Halomethanes
Filtered Search Results
Dichloromethane-d{2}, 99.9% (Isotopic)
CAS: 1665-00-5 MDL Number: MFCD00000882 Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d
| CAS | 1665-00-5 |
|---|---|
| MDL Number | MFCD00000882 |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
Diiodomethane, 99+%, stabilized with silver wire
CAS: 75-11-6 Molecular Formula: CH2I2 Molecular Weight (g/mol): 267.84 MDL Number: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
| PubChem CID | 6346 |
|---|---|
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| MDL Number | MFCD00001079 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
| Molecular Formula | CH2I2 |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.83 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.83 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
| Boiling Point | 41.0°C to 43.0°C |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| Chemical Name or Material | Iodomethane |
| Merck Index | 15, 6159 |
| Density | 0.9330g/mL |
| Name Note | 2M Solution in tert-Butyl Ether |
| CAS | 74-88-4 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. Keep away from heat/spark |
| MDL Number | MFCD00001073 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Toxic if inhaled. Causes skin irritation. May cause respiratory irritation. Suspected of causing cancer. Highly flammable liquid and vapor. |
| Flash Point | −18°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| EINECS Number | 200-819-5 |
| Formula Weight | 141.94 |
| Specific Gravity | 0.933 |
1,2-Dichlorotrifluoroethyl Trifluoromethyl Ether, TRC
CAS: 2356-53-8 Molecular Formula: C3OF6Cl2 Molecular Weight (g/mol): 236.93 Synonym: 1,2-Dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane IUPAC Name: 1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane SMILES: FC(F)(F)OC(F)(Cl)C(F)(F)Cl
| CAS | 2356-53-8 |
|---|---|
| Molecular Weight (g/mol) | 236.93 |
| SMILES | FC(F)(F)OC(F)(Cl)C(F)(F)Cl |
| Synonym | 1,2-Dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane |
| IUPAC Name | 1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane |
| Molecular Formula | C3OF6Cl2 |
Chloroiodomethane, 98%, stabilized
CAS: 593-71-5 Molecular Formula: CH2ClI Molecular Weight (g/mol): 176.38 InChI Key: PJGJQVRXEUVAFT-UHFFFAOYSA-N Synonym: chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ PubChem CID: 11644 IUPAC Name: chloro(iodo)methane SMILES: C(Cl)I
| PubChem CID | 11644 |
|---|---|
| CAS | 593-71-5 |
| Molecular Weight (g/mol) | 176.38 |
| SMILES | C(Cl)I |
| Synonym | chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ |
| IUPAC Name | chloro(iodo)methane |
| InChI Key | PJGJQVRXEUVAFT-UHFFFAOYSA-N |
| Molecular Formula | CH2ClI |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.835 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.835 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Dibromoiodomethane (90%), TRC
CAS: 593-94-2 Molecular Formula: C H Br2 I Molecular Weight (g/mol): 299.73 Synonym: Methane, dibromoiodo- (6CI,7CI,9CI),Dibromoiodomethane IUPAC Name: dibromo(iodo)methane SMILES: BrC(Br)I
| CAS | 593-94-2 |
|---|---|
| Molecular Weight (g/mol) | 299.73 |
| SMILES | BrC(Br)I |
| Synonym | Methane, dibromoiodo- (6CI,7CI,9CI),Dibromoiodomethane |
| IUPAC Name | dibromo(iodo)methane |
| Molecular Formula | C H Br2 I |
Iodomethane, TRC
CAS: 74-88-4 Molecular Formula: C H3 I Molecular Weight (g/mol): 141.94 Synonym: Methane, iodo-,Iodomethane,Ioguard,Methyl iodide,Methyl iodide (CH3I),Monoiodomethane,NSC 9366 IUPAC Name: iodomethane SMILES: CI
| CAS | 74-88-4 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| SMILES | CI |
| Synonym | Methane, iodo-,Iodomethane,Ioguard,Methyl iodide,Methyl iodide (CH3I),Monoiodomethane,NSC 9366 |
| IUPAC Name | iodomethane |
| Molecular Formula | C H3 I |