O.[Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23666339 |
|---|---|
| CAS | 207596-29-0 |
| Molecular Weight (g/mol) | 234.29 |
| MDL Number | MFCD00149551 |
| SMILES | O.[Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate |
| IUPAC Name | sodium;octane-1-sulfonate;hydrate |
| InChI Key | MBURIAHQXJQKRE-UHFFFAOYSA-M |
| Molecular Formula | C8H19NaO4S |
Diethylenetriaminepentaacetic acid, 98+%
CAS: 67-43-6 Molecular Formula: C14H23N3O10 Molecular Weight (g/mol): 393.34 InChI Key: QPCDCPDFJACHGM-UHFFFAOYSA-N Synonym: pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid PubChem CID: 3053 ChEBI: CHEBI:35739 IUPAC Name: 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid SMILES: C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O
| PubChem CID | 3053 |
|---|---|
| CAS | 67-43-6 |
| Molecular Weight (g/mol) | 393.34 |
| ChEBI | CHEBI:35739 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Synonym | pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| InChI Key | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| Molecular Formula | C14H23N3O10 |
Phenazine methosulfate, 98%
CAS: 299-11-6 Molecular Formula: C13H11N2·CH3O4S Molecular Weight (g/mol): 306.33 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.33 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C13H11N2·CH3O4S |
Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for analysis
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Calcium propionate, 98+%
CAS: 4075-81-4 Molecular Formula: C6H10CaO4 Molecular Weight (g/mol): 186.22 MDL Number: MFCD00167354 InChI Key: BCZXFFBUYPCTSJ-UHFFFAOYSA-L Synonym: calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 PubChem CID: 19999 ChEBI: CHEBI:81716 IUPAC Name: calcium;propanoate SMILES: [Ca++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 19999 |
|---|---|
| CAS | 4075-81-4 |
| Molecular Weight (g/mol) | 186.22 |
| ChEBI | CHEBI:81716 |
| MDL Number | MFCD00167354 |
| SMILES | [Ca++].CCC([O-])=O.CCC([O-])=O |
| Synonym | calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 |
| IUPAC Name | calcium;propanoate |
| InChI Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Molecular Formula | C6H10CaO4 |
Oleamide
CAS: 301-02-0 Molecular Formula: C18H35NO Molecular Weight (g/mol): 281.48 InChI Key: FATBGEAMYMYZAF-MDZDMXLPSA-N IUPAC Name: (9E)-octadec-9-enamide SMILES: CCCCCCCC\C=C\CCCCCCCC(N)=O
| CAS | 301-02-0 |
|---|---|
| Molecular Weight (g/mol) | 281.48 |
| SMILES | CCCCCCCC\C=C\CCCCCCCC(N)=O |
| IUPAC Name | (9E)-octadec-9-enamide |
| InChI Key | FATBGEAMYMYZAF-MDZDMXLPSA-N |
| Molecular Formula | C18H35NO |
beta-Sitosterol, with ca. 10% campesterol, ca. 75% beta-sitosterol
CAS: 83-46-5 Molecular Formula: C29H50O InChI Key: KZJWDPNRJALLNS-VJSFXXLFSA-N Synonym: beta-sitosterol,sitosterol,cupreol,quebrachol,22,23-dihydrostigmasterol,azuprostat,triastonal,cinchol,rhamnol,harzol PubChem CID: 222284 ChEBI: CHEBI:27693
| PubChem CID | 222284 |
|---|---|
| CAS | 83-46-5 |
| ChEBI | CHEBI:27693 |
| Synonym | beta-sitosterol,sitosterol,cupreol,quebrachol,22,23-dihydrostigmasterol,azuprostat,triastonal,cinchol,rhamnol,harzol |
| InChI Key | KZJWDPNRJALLNS-VJSFXXLFSA-N |
| Molecular Formula | C29H50O |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Trimethyl phosphate, 99%
CAS: 512-56-1 Molecular Formula: C3H9O4P Molecular Weight (g/mol): 140.08 MDL Number: MFCD00008348 InChI Key: WVLBCYQITXONBZ-UHFFFAOYSA-N Synonym: trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech PubChem CID: 10541 ChEBI: CHEBI:46324 IUPAC Name: trimethyl phosphate SMILES: COP(=O)(OC)OC
| PubChem CID | 10541 |
|---|---|
| CAS | 512-56-1 |
| Molecular Weight (g/mol) | 140.08 |
| ChEBI | CHEBI:46324 |
| MDL Number | MFCD00008348 |
| SMILES | COP(=O)(OC)OC |
| Synonym | trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech |
| IUPAC Name | trimethyl phosphate |
| InChI Key | WVLBCYQITXONBZ-UHFFFAOYSA-N |
| Molecular Formula | C3H9O4P |
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
CAS: 333338-18-4 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 333338-18-4 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |