Filtered Search Results
Thermo Scientific™ High-Purity Maltoside Detergents
Maltoside detergents are a class of nonionic surfactants that are commonly utilized in the field of membrane protein solubilization. Several studies have shown that these surfactants are highly effective in extracting and stabilizing membrane proteins.
Invitrogen™ BODIPY™ 500/510 C1, C12 (4,4-Difluoro-5-Methyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
Forms excimers and exhibits red-shifted fluorescence emission when incorporated into living cells
Thermo Fisher Scientific DDM/CHS Solution (10:1)
A ready-to-use solution for solubilization of membrane proteins while maintaining structural integrity and activity.
Invitrogen™ BODIPY™ FL C12 (4,4-Difluoro-5,7-Dimethyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
The green fluorescent fatty acid, BODIPY™ FL C12 can be used as a synthetic precursor to a wide variety of fluorescent phospholipids.
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
N,N-Dimethylacetamide, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Glycerol, 99+%, Extra Pure
CAS: 56-81-5 Molecular Formula: C3H8O3 Molecular Weight (g/mol): 92.09 MDL Number: MFCD00004722 InChI Key: PEDCQBHIVMGVHV-UHFFFAOYSA-N Synonym: glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn PubChem CID: 753 ChEBI: CHEBI:17754 IUPAC Name: propane-1,2,3-triol SMILES: OCC(O)CO
| PubChem CID | 753 |
|---|---|
| CAS | 56-81-5 |
| Molecular Weight (g/mol) | 92.09 |
| ChEBI | CHEBI:17754 |
| MDL Number | MFCD00004722 |
| SMILES | OCC(O)CO |
| Synonym | glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn |
| IUPAC Name | propane-1,2,3-triol |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3 |
| Molecular Weight (g/mol) | 122.02 |
|---|---|
| CAS Min % | 92.49 |
| Chemical Name or Material | 9-Borabicyclo[3.3.1]nonane |
| SMILES | [B]1C2CCCC1CCC2 |
| InChI Key | AMKGKYQBASDDJB-UHFFFAOYSA-N |
| Density | 0.8840g/mL |
| PubChem CID | 6327450 |
| Fieser | 02,31; 03,24; 04,41; 05,46; 06,62; 07,29; 08,47; 09,57; 10,48; 11,68; 13,92; 14,52; 15,43; 17,49; 01,732; 04,356 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00074742 |
| Health Hazard 2 | GHS H Statement In contact with water releases flammable gases. Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explo |
| Solubility Information | Solubility in water: reacts |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 9-borabicyclo 3.3.1 nonane,9-borabicyclo 3.3.1 nonan,9-borabicyclo 3,3,1 nonane,9$l^ 2-borabicyclo 3.3.1 nonane,1s,5s-9-borabicyclo 3.3.1 nonane,monomer; 21205-91-4 dimer,9-borabicyclo 3.3.1 nonane,9-bbn,intetrahydrofuran |
| IUPAC Name | 9$l^{2}-borabicyclo[3.3.1]nonane |
| Molecular Formula | C8H15B |
| EINECS Number | 206-000-9 |
| Formula Weight | 122.02 |
| Specific Gravity | 0.884 |
| CAS Max % | 93.86 |
Tetramethylammonium hydrogensulfate, 99+%, HPLC grade
CAS: 80526-82-5 Molecular Formula: C4H13NO4S Molecular Weight (g/mol): 171.21 MDL Number: MFCD00036149 InChI Key: DWTYPCUOWWOADE-UHFFFAOYSA-M Synonym: tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution PubChem CID: 157340 IUPAC Name: hydrogen sulfate;tetramethylazanium SMILES: C[N+](C)(C)C.OS(=O)(=O)[O-]
| PubChem CID | 157340 |
|---|---|
| CAS | 80526-82-5 |
| Molecular Weight (g/mol) | 171.21 |
| MDL Number | MFCD00036149 |
| SMILES | C[N+](C)(C)C.OS(=O)(=O)[O-] |
| Synonym | tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution |
| IUPAC Name | hydrogen sulfate;tetramethylazanium |
| InChI Key | DWTYPCUOWWOADE-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO4S |
2-Methylbutane, 99+%, extra pure
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9950g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Boiling Point | >100.0°C |
| Color | White to Yellow |
| Physical Form | Crystals or Powder |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.995 |
1,3-Dioxolane, 99.5+%, pure, stabilized
CAS: 646-06-0 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003207 InChI Key: WNXJIVFYUVYPPR-UHFFFAOYSA-N Synonym: dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech PubChem CID: 31404 ChEBI: CHEBI:34247 IUPAC Name: 2,6-ditert-butyl-4-methylphenol SMILES: CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 31404 |
|---|---|
| CAS | 646-06-0 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:34247 |
| MDL Number | MFCD00003207 |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Synonym | dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI Key | WNXJIVFYUVYPPR-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Tetrabutylammonium bromide, 99+%
CAS: 1643-19-2 Molecular Formula: C16H36BrN Molecular Weight (g/mol): 322.36 MDL Number: MFCD00011633 InChI Key: JRMUNVKIHCOMHV-UHFFFAOYSA-M Synonym: tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r PubChem CID: 74236 ChEBI: CHEBI:51993 IUPAC Name: tetrabutylazanium;bromide SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 74236 |
|---|---|
| CAS | 1643-19-2 |
| Molecular Weight (g/mol) | 322.36 |
| ChEBI | CHEBI:51993 |
| MDL Number | MFCD00011633 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r |
| IUPAC Name | tetrabutylazanium;bromide |
| InChI Key | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrN |
Isopropyl acetate, 99%, pure
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.13 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |