Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Dimidium Bromide-Disulfine, Extra Pure, Blue Indicator Stock Solution, SLR, Fisher Chemical™
Dimidium Bromide-Disulfine, Extra Pure, Blue Indicator Stock Solution, SLR, Fisher Chemical, Quantity: 100mL, Packaging: Amber glass bottle, Boiling Point: 100 deg.C, Melting Point: 0 deg.C, MDL Number: 146696, Physical Form: Liquid
Potassium acetate, 99%
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.142 MDL Number: MFCD00012458 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.142 |
| ChEBI | CHEBI:32029 |
| MDL Number | MFCD00012458 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
1-Octadecene, 90%, tech.
CAS: 112-88-9 Molecular Formula: C18H36 Molecular Weight (g/mol): 252.48 InChI Key: CCCMONHAUSKTEQ-UHFFFAOYSA-N Synonym: 1-octadecene,octadecene,alpha-octadecene,.alpha.-octadecene,unii-h5zuq6v4ak,octadecene-1,h5zuq6v4ak,alkenes, c14-20 .alpha.,1-octadecene, analytical standard,linear octadecene PubChem CID: 8217 ChEBI: CHEBI:30824 IUPAC Name: octadec-1-ene SMILES: CCCCCCCCCCCCCCCCC=C
| PubChem CID | 8217 |
|---|---|
| CAS | 112-88-9 |
| Molecular Weight (g/mol) | 252.48 |
| ChEBI | CHEBI:30824 |
| SMILES | CCCCCCCCCCCCCCCCC=C |
| Synonym | 1-octadecene,octadecene,alpha-octadecene,.alpha.-octadecene,unii-h5zuq6v4ak,octadecene-1,h5zuq6v4ak,alkenes, c14-20 .alpha.,1-octadecene, analytical standard,linear octadecene |
| IUPAC Name | octadec-1-ene |
| InChI Key | CCCMONHAUSKTEQ-UHFFFAOYSA-N |
| Molecular Formula | C18H36 |
Trisodium citrate dihydrate, 99%
CAS: 4-3-6132 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 MDL Number: MFCD00150031 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 4-3-6132 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| MDL Number | MFCD00150031 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Thermo Scientific Chemicals Thiamine hydrochloride, 98.5-101.5%
CAS: 67-03-8 Molecular Formula: C12H17ClN4OS·HCl Molecular Weight (g/mol): 337.26 MDL Number: MFCD00012780 InChI Key: DPJRMOMPQZCRJU-UHFFFAOYSA-M Synonym: thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride PubChem CID: 6202 ChEBI: CHEBI:49105 IUPAC Name: 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride SMILES: CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-]
| PubChem CID | 6202 |
|---|---|
| CAS | 67-03-8 |
| Molecular Weight (g/mol) | 337.26 |
| ChEBI | CHEBI:49105 |
| MDL Number | MFCD00012780 |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
| Synonym | thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Molecular Formula | C12H17ClN4OS·HCl |
Polyethylene glycol 6,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Sodium pyruvate, 99%
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Triphenylphosphine, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Polysorbate 20
CAS: 9005-64-5 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD00165986 InChI Key: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC Name: 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| PubChem CID | 443314 |
|---|---|
| CAS | 9005-64-5 |
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD00165986 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
Choline chloride, 98+%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Urea, 98+%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals myo-Inositol, 98+%
CAS: 87-89-8 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.156 MDL Number: MFCD00077932 InChI Key: CDAISMWEOUEBRE-UHFFFAOYSA-N Synonym: scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol PubChem CID: 892 ChEBI: CHEBI:24848 IUPAC Name: cyclohexane-1,2,3,4,5,6-hexol SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
| PubChem CID | 892 |
|---|---|
| CAS | 87-89-8 |
| Molecular Weight (g/mol) | 180.156 |
| ChEBI | CHEBI:24848 |
| MDL Number | MFCD00077932 |
| SMILES | C1(C(C(C(C(C1O)O)O)O)O)O |
| Synonym | scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol |
| InChI Key | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| Molecular Formula | C6H12O6 |
N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |