Resins and Supports
Filtered Search Results
Chromate, Ion chromatography standard solution, Specpure™ CrO4∣-2 1000μg/mL
Molecular Formula: K2CrO4 in H2O MDL Number: MFCD00011368
| MDL Number | MFCD00011368 |
|---|---|
| Molecular Formula | K2CrO4 in H2O |
Acetate, Ion chromatography standard solution, Specpure™ CH{3}CO{2}∣- 1000μg/mL
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium;acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium;acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Amberlyst™ 15(H), ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
Amberlite™ IRN-77, ion exchange resin, nuclear grade
CAS: 11128-94-2 Molecular Formula: Styrene-DVB MDL Number: MFCD00145822
| CAS | 11128-94-2 |
|---|---|
| MDL Number | MFCD00145822 |
| Molecular Formula | Styrene-DVB |
Thermo Scientific Chemicals Agar powder
CAS: 9002-18-0 Molecular Formula: C14H24O9 Molecular Weight (g/mol): 336.337 MDL Number: MFCD00081288 InChI Key: GYYDPBCUIJTIBM-DYOGSRDZSA-N Synonym: agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol PubChem CID: 71571511 IUPAC Name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol SMILES: CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O
| PubChem CID | 71571511 |
|---|---|
| CAS | 9002-18-0 |
| Molecular Weight (g/mol) | 336.337 |
| MDL Number | MFCD00081288 |
| SMILES | CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O |
| Synonym | agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol |
| InChI Key | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| Molecular Formula | C14H24O9 |
Amberlyst™ 15, (wet) ion-exchange resin
CAS: 9037-24-5 Molecular Formula: MFCD00145841 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00145841 InChI Key: YZUPZGFPHUVJKC-UHFFFAOYSA-N Synonym: 2-bromoethyl methyl ether,2-methoxyethyl bromide,ethane, 1-bromo-2-methoxy,ether, 2-bromoethyl methyl,methoxyethyl bromide,2-bromoethylmethylether,bromoethyl methyl ether,2-bromoethylmethyl ether,2-bromoethylmethyl-ether,2-bromo-1-methoxyethane PubChem CID: 80972 IUPAC Name: 1-bromo-2-methoxyethane SMILES: *
| PubChem CID | 80972 |
|---|---|
| CAS | 9037-24-5 |
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00145841 |
| SMILES | * |
| Synonym | 2-bromoethyl methyl ether,2-methoxyethyl bromide,ethane, 1-bromo-2-methoxy,ether, 2-bromoethyl methyl,methoxyethyl bromide,2-bromoethylmethylether,bromoethyl methyl ether,2-bromoethylmethyl ether,2-bromoethylmethyl-ether,2-bromo-1-methoxyethane |
| IUPAC Name | 1-bromo-2-methoxyethane |
| InChI Key | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
| Molecular Formula | MFCD00145841 |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
| CAS | 9017-79-2 |
|---|---|
| MDL Number | MFCD00802695 |
| CAS | 12612-37-2 |
|---|---|
| MDL Number | MFCD00132722 |
Amberlyst 15, MP Biomedicals™
CAS: 9037-24-5 Molecular Formula: MFCD00145841 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00145841 InChI Key: YZUPZGFPHUVJKC-UHFFFAOYSA-N Synonym: 2-bromoethyl methyl ether,2-methoxyethyl bromide,ethane, 1-bromo-2-methoxy,ether, 2-bromoethyl methyl,methoxyethyl bromide,2-bromoethylmethylether,bromoethyl methyl ether,2-bromoethylmethyl ether,2-bromoethylmethyl-ether,2-bromo-1-methoxyethane PubChem CID: 80972 IUPAC Name: 1-bromo-2-methoxyethane SMILES: *
| PubChem CID | 80972 |
|---|---|
| CAS | 9037-24-5 |
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00145841 |
| SMILES | * |
| Synonym | 2-bromoethyl methyl ether,2-methoxyethyl bromide,ethane, 1-bromo-2-methoxy,ether, 2-bromoethyl methyl,methoxyethyl bromide,2-bromoethylmethylether,bromoethyl methyl ether,2-bromoethylmethyl ether,2-bromoethylmethyl-ether,2-bromo-1-methoxyethane |
| IUPAC Name | 1-bromo-2-methoxyethane |
| InChI Key | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
| Molecular Formula | MFCD00145841 |
Amberlite™ CG-50 - type 1, ion-exchange resin
CAS: 9042-11-9 Molecular Formula: (C18H30O15)AHO MDL Number: MFCD00132693 InChI Key: GFZFEWWPMNSVBS-WVZDODFGSA-N PubChem CID: 131636581 IUPAC Name: (2R,4S,5S)-2-[(3S,4R,6R)-6-[(3S,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(methoxymethyl)oxane-3,4,5-triol SMILES: COCC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC)CO)CO)O)O)O
| PubChem CID | 131636581 |
|---|---|
| CAS | 9042-11-9 |
| MDL Number | MFCD00132693 |
| SMILES | COCC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC)CO)CO)O)O)O |
| IUPAC Name | (2R,4S,5S)-2-[(3S,4R,6R)-6-[(3S,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(methoxymethyl)oxane-3,4,5-triol |
| InChI Key | GFZFEWWPMNSVBS-WVZDODFGSA-N |
| Molecular Formula | (C18H30O15)AHO |
Polycarbonate resin, approx. M.W. 45.000, pellets
CAS: 24936-68-3 Molecular Formula: (C16H14O3)n Molecular Weight (g/mol): NaN MDL Number: MFCD00084476 SMILES: CC(C)(C1=CC=C(-*)C=C1)C1=CC=C(OC(=O)O-*)C=C1
| CAS | 24936-68-3 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00084476 |
| SMILES | CC(C)(C1=CC=C(-*)C=C1)C1=CC=C(OC(=O)O-*)C=C1 |
| Molecular Formula | (C16H14O3)n |