Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Tannic acid
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Tannic acid, ACS
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Boric acid, 99.8%
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Acetic acid, ammonium salt, 98+%, for HPLC
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Adipic acid, 99%
CAS: 124-04-9 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.142 MDL Number: MFCD00004420 InChI Key: WNLRTRBMVRJNCN-UHFFFAOYSA-N Synonym: adipic acid,adipinic acid,1,4-butanedicarboxylic acid,adilactetten,acifloctin,acinetten,1,6-hexanedioic acid,molten adipic acid,kyselina adipova,adipinsaure german PubChem CID: 196 ChEBI: CHEBI:30832 IUPAC Name: hexanedioic acid SMILES: C(CCC(=O)O)CC(=O)O
| PubChem CID | 196 |
|---|---|
| CAS | 124-04-9 |
| Molecular Weight (g/mol) | 146.142 |
| ChEBI | CHEBI:30832 |
| MDL Number | MFCD00004420 |
| SMILES | C(CCC(=O)O)CC(=O)O |
| Synonym | adipic acid,adipinic acid,1,4-butanedicarboxylic acid,adilactetten,acifloctin,acinetten,1,6-hexanedioic acid,molten adipic acid,kyselina adipova,adipinsaure german |
| IUPAC Name | hexanedioic acid |
| InChI Key | WNLRTRBMVRJNCN-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
Succinic acid, 99+%
CAS: 110-15-6 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00002789 InChI Key: KDYFGRWQOYBRFD-UHFFFAOYSA-N Synonym: succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid PubChem CID: 1110 ChEBI: CHEBI:15741 IUPAC Name: butanedioic acid SMILES: OC(=O)CCC(O)=O
| PubChem CID | 1110 |
|---|---|
| CAS | 110-15-6 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:15741 |
| MDL Number | MFCD00002789 |
| SMILES | OC(=O)CCC(O)=O |
| Synonym | succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid |
| IUPAC Name | butanedioic acid |
| InChI Key | KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
Boric acid, Puratronic™, 99.9995% (metals basis)
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Acetic acid, ammonium salt, 98+%, for analysis
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 MDL Number: MFCD00013066 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| MDL Number | MFCD00013066 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Benzoic acid, ACS, 99.5% min
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00002398 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.123 |
| ChEBI | CHEBI:30746 |
| MDL Number | MFCD00002398 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Boric acid, 98%
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Succinic acid, 99%
CAS: 110-15-6 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00002789 InChI Key: KDYFGRWQOYBRFD-UHFFFAOYSA-N Synonym: succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid PubChem CID: 1110 ChEBI: CHEBI:15741 IUPAC Name: butanedioic acid SMILES: OC(=O)CCC(O)=O
| PubChem CID | 1110 |
|---|---|
| CAS | 110-15-6 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:15741 |
| MDL Number | MFCD00002789 |
| SMILES | OC(=O)CCC(O)=O |
| Synonym | succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid |
| IUPAC Name | butanedioic acid |
| InChI Key | KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
DL-Malic acid, 99+%
CAS: 6915-15-7 Molecular Formula: C4H6O5 Molecular Weight (g/mol): 134.087 MDL Number: MFCD00064212 InChI Key: BJEPYKJPYRNKOW-UHFFFAOYSA-N Synonym: malic acid,dl-malic acid,2-hydroxysuccinic acid,malate,hydroxysuccinic acid,butanedioic acid, hydroxy,kyselina jablecna,pomalus acid,hydroxybutanedioic acid,deoxytetraric acid PubChem CID: 525 ChEBI: CHEBI:6650 IUPAC Name: 2-hydroxybutanedioic acid SMILES: C(C(C(=O)O)O)C(=O)O
| PubChem CID | 525 |
|---|---|
| CAS | 6915-15-7 |
| Molecular Weight (g/mol) | 134.087 |
| ChEBI | CHEBI:6650 |
| MDL Number | MFCD00064212 |
| SMILES | C(C(C(=O)O)O)C(=O)O |
| Synonym | malic acid,dl-malic acid,2-hydroxysuccinic acid,malate,hydroxysuccinic acid,butanedioic acid, hydroxy,kyselina jablecna,pomalus acid,hydroxybutanedioic acid,deoxytetraric acid |
| IUPAC Name | 2-hydroxybutanedioic acid |
| InChI Key | BJEPYKJPYRNKOW-UHFFFAOYSA-N |
| Molecular Formula | C4H6O5 |
Gallic acid, 98%
CAS: 149-91-7 Molecular Formula: C7H6O5 Molecular Weight (g/mol): 170.12 MDL Number: MFCD00002510 InChI Key: LNTHITQWFMADLM-UHFFFAOYSA-N Synonym: gallic acid,gallate,benzoic acid, 3,4,5-trihydroxy,gallic acid, tech.,galop,pyrogallol-5-carboxylic acid,kyselina gallova,3,4,5-trihydroxybenzoate,ccris 5523,kyselina gallova czech PubChem CID: 370 ChEBI: CHEBI:30778 IUPAC Name: 3,4,5-trihydroxybenzoic acid SMILES: OC(=O)C1=CC(O)=C(O)C(O)=C1
| PubChem CID | 370 |
|---|---|
| CAS | 149-91-7 |
| Molecular Weight (g/mol) | 170.12 |
| ChEBI | CHEBI:30778 |
| MDL Number | MFCD00002510 |
| SMILES | OC(=O)C1=CC(O)=C(O)C(O)=C1 |
| Synonym | gallic acid,gallate,benzoic acid, 3,4,5-trihydroxy,gallic acid, tech.,galop,pyrogallol-5-carboxylic acid,kyselina gallova,3,4,5-trihydroxybenzoate,ccris 5523,kyselina gallova czech |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| InChI Key | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Molecular Formula | C7H6O5 |
trans-Cinnamic Acid, 98+%
CAS: 140-10-3 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00004369 InChI Key: WBYWAXJHAXSJNI-VOTSOKGWSA-N Synonym: cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid PubChem CID: 444539 ChEBI: CHEBI:35697 IUPAC Name: (E)-3-phenylprop-2-enoic acid SMILES: C1=CC=C(C=C1)C=CC(=O)O
| PubChem CID | 444539 |
|---|---|
| CAS | 140-10-3 |
| Molecular Weight (g/mol) | 148.161 |
| ChEBI | CHEBI:35697 |
| MDL Number | MFCD00004369 |
| SMILES | C1=CC=C(C=C1)C=CC(=O)O |
| Synonym | cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Molecular Formula | C9H8O2 |
| Molecular Weight (g/mol) | 100.45 |
|---|---|
| ChEBI | CHEBI:29221 |
| UN Number | 2920 |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Density | 1.0600g/mL |
| PubChem CID | 24247 |
| Name Note | 0.1 M Solution in Acetic Acid |
| Fieser | 01,796; 02,309; 03,220; 06,453; 09,279; 11,402 |
| Formula Weight | 100.46 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Perchloric acid |
| Grade | Pure |
| SMILES | O[Cl](=O)(=O)=O |
| Merck Index | 15, 7267 |
| CAS | 64-19-7 |
| Health Hazard 3 | GHS P Statement: Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. IF ON SKIN: Wash with plenty of soap and water. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011325 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Flammable liquid and vapor. |
| Solubility Information | Solubility in water: insoluble. |
| Flash Point | 40°C |
| Packaging | Plastic Bottle |
| Health Hazard 1 | Danger |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| Molecular Formula | ClHO4 |
| Specific Gravity | 1.06 |