Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
L-Ascorbic Acid, Certified AR for Analysis, Fisher Chemical
CAS: 50-81-7 Molecular Formula: C6H8O6 MDL Number: 64328
| CAS | 50-81-7 |
|---|---|
| MDL Number | 64328 |
| Molecular Formula | C6H8O6 |
Thermo Scientific Chemicals Albumine bovine serum, for biochemistry, additional reagent for IGSS, protease free
CAS: 9048-46-8 MDL Number: MFCD00145743
| CAS | 9048-46-8 |
|---|---|
| MDL Number | MFCD00145743 |
Starch, ACS reagent, soluble
CAS: 9005-84-9 Molecular Formula: C12H22O11 Molecular Weight (g/mol): 342.297 MDL Number: MFCD00082026 InChI Key: GUBGYTABKSRVRQ-ASMJPISFSA-N Synonym: alpha-maltose,maltose,starch, soluble,glcalpha1-4glca,unii-15sug9ad26,glcalpha1-4glcalpha,amylodextrin,starch solution,alpha-malt sugar,4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose PubChem CID: 439341 ChEBI: CHEBI:18167 IUPAC Name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol SMILES: C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O
| PubChem CID | 439341 |
|---|---|
| CAS | 9005-84-9 |
| Molecular Weight (g/mol) | 342.297 |
| ChEBI | CHEBI:18167 |
| MDL Number | MFCD00082026 |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
| Synonym | alpha-maltose,maltose,starch, soluble,glcalpha1-4glca,unii-15sug9ad26,glcalpha1-4glcalpha,amylodextrin,starch solution,alpha-malt sugar,4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| InChI Key | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| Molecular Formula | C12H22O11 |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
L(+)-Ascorbic acid, ACS reagent
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Choline Chloride, 99%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Thermo Scientific Chemicals L-alpha-Lecithin, granular, from soybean oil
CAS: 8002-43-5 Molecular Formula: C42H80NO8P Molecular Weight (g/mol): 750 MDL Number: MFCD00082428 InChI Key: JLPULHDHAOZNQI-JLOPVYAASA-N Synonym: 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine PubChem CID: 16213884 ChEBI: CHEBI:86658 IUPAC Name: [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate SMILES: CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC
| PubChem CID | 16213884 |
|---|---|
| CAS | 8002-43-5 |
| Molecular Weight (g/mol) | 750 |
| ChEBI | CHEBI:86658 |
| MDL Number | MFCD00082428 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC |
| Synonym | 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine |
| IUPAC Name | [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChI Key | JLPULHDHAOZNQI-JLOPVYAASA-N |
| Molecular Formula | C42H80NO8P |
Thermo Scientific Chemicals Lecithin, Refined
CAS: 8002-43-5 Molecular Formula: C42H80NO8P Molecular Weight (g/mol): 758.075 MDL Number: MFCD00147406 InChI Key: JLPULHDHAOZNQI-JLOPVYAASA-N Synonym: 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine PubChem CID: 16213884 ChEBI: CHEBI:86658 IUPAC Name: [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate SMILES: CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC
| PubChem CID | 16213884 |
|---|---|
| CAS | 8002-43-5 |
| Molecular Weight (g/mol) | 758.075 |
| ChEBI | CHEBI:86658 |
| MDL Number | MFCD00147406 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC |
| Synonym | 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine |
| IUPAC Name | [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChI Key | JLPULHDHAOZNQI-JLOPVYAASA-N |
| Molecular Formula | C42H80NO8P |
Ethylenediaminetetraacetic acid disodium salt dihydrate, 99+%
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals Albumin bovine, for biochemistry, Fraction V, pH=5, 96.0-100.0% protein
CAS: 9048-46-8 MDL Number: MFCD00145743
| CAS | 9048-46-8 |
|---|---|
| MDL Number | MFCD00145743 |
Thermo Scientific Chemicals N-Acetyl-L-cysteine, 98%
CAS: 616-91-1 Molecular Formula: C5H9NO3S Molecular Weight (g/mol): 163.19 MDL Number: MFCD00004880 InChI Key: PWKSKIMOESPYIA-BYPYZUCNSA-N Synonym: n-acetyl-l-cysteine,acetylcysteine,n-acetylcysteine,mercapturic acid,acetadote,l-acetylcysteine,broncholysin,fluimucil,mucomyst,fluprowit PubChem CID: 12035 ChEBI: CHEBI:28939 IUPAC Name: (2R)-2-acetamido-3-sulfanylpropanoic acid SMILES: CC(=O)NC(CS)C(=O)O
| PubChem CID | 12035 |
|---|---|
| CAS | 616-91-1 |
| Molecular Weight (g/mol) | 163.19 |
| ChEBI | CHEBI:28939 |
| MDL Number | MFCD00004880 |
| SMILES | CC(=O)NC(CS)C(=O)O |
| Synonym | n-acetyl-l-cysteine,acetylcysteine,n-acetylcysteine,mercapturic acid,acetadote,l-acetylcysteine,broncholysin,fluimucil,mucomyst,fluprowit |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid |
| InChI Key | PWKSKIMOESPYIA-BYPYZUCNSA-N |
| Molecular Formula | C5H9NO3S |
Sodium succinate hexahydrate, 99%
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Polysorbate 20
CAS: 9005-64-5 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD00165986 InChI Key: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC Name: 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| PubChem CID | 443314 |
|---|---|
| CAS | 9005-64-5 |
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD00165986 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |