missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Lovastatin, 97%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar H52792.14
| Quantity | 25g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsLovastatin is a cholesterol lowering drug and competitive inhibitor of HMG-CoA reductase, a rate limiting enzyme in cholesterol synthesis. Blocks the production of mevalonate, a critical compound in the production of cholesterol and isoprenoids. It increases cellular resistance to anticancer agents such as doxorubicin and induces apoptosis in myeloma cells. It causes cell cycle arrest in G1 and G2/M phases.
Solubility
Soluble in DMSO (10 mg/ml), ethanol (10 mg/ml), methanol, chloroform, acetone, acetonitrile, DMF, and water (0.4 µg/ml).
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents and heat.
Kemiska identifierare
| 75330-75-5 | |
| 404.55 | |
| PCZOHLXUXFIOCF-BXMDZJJMSA-N | |
| 53232 | |
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate |
| C24H36O5 | |
| MFCD00072164 | |
| lovastatin, mevinolin, mevacor, monacolin k, lovalip, altoprev, lovalord, mevinacor, nergadan, 6alpha-methylcompactin | |
| CHEBI:40303 | |
| CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 |
Specifikationer
| 75330-75-5 | |
| MFCD00072164 | |
| lovastatin, mevinolin, mevacor, monacolin k, lovalip, altoprev, lovalord, mevinacor, nergadan, 6alpha-methylcompactin | |
| PCZOHLXUXFIOCF-BXMDZJJMSA-N | |
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate | |
| 53232 | |
| 404.56 | |
| Lovastatin |
| C24H36O5 | |
| 25g | |
| Soluble in DMSO (10mg/ml),ethanol (10mg/ml),methanol,chloroform,acetone,acetonitrile,DMF,and water (0.4 μg/ml). | |
| CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 | |
| 404.55 | |
| CHEBI:40303 | |
| 97% |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering