Benzenoids
Filtered Search Results
Benzophenone, 99%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
4-Dimethylaminobenzaldehyde, 99+%
CAS: 100-10-7 Molecular Formula: C9H11NO Molecular Weight (g/mol): 149.19 MDL Number: MFCD00003381 InChI Key: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
| PubChem CID | 7479 |
|---|---|
| CAS | 100-10-7 |
| Molecular Weight (g/mol) | 149.19 |
| MDL Number | MFCD00003381 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| IUPAC Name | 4-(dimethylamino)benzaldehyde |
| InChI Key | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO |
Benzoic acid, 99.6%, ACS reagent
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.12 |
| ChEBI | CHEBI:30746 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
3,5-Dinitrosalicylic acid, 98%
CAS: 609-99-4 Molecular Formula: C7H4N2O7 Molecular Weight (g/mol): 228.12 MDL Number: MFCD00007104 InChI Key: LWFUFLREGJMOIZ-UHFFFAOYSA-N Synonym: 3,5-dinitrosalicylic acid,2-hydroxy-3,5-dinitrobenzoic acid,3,5-dinitro-2-hydroxybenzoic acid,3,5-dinitrosalicylate,benzoic acid, 2-hydroxy-3,5-dinitro,salicylic acid, 3,5-dinitro,dnsa,o-dncp,o-dinitrocarboxylphenol,3,5-dinitro-2-salicylic acid PubChem CID: 11873 ChEBI: CHEBI:53648 SMILES: C1=C(C=C(C(=C1[N+](=O)[O-])O)C(=O)O)[N+](=O)[O-]
| PubChem CID | 11873 |
|---|---|
| CAS | 609-99-4 |
| Molecular Weight (g/mol) | 228.12 |
| ChEBI | CHEBI:53648 |
| MDL Number | MFCD00007104 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)C(=O)O)[N+](=O)[O-] |
| Synonym | 3,5-dinitrosalicylic acid,2-hydroxy-3,5-dinitrobenzoic acid,3,5-dinitro-2-hydroxybenzoic acid,3,5-dinitrosalicylate,benzoic acid, 2-hydroxy-3,5-dinitro,salicylic acid, 3,5-dinitro,dnsa,o-dncp,o-dinitrocarboxylphenol,3,5-dinitro-2-salicylic acid |
| InChI Key | LWFUFLREGJMOIZ-UHFFFAOYSA-N |
| Molecular Formula | C7H4N2O7 |
DL-alpha-Methoxyphenylacetic acid, 99%
CAS: 7021-09-2 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 InChI Key: DIWVBIXQCNRCFE-UHFFFAOYNA-N Synonym: methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid PubChem CID: 107202 IUPAC Name: 2-methoxy-2-phenylacetic acid SMILES: COC(C1=CC=CC=C1)C(=O)O
| PubChem CID | 107202 |
|---|---|
| CAS | 7021-09-2 |
| Molecular Weight (g/mol) | 166.18 |
| SMILES | COC(C1=CC=CC=C1)C(=O)O |
| Synonym | methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid |
| IUPAC Name | 2-methoxy-2-phenylacetic acid |
| InChI Key | DIWVBIXQCNRCFE-UHFFFAOYNA-N |
| Molecular Formula | C9H10O3 |
Terephthalic acid, 98+%
CAS: 100-21-0 Molecular Formula: C8H6O4 Molecular Weight (g/mol): 166.132 MDL Number: MFCD00002558 InChI Key: KKEYFWRCBNTPAC-UHFFFAOYSA-N Synonym: p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene PubChem CID: 7489 ChEBI: CHEBI:15702 IUPAC Name: terephthalic acid SMILES: C1=CC(=CC=C1C(=O)O)C(=O)O
| PubChem CID | 7489 |
|---|---|
| CAS | 100-21-0 |
| Molecular Weight (g/mol) | 166.132 |
| ChEBI | CHEBI:15702 |
| MDL Number | MFCD00002558 |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)O |
| Synonym | p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene |
| IUPAC Name | terephthalic acid |
| InChI Key | KKEYFWRCBNTPAC-UHFFFAOYSA-N |
| Molecular Formula | C8H6O4 |
Aluminon, ACS reagent
CAS: 569-58-4 Molecular Formula: C22H23N3O9 Molecular Weight (g/mol): 473.44 InChI Key: AIPNSHNRCQOTRI-UHFFFAOYSA-N Synonym: aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs PubChem CID: 54729869 ChEBI: CHEBI:87398 IUPAC Name: triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate SMILES: C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+]
| PubChem CID | 54729869 |
|---|---|
| CAS | 569-58-4 |
| Molecular Weight (g/mol) | 473.44 |
| ChEBI | CHEBI:87398 |
| SMILES | C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+] |
| Synonym | aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs |
| IUPAC Name | triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate |
| InChI Key | AIPNSHNRCQOTRI-UHFFFAOYSA-N |
| Molecular Formula | C22H23N3O9 |
p-Tolualdehyde, 99+%
CAS: 104-87-0 Molecular Formula: C8H8O Molecular Weight (g/mol): 120.15 MDL Number: MFCD00006954 InChI Key: FXLOVSHXALFLKQ-UHFFFAOYSA-N Synonym: p-tolualdehyde,4-tolualdehyde,p-formyltoluene,p-tolylaldehyde,p-toluylaldehyde,p-methylbenzaldehyde,para-tolualdehyde,benzaldehyde, 4-methyl,para-methylbenzaldehyde,para-toluyl aldehyde PubChem CID: 7725 ChEBI: CHEBI:28617 IUPAC Name: 4-methylbenzaldehyde SMILES: CC1=CC=C(C=C1)C=O
| PubChem CID | 7725 |
|---|---|
| CAS | 104-87-0 |
| Molecular Weight (g/mol) | 120.15 |
| ChEBI | CHEBI:28617 |
| MDL Number | MFCD00006954 |
| SMILES | CC1=CC=C(C=C1)C=O |
| Synonym | p-tolualdehyde,4-tolualdehyde,p-formyltoluene,p-tolylaldehyde,p-toluylaldehyde,p-methylbenzaldehyde,para-tolualdehyde,benzaldehyde, 4-methyl,para-methylbenzaldehyde,para-toluyl aldehyde |
| IUPAC Name | 4-methylbenzaldehyde |
| InChI Key | FXLOVSHXALFLKQ-UHFFFAOYSA-N |
| Molecular Formula | C8H8O |
4-Dimethylaminobenzaldehyde, ACS reagent
CAS: 100-10-7 Molecular Formula: C9H11NO Molecular Weight (g/mol): 149.19 MDL Number: MFCD00003381 InChI Key: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
| PubChem CID | 7479 |
|---|---|
| CAS | 100-10-7 |
| Molecular Weight (g/mol) | 149.19 |
| MDL Number | MFCD00003381 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| IUPAC Name | 4-(dimethylamino)benzaldehyde |
| InChI Key | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO |
Lanolin, anhydrous, USP
CAS: 8006-54-0 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
| CAS | 8006-54-0 |
|---|---|
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |
Triphenylphosphinecopper(I) hydride hexamer, 96%
CAS: 33636-93-0 Molecular Formula: C108H96Cu6P6 Molecular Weight (g/mol): 1961.07 MDL Number: MFCD00221518 InChI Key: IZZFKTUYPRVQID-UHFFFAOYSA-T Synonym: stryker's reagent,triphenylphosphine copper hydride hexamer,triphenylphosphine-copper i hydride hexamer,unii-8x3r32m7xu,hydrido triphenylphosphine copper i hexamer,stryker's reagent mi,triphenylphosphine cuprous hydride,triphenylphosphine copper i hydride hexamer,copper, hexa-mu3-hydrohexakis triphenylphosphine hexa-, octahedro,cuprous hydride triphenylphosphine hexamer PubChem CID: 11982471 IUPAC Name: copper;triphenylphosphane SMILES: [H+].[H+].[H+].[H+].[H+].[H+].C1=CC=C(C=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)[Cu]123[Cu]45([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]11([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]22([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]34([P+](C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)[Cu]512[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11982471 |
|---|---|
| CAS | 33636-93-0 |
| Molecular Weight (g/mol) | 1961.07 |
| MDL Number | MFCD00221518 |
| SMILES | [H+].[H+].[H+].[H+].[H+].[H+].C1=CC=C(C=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)[Cu]123[Cu]45([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]11([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]22([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]34([P+](C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)[Cu]512[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | stryker's reagent,triphenylphosphine copper hydride hexamer,triphenylphosphine-copper i hydride hexamer,unii-8x3r32m7xu,hydrido triphenylphosphine copper i hexamer,stryker's reagent mi,triphenylphosphine cuprous hydride,triphenylphosphine copper i hydride hexamer,copper, hexa-mu3-hydrohexakis triphenylphosphine hexa-, octahedro,cuprous hydride triphenylphosphine hexamer |
| IUPAC Name | copper;triphenylphosphane |
| InChI Key | IZZFKTUYPRVQID-UHFFFAOYSA-T |
| Molecular Formula | C108H96Cu6P6 |
Iodobenzene, 98%
CAS: 591-50-4 Molecular Formula: C6H5I Molecular Weight (g/mol): 204.01 MDL Number: MFCD00001029 InChI Key: SNHMUERNLJLMHN-UHFFFAOYSA-N Synonym: benzene, iodo,phenyl iodide,benzene iodide,iodophenyl,iodinebenzol,iodo-benzene,phenyliodide,iodo benzene,unii-9hk5l7ybbr,1-iodobenzene PubChem CID: 11575 IUPAC Name: iodobenzene SMILES: IC1=CC=CC=C1
| PubChem CID | 11575 |
|---|---|
| CAS | 591-50-4 |
| Molecular Weight (g/mol) | 204.01 |
| MDL Number | MFCD00001029 |
| SMILES | IC1=CC=CC=C1 |
| Synonym | benzene, iodo,phenyl iodide,benzene iodide,iodophenyl,iodinebenzol,iodo-benzene,phenyliodide,iodo benzene,unii-9hk5l7ybbr,1-iodobenzene |
| IUPAC Name | iodobenzene |
| InChI Key | SNHMUERNLJLMHN-UHFFFAOYSA-N |
| Molecular Formula | C6H5I |
Benzoic acid, 99%, extra pure
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 MDL Number: MFCD00002398 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.12 |
| ChEBI | CHEBI:30746 |
| MDL Number | MFCD00002398 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Bis(2-ethylhexyl) terephthalate, 97%
CAS: 6422-86-2 Molecular Formula: C24H38O4 Molecular Weight (g/mol): 390.55 MDL Number: MFCD00072256 InChI Key: RWPICVVBGZBXNA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester PubChem CID: 22932 IUPAC Name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate SMILES: CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC
| PubChem CID | 22932 |
|---|---|
| CAS | 6422-86-2 |
| Molecular Weight (g/mol) | 390.55 |
| MDL Number | MFCD00072256 |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChI Key | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| Molecular Formula | C24H38O4 |