Isobenzofurans
Filtered Search Results
4',5'-Dibromofluorescein, Thermo Scientific™
CAS: 596-03-2 Molecular Formula: C20H10Br2O5 Molecular Weight (g/mol): 490.11 InChI Key: ZDTNHRWWURISAA-UHFFFAOYSA-N Synonym: 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 PubChem CID: 11689 IUPAC Name: 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O
| PubChem CID | 11689 |
|---|---|
| CAS | 596-03-2 |
| Molecular Weight (g/mol) | 490.11 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O |
| Synonym | 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 |
| IUPAC Name | 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | ZDTNHRWWURISAA-UHFFFAOYSA-N |
| Molecular Formula | C20H10Br2O5 |
Thermo Scientific Chemicals Rose Bengal
CAS: 632-69-9 Molecular Formula: C20H4Cl4I4Na2O5 Molecular Weight (g/mol): 1019.644 MDL Number: MFCD00151169 InChI Key: DPBQSRZQYAYDGY-UHFFFAOYSA-N Synonym: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 IUPAC Name: sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
| PubChem CID | 87244310 |
|---|---|
| CAS | 632-69-9 |
| Molecular Weight (g/mol) | 1019.644 |
| MDL Number | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Synonym | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
| IUPAC Name | sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| Molecular Formula | C20H4Cl4I4Na2O5 |
Thermo Scientific Chemicals Fluorescein
CAS: 2321-07-5 Molecular Formula: C20H12O5 Molecular Weight (g/mol): 332.31 MDL Number: MFCD00005050 InChI Key: GNBHRKFJIUUOQI-UHFFFAOYSA-N Synonym: fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 PubChem CID: 16850 ChEBI: CHEBI:31624 IUPAC Name: 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
| PubChem CID | 16850 |
|---|---|
| CAS | 2321-07-5 |
| Molecular Weight (g/mol) | 332.31 |
| ChEBI | CHEBI:31624 |
| MDL Number | MFCD00005050 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Synonym | fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| Molecular Formula | C20H12O5 |
Thermo Scientific Chemicals Fluorescein diacetate, 97%, pure
CAS: 596-09-8 Molecular Formula: C24H16O7 Molecular Weight (g/mol): 416.39 MDL Number: MFCD00005062 InChI Key: CHADEQDQBURGHL-UHFFFAOYSA-N Synonym: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 IUPAC Name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
| PubChem CID | 65047 |
|---|---|
| CAS | 596-09-8 |
| Molecular Weight (g/mol) | 416.39 |
| MDL Number | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Synonym | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Molecular Formula | C24H16O7 |
Thermo Scientific Chemicals Fluorescein isothiocyanate, isomer 1, 95%
CAS: 3326-32-7 Molecular Formula: C21H11NO5S Molecular Weight (g/mol): 389.381 MDL Number: MFCD00005063 InChI Key: MHMNJMPURVTYEJ-UHFFFAOYSA-N Synonym: fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer PubChem CID: 18730 ChEBI: CHEBI:37918 IUPAC Name: 3',6'-dihydroxy-6-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
| PubChem CID | 18730 |
|---|---|
| CAS | 3326-32-7 |
| Molecular Weight (g/mol) | 389.381 |
| ChEBI | CHEBI:37918 |
| MDL Number | MFCD00005063 |
| SMILES | C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Synonym | fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer |
| IUPAC Name | 3',6'-dihydroxy-6-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | MHMNJMPURVTYEJ-UHFFFAOYSA-N |
| Molecular Formula | C21H11NO5S |
Thermo Scientific Chemicals 4',5'-Dibromofluorescein, ca. 95% dye content
CAS: 596-03-2 Molecular Formula: C20H10Br2O5 Molecular Weight (g/mol): 490.103 MDL Number: MFCD00005042 InChI Key: ZDTNHRWWURISAA-UHFFFAOYSA-N Synonym: 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 PubChem CID: 11689 IUPAC Name: 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O
| PubChem CID | 11689 |
|---|---|
| CAS | 596-03-2 |
| Molecular Weight (g/mol) | 490.103 |
| MDL Number | MFCD00005042 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O |
| Synonym | 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 |
| IUPAC Name | 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | ZDTNHRWWURISAA-UHFFFAOYSA-N |
| Molecular Formula | C20H10Br2O5 |
Thermo Scientific Alfa Aesar Fluorescein diacetate, 97%, Alfa Aesar™
CAS: 596-09-8 Molecular Formula: C24H16O7 Molecular Weight (g/mol): 416.385 MDL Number: MFCD00005062 InChI Key: CHADEQDQBURGHL-UHFFFAOYSA-N Synonym: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 IUPAC Name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
| PubChem CID | 65047 |
|---|---|
| CAS | 596-09-8 |
| Molecular Weight (g/mol) | 416.385 |
| MDL Number | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Synonym | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Molecular Formula | C24H16O7 |