Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
alpha-Naphtholbenzein
CAS: 145-50-6 Molecular Formula: C27H18O2 Molecular Weight (g/mol): 374.439 MDL Number: MFCD00078492 InChI Key: VDDWRTZCUJCDJM-PNHLSOANSA-N PubChem CID: 5941340 IUPAC Name: (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one SMILES: C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O
| PubChem CID | 5941340 |
|---|---|
| CAS | 145-50-6 |
| Molecular Weight (g/mol) | 374.439 |
| MDL Number | MFCD00078492 |
| SMILES | C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O |
| IUPAC Name | (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one |
| InChI Key | VDDWRTZCUJCDJM-PNHLSOANSA-N |
| Molecular Formula | C27H18O2 |
4-Isobutyl-alpha-methylphenylacetic acid, 99%
CAS: 15687-27-1 Molecular Formula: C13H18O2 Molecular Weight (g/mol): 206.29 MDL Number: MFCD00010393 InChI Key: HEFNNWSXXWATRW-UHFFFAOYNA-N Synonym: ibuprofen,2-4-isobutylphenyl propanoic acid,motrin,brufen,nurofen,advil,dolgit,liptan,nuprin,anflagen PubChem CID: 3672 ChEBI: CHEBI:5855 IUPAC Name: 2-[4-(2-methylpropyl)phenyl]propanoic acid SMILES: CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
| PubChem CID | 3672 |
|---|---|
| CAS | 15687-27-1 |
| Molecular Weight (g/mol) | 206.29 |
| ChEBI | CHEBI:5855 |
| MDL Number | MFCD00010393 |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(O)=O |
| Synonym | ibuprofen,2-4-isobutylphenyl propanoic acid,motrin,brufen,nurofen,advil,dolgit,liptan,nuprin,anflagen |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChI Key | HEFNNWSXXWATRW-UHFFFAOYNA-N |
| Molecular Formula | C13H18O2 |
alpha-Naphthoflavone, 97%
CAS: 604-59-1 Molecular Formula: C19H12O2 Molecular Weight (g/mol): 272.303 MDL Number: MFCD00004985 InChI Key: VFMMPHCGEFXGIP-UHFFFAOYSA-N Synonym: alpha-naphthoflavone,7,8-benzoflavone,2-phenyl-4h-benzo h chromen-4-one,alpha-naphthylflavone,2-phenylbenzo h chromen-4-one,benzo h flavone,4h-naphtho 1,2-b pyran-4-one, 2-phenyl,.alpha.-naphthoflavone,2-phenyl-benzo h chromen-4-one,2-phenyl-4h-naphtho 1,2-b pyran-4-one PubChem CID: 11790 ChEBI: CHEBI:76995 IUPAC Name: 2-phenylbenzo[h]chromen-4-one SMILES: C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3
| PubChem CID | 11790 |
|---|---|
| CAS | 604-59-1 |
| Molecular Weight (g/mol) | 272.303 |
| ChEBI | CHEBI:76995 |
| MDL Number | MFCD00004985 |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3 |
| Synonym | alpha-naphthoflavone,7,8-benzoflavone,2-phenyl-4h-benzo h chromen-4-one,alpha-naphthylflavone,2-phenylbenzo h chromen-4-one,benzo h flavone,4h-naphtho 1,2-b pyran-4-one, 2-phenyl,.alpha.-naphthoflavone,2-phenyl-benzo h chromen-4-one,2-phenyl-4h-naphtho 1,2-b pyran-4-one |
| IUPAC Name | 2-phenylbenzo[h]chromen-4-one |
| InChI Key | VFMMPHCGEFXGIP-UHFFFAOYSA-N |
| Molecular Formula | C19H12O2 |
Silicone oil, for oil baths, usable range from -40 to +200°C
CAS: 63148-62-9 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): NaN MDL Number: MFCD00132673 IUPAC Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
| CAS | 63148-62-9 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00132673 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | Polydimethylsiloxane |
| Molecular Formula | (C2H6OSi)n |
Thermo Scientific Chemicals Lecithin, Refined
CAS: 8002-43-5 Molecular Formula: C42H80NO8P Molecular Weight (g/mol): 758.075 MDL Number: MFCD00147406 InChI Key: JLPULHDHAOZNQI-JLOPVYAASA-N Synonym: 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine PubChem CID: 16213884 ChEBI: CHEBI:86658 IUPAC Name: [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate SMILES: CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC
| PubChem CID | 16213884 |
|---|---|
| CAS | 8002-43-5 |
| Molecular Weight (g/mol) | 758.075 |
| ChEBI | CHEBI:86658 |
| MDL Number | MFCD00147406 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCC=CCCCCC |
| Synonym | 3-sn-phosphatidylcholine,1-hexadecanoyl-2-9e,12e-octadecadienoyl-sn-glycero-3-phosphocholine,1,2-diacyl-sn-glycero-3-phosphocholine,3,5,8-trioxa-4-phosphahexacosa-17,20-dien-1-aminium, 4-hydroxy-n,n,n-trimethyl-9-oxo-7-1-oxohexadecyl oxy methyl-, inner salt, 4-oxide, r,l-,a-lecithin,2-linoleoyl-1-palmitoyl-sn-glycero-3-phosphocholine,a-phosphatidylcholine solution,l-alpha-phosphatidylcholine solution,2-linoleoyl-1-palmitoyl-sn-glyc-ero-3-phosphocholine |
| IUPAC Name | [(2R)-3-hexadecanoyloxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChI Key | JLPULHDHAOZNQI-JLOPVYAASA-N |
| Molecular Formula | C42H80NO8P |
alpha,alpha,alpha',alpha'-Tetrabromo-o-xylene, 97%
CAS: 13209-15-9 Molecular Formula: C8H6Br4 Molecular Weight (g/mol): 421.752 MDL Number: MFCD00000131 InChI Key: LNAOKZKISWEZNY-UHFFFAOYSA-N Synonym: 1,2-bis dibromomethyl benzene,alpha,alpha,alpha',alpha'-tetrabromo-o-xylene,benzene, 1,2-bis dibromomethyl,unii-3wg2h68vx4,o-xylylene tetrabromide,alpha,alpha,alpha,alpha-tetrabromo-o-xylene,a,a,a',a'-tetrabromo-o-xylene,o-xylene, alpha,alpha,alpha',alpha'-tetrabromo,alpha,alpha,beta,beta-tetrabromo-o-xylene,acmc-209boi PubChem CID: 83234 IUPAC Name: 1,2-bis(dibromomethyl)benzene SMILES: C1=CC=C(C(=C1)C(Br)Br)C(Br)Br
| PubChem CID | 83234 |
|---|---|
| CAS | 13209-15-9 |
| Molecular Weight (g/mol) | 421.752 |
| MDL Number | MFCD00000131 |
| SMILES | C1=CC=C(C(=C1)C(Br)Br)C(Br)Br |
| Synonym | 1,2-bis dibromomethyl benzene,alpha,alpha,alpha',alpha'-tetrabromo-o-xylene,benzene, 1,2-bis dibromomethyl,unii-3wg2h68vx4,o-xylylene tetrabromide,alpha,alpha,alpha,alpha-tetrabromo-o-xylene,a,a,a',a'-tetrabromo-o-xylene,o-xylene, alpha,alpha,alpha',alpha'-tetrabromo,alpha,alpha,beta,beta-tetrabromo-o-xylene,acmc-209boi |
| IUPAC Name | 1,2-bis(dibromomethyl)benzene |
| InChI Key | LNAOKZKISWEZNY-UHFFFAOYSA-N |
| Molecular Formula | C8H6Br4 |
Polyethylene glycol 400
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 400 IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 400 |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Polyethylene glycol 4,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 4000 IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 4000 |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Ethylenediaminetetraacetic acid disodium salt dihydrate, 99+%
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Polysorbate 20
CAS: 9005-64-5 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD00165986 InChI Key: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC Name: 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| PubChem CID | 443314 |
|---|---|
| CAS | 9005-64-5 |
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD00165986 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
alpha,alpha-Dimethylbenzylamine, 96%
CAS: 585-32-0 Molecular Formula: C9H13N Molecular Weight (g/mol): 135.21 MDL Number: MFCD00134680 InChI Key: KDFDOINBXBEOLZ-UHFFFAOYSA-N Synonym: cumylamine,alpha,alpha-dimethylbenzylamine,1-methyl-1-phenyl-ethylamine,1-methyl-1-phenylethylamine,2-phenyl-2-propanamine,alpha-aminoisopropylbenzene,benzenemethanamine, alpha,alpha-dimethyl,dimethyl-aminophenylmethane,cumyl amine,phenisopropyl amine PubChem CID: 68509 IUPAC Name: 2-phenylpropan-2-amine SMILES: CC(C)(N)C1=CC=CC=C1
| PubChem CID | 68509 |
|---|---|
| CAS | 585-32-0 |
| Molecular Weight (g/mol) | 135.21 |
| MDL Number | MFCD00134680 |
| SMILES | CC(C)(N)C1=CC=CC=C1 |
| Synonym | cumylamine,alpha,alpha-dimethylbenzylamine,1-methyl-1-phenyl-ethylamine,1-methyl-1-phenylethylamine,2-phenyl-2-propanamine,alpha-aminoisopropylbenzene,benzenemethanamine, alpha,alpha-dimethyl,dimethyl-aminophenylmethane,cumyl amine,phenisopropyl amine |
| IUPAC Name | 2-phenylpropan-2-amine |
| InChI Key | KDFDOINBXBEOLZ-UHFFFAOYSA-N |
| Molecular Formula | C9H13N |
alpha,alpha-Dichlorodiphenylmethane, 97%
CAS: 2051-90-3 Molecular Formula: C13H10Cl2 Molecular Weight (g/mol): 237.123 MDL Number: MFCD00000811 InChI Key: OPTDDWCXQQYKGU-UHFFFAOYSA-N Synonym: dichlorodiphenylmethane,diphenyldichloromethane,dpm halocarbon,benzophenone dichloride,alpha,alpha-dichlorodiphenylmethane,benzene, 1,1'-dichloromethylene bis,methane, dichlorodiphenyl,dichlorodiphenyl methane,dichloro phenyl methyl benzene,unii-81fez29ak6 PubChem CID: 16327 IUPAC Name: [dichloro(phenyl)methyl]benzene SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)(Cl)Cl
| PubChem CID | 16327 |
|---|---|
| CAS | 2051-90-3 |
| Molecular Weight (g/mol) | 237.123 |
| MDL Number | MFCD00000811 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(Cl)Cl |
| Synonym | dichlorodiphenylmethane,diphenyldichloromethane,dpm halocarbon,benzophenone dichloride,alpha,alpha-dichlorodiphenylmethane,benzene, 1,1'-dichloromethylene bis,methane, dichlorodiphenyl,dichlorodiphenyl methane,dichloro phenyl methyl benzene,unii-81fez29ak6 |
| IUPAC Name | [dichloro(phenyl)methyl]benzene |
| InChI Key | OPTDDWCXQQYKGU-UHFFFAOYSA-N |
| Molecular Formula | C13H10Cl2 |
N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
alpha,alpha-Dimethylphenylacetic acid
CAS: 826-55-1 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00014332 InChI Key: YYEROYLAYAVZNW-UHFFFAOYSA-N Synonym: 2-methyl-2-phenylpropionic acid,2-phenylisobutyric acid,alpha,alpha-dimethylphenylacetic acid,unii-dr8huh2gyk,dimethylphenylacetic acid,dr8huh2gyk,2-methyl-2-phenyl-propionic acid,hydratropic acid, .alpha.-methyl,benzeneacetic acid,.alpha.-dimethyl,propionic acid, 2-methyl-2-phenyl PubChem CID: 13222 IUPAC Name: 2-methyl-2-phenylpropanoic acid SMILES: CC(C)(C(O)=O)C1=CC=CC=C1
| PubChem CID | 13222 |
|---|---|
| CAS | 826-55-1 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00014332 |
| SMILES | CC(C)(C(O)=O)C1=CC=CC=C1 |
| Synonym | 2-methyl-2-phenylpropionic acid,2-phenylisobutyric acid,alpha,alpha-dimethylphenylacetic acid,unii-dr8huh2gyk,dimethylphenylacetic acid,dr8huh2gyk,2-methyl-2-phenyl-propionic acid,hydratropic acid, .alpha.-methyl,benzeneacetic acid,.alpha.-dimethyl,propionic acid, 2-methyl-2-phenyl |
| IUPAC Name | 2-methyl-2-phenylpropanoic acid |
| InChI Key | YYEROYLAYAVZNW-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |