Organic phosphoric acids and derivatives
Filtered Search Results
Triethyl phosphate, 99+%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
Triethyl phosphate, 99%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
n-Butyl phosphate, mixture of mono-n-butyl and di-n-butyl
CAS: 52933-01-4 Molecular Formula: C4H11O4P Molecular Weight (g/mol): 154.102 MDL Number: MFCD00013947 InChI Key: BNMJSBUIDQYHIN-UHFFFAOYSA-N Synonym: n-butylphosphate,monobutyl phosphate,phosphoric acid, monobutyl ester,butyl diacid phosphate,n-butyl acid phosphate,butyl dibasic acid phosphate,unii-0i9w48e53l,butyl phosphate, buo ho 2po,mono-n-butylphosphoric acid,butoxyphosphonic acid PubChem CID: 15389 IUPAC Name: butyl dihydrogen phosphate SMILES: CCCCOP(=O)(O)O
| PubChem CID | 15389 |
|---|---|
| CAS | 52933-01-4 |
| Molecular Weight (g/mol) | 154.102 |
| MDL Number | MFCD00013947 |
| SMILES | CCCCOP(=O)(O)O |
| Synonym | n-butylphosphate,monobutyl phosphate,phosphoric acid, monobutyl ester,butyl diacid phosphate,n-butyl acid phosphate,butyl dibasic acid phosphate,unii-0i9w48e53l,butyl phosphate, buo ho 2po,mono-n-butylphosphoric acid,butoxyphosphonic acid |
| IUPAC Name | butyl dihydrogen phosphate |
| InChI Key | BNMJSBUIDQYHIN-UHFFFAOYSA-N |
| Molecular Formula | C4H11O4P |
Tri-n-hexyl phosphate, 90+%
CAS: 2528-39-4 Molecular Formula: C18H39O4P Molecular Weight (g/mol): 350.48 MDL Number: MFCD00015351 InChI Key: SFENPMLASUEABX-UHFFFAOYSA-N Synonym: phosphoric acid, trihexyl ester,tri-n-hexyl phosphate,tri n-hexyl phosphate,acmc-20aje0,aronis24109 PubChem CID: 75666 IUPAC Name: trihexyl phosphate SMILES: CCCCCCOP(=O)(OCCCCCC)OCCCCCC
| PubChem CID | 75666 |
|---|---|
| CAS | 2528-39-4 |
| Molecular Weight (g/mol) | 350.48 |
| MDL Number | MFCD00015351 |
| SMILES | CCCCCCOP(=O)(OCCCCCC)OCCCCCC |
| Synonym | phosphoric acid, trihexyl ester,tri-n-hexyl phosphate,tri n-hexyl phosphate,acmc-20aje0,aronis24109 |
| IUPAC Name | trihexyl phosphate |
| InChI Key | SFENPMLASUEABX-UHFFFAOYSA-N |
| Molecular Formula | C18H39O4P |
Bis(2-ethylhexyl) phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |
Phenyl phosphate disodium salt hydrate, 98%
CAS: 3279-54-7 Molecular Formula: C6H5Na2O4P Molecular Weight (g/mol): 218.06 MDL Number: MFCD00002133 InChI Key: TYJOJLOWRIQYQM-UHFFFAOYSA-L Synonym: disodium phenyl phosphate,phenyl phosphate disodium salt,disodium phenylphosphate,phenyldisodium phosphate,phosphoric acid, monophenyl ester, disodium salt,phenyl disodium orthophosphate,phenyl phosphate,phosphoric acid, monophenyl ester, sodium salt 1:2,disodium phenyl phosphate dihydrate,phenyl phosphate disodium salt dihydrate PubChem CID: 76771 IUPAC Name: disodium;phenyl phosphate SMILES: [Na+].[Na+].[O-]P([O-])(=O)OC1=CC=CC=C1
| PubChem CID | 76771 |
|---|---|
| CAS | 3279-54-7 |
| Molecular Weight (g/mol) | 218.06 |
| MDL Number | MFCD00002133 |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)OC1=CC=CC=C1 |
| Synonym | disodium phenyl phosphate,phenyl phosphate disodium salt,disodium phenylphosphate,phenyldisodium phosphate,phosphoric acid, monophenyl ester, disodium salt,phenyl disodium orthophosphate,phenyl phosphate,phosphoric acid, monophenyl ester, sodium salt 1:2,disodium phenyl phosphate dihydrate,phenyl phosphate disodium salt dihydrate |
| IUPAC Name | disodium;phenyl phosphate |
| InChI Key | TYJOJLOWRIQYQM-UHFFFAOYSA-L |
| Molecular Formula | C6H5Na2O4P |
Trioctyl phosphate
CAS: 78-42-2 Molecular Formula: C24H51O4P Molecular Weight (g/mol): 434.64 MDL Number: MFCD00009491 InChI Key: GTVWRXDRKAHEAD-UHFFFAOYNA-N Synonym: tris 2-ethylhexyl phosphate,disflamoll tof,flexol tof,phosphoric acid, tris 2-ethylhexyl ester,kronitex tof,flexol plasticizer tof,2-ethyl-1-hexanol phosphate,tris ethylhexyl phosphate,tri 2-ethylhexyl phosphate PubChem CID: 6537 IUPAC Name: tris(2-ethylhexyl) phosphate SMILES: CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC
| PubChem CID | 6537 |
|---|---|
| CAS | 78-42-2 |
| Molecular Weight (g/mol) | 434.64 |
| MDL Number | MFCD00009491 |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| Synonym | tris 2-ethylhexyl phosphate,disflamoll tof,flexol tof,phosphoric acid, tris 2-ethylhexyl ester,kronitex tof,flexol plasticizer tof,2-ethyl-1-hexanol phosphate,tris ethylhexyl phosphate,tri 2-ethylhexyl phosphate |
| IUPAC Name | tris(2-ethylhexyl) phosphate |
| InChI Key | GTVWRXDRKAHEAD-UHFFFAOYNA-N |
| Molecular Formula | C24H51O4P |
Triethyl phosphate, 98+%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
Thermo Scientific Chemicals Adenosine-5'-monophosphoric acid, 99% (dry wt.), water <6%
CAS: 61-19-8 Molecular Formula: C10H14N5O7P Molecular Weight (g/mol): 347.22 MDL Number: MFCD00005750 InChI Key: UDMBCSSLTHHNCD-YPLCUDRINA-N Synonym: adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside PubChem CID: 6083 ChEBI: CHEBI:16027 IUPAC Name: [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate SMILES: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 6083 |
|---|---|
| CAS | 61-19-8 |
| Molecular Weight (g/mol) | 347.22 |
| ChEBI | CHEBI:16027 |
| MDL Number | MFCD00005750 |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5'-monophosphate,5'-adenylic acid,adenosine monophosphate,adenosine phosphate,adenylic acid,adenylate,phosphaden,5'-amp,adenosine 5'-phosphate,phosphentaside |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI Key | UDMBCSSLTHHNCD-YPLCUDRINA-N |
| Molecular Formula | C10H14N5O7P |
1-Naphthyl phosphate disodium salt hydrate, 99%
CAS: 207569-06-0 Molecular Formula: C10H7Na2O4P Molecular Weight (g/mol): 268.12 MDL Number: MFCD00041007 InChI Key: QYURIFWAOPAPAJ-UHFFFAOYSA-L Synonym: 1-naphthyl phosphate disodium salt hydrate,sodium naphthalen-1-yl phosphate hydrate,disodium 1-naphthyl phosphate hydrate,disodium hydrate naphthalen-1-yl phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h7o4p.2na.h2o,1-naphthyl?phosphate?disodium?salt?hydrate,1-naphthyl phosphate disodium salt monohydrate,dihydrogen naphthyl phosphate, oxamethane, sodium salt, sodium salt PubChem CID: 24212014 IUPAC Name: disodium;naphthalen-1-yl phosphate;hydrate SMILES: [Na+].[Na+].[O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1
| PubChem CID | 24212014 |
|---|---|
| CAS | 207569-06-0 |
| Molecular Weight (g/mol) | 268.12 |
| MDL Number | MFCD00041007 |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthyl phosphate disodium salt hydrate,sodium naphthalen-1-yl phosphate hydrate,disodium 1-naphthyl phosphate hydrate,disodium hydrate naphthalen-1-yl phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h7o4p.2na.h2o,1-naphthyl?phosphate?disodium?salt?hydrate,1-naphthyl phosphate disodium salt monohydrate,dihydrogen naphthyl phosphate, oxamethane, sodium salt, sodium salt |
| IUPAC Name | disodium;naphthalen-1-yl phosphate;hydrate |
| InChI Key | QYURIFWAOPAPAJ-UHFFFAOYSA-L |
| Molecular Formula | C10H7Na2O4P |
1-Ethyl-3-methylimidazolium diethyl phosphate, 98%
CAS: 848641-69-0 Molecular Formula: C10H21N2O4P Molecular Weight (g/mol): 264.26 MDL Number: MFCD09953486 InChI Key: HQWOEDCLDNFWEV-UHFFFAOYSA-M Synonym: 1-ethyl-3-methylimidazolium diethyl phosphate,1-ethyl-3-methylimidazolium diethylphosphate,dsstox_cid_27865,dsstox_rid_82618,dsstox_gsid_47889,emim dep,basionics™ lq 11,1-ethyl-3-methylimidazolium-diethyl phosphate,1-ethyl-3-methylimidazolium diethyl phosphate hplc PubChem CID: 53316406 IUPAC Name: diethyl phosphate;1-ethyl-3-methylimidazol-3-ium SMILES: CCN1C=C[N+](C)=C1.CCOP([O-])(=O)OCC
| PubChem CID | 53316406 |
|---|---|
| CAS | 848641-69-0 |
| Molecular Weight (g/mol) | 264.26 |
| MDL Number | MFCD09953486 |
| SMILES | CCN1C=C[N+](C)=C1.CCOP([O-])(=O)OCC |
| Synonym | 1-ethyl-3-methylimidazolium diethyl phosphate,1-ethyl-3-methylimidazolium diethylphosphate,dsstox_cid_27865,dsstox_rid_82618,dsstox_gsid_47889,emim dep,basionics™ lq 11,1-ethyl-3-methylimidazolium-diethyl phosphate,1-ethyl-3-methylimidazolium diethyl phosphate hplc |
| IUPAC Name | diethyl phosphate;1-ethyl-3-methylimidazol-3-ium |
| InChI Key | HQWOEDCLDNFWEV-UHFFFAOYSA-M |
| Molecular Formula | C10H21N2O4P |
1-Naphthyl phosphate, monosodium salt monohydrate, 98+%
CAS: 81012-89-7 Molecular Formula: C10H7O4P Molecular Weight (g/mol): 222.14 MDL Number: MFCD00150615 InChI Key: YNXICDMQCQPQEW-UHFFFAOYSA-L Synonym: 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc PubChem CID: 45055387 SMILES: [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1
| PubChem CID | 45055387 |
|---|---|
| CAS | 81012-89-7 |
| Molecular Weight (g/mol) | 222.14 |
| MDL Number | MFCD00150615 |
| SMILES | [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc |
| InChI Key | YNXICDMQCQPQEW-UHFFFAOYSA-L |
| Molecular Formula | C10H7O4P |
Mono[2-(perfluorohexyl)ethyl] phosphate, TRC
CAS: 57678-01-0 Molecular Formula: C8 H6 F13 O4 P Molecular Weight (g/mol): 444.08 Synonym: 6:2 monoPAP,3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-(dihydrogen phosphate)-1-octanol IUPAC Name: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl dihydrogen phosphate SMILES: OP(=O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| CAS | 57678-01-0 |
|---|---|
| Molecular Weight (g/mol) | 444.08 |
| SMILES | OP(=O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | 6:2 monoPAP,3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-(dihydrogen phosphate)-1-octanol |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl dihydrogen phosphate |
| Molecular Formula | C8 H6 F13 O4 P |
Di-Beta,Beta'-Chloroethylphosphoric Acid, TRC
CAS: 3040-56-0 Molecular Formula: C4H9Cl2O4P Molecular Weight (g/mol): 222.99 Synonym: Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid IUPAC Name: bis(2-chloroethyl) hydrogen phosphate SMILES: OP(=O)(OCCCl)OCCCl
| CAS | 3040-56-0 |
|---|---|
| Molecular Weight (g/mol) | 222.99 |
| SMILES | OP(=O)(OCCCl)OCCCl |
| Synonym | Ethanol, 2-chloro-, hydrogen phosphate (7CI, 8CI, 9CI),Bis(2-chloroethyl) hydrogen phosphate,Bis(2-chloroethyl) phosphate,Bis(chloroethyl) phosphate,Bis(β-chloroethyl) phosphate,Bis(β-chloroethyl) phosphoric acid,Di-2-Chloroethyl phosphate,Di-β,β'-Chloroethylphosphoric acid |
| IUPAC Name | bis(2-chloroethyl) hydrogen phosphate |
| Molecular Formula | C4H9Cl2O4P |
Di-n-butyl phosphate, 96%, Thermo Scientific Chemicals
CAS: 107-66-4 Molecular Formula: C8H19O4P Molecular Weight (g/mol): 210.21 MDL Number: MFCD00015245 InChI Key: JYFHYPJRHGVZDY-UHFFFAOYSA-N Synonym: dibutyl phosphate,di-n-butyl phosphate,phosphoric acid, dibutyl ester,dibutyl acid phosphate,di-n-butylphosphoric acid,dp 4 coupling agent,di-n-butyl hydrogen phosphate,unii-0072nn74tn,phosphoric acid di-n-butyl ester,phosphoric acid dibutyl ester PubChem CID: 7881 SMILES: CCCCOP(O)(=O)OCCCC
| PubChem CID | 7881 |
|---|---|
| CAS | 107-66-4 |
| Molecular Weight (g/mol) | 210.21 |
| MDL Number | MFCD00015245 |
| SMILES | CCCCOP(O)(=O)OCCCC |
| Synonym | dibutyl phosphate,di-n-butyl phosphate,phosphoric acid, dibutyl ester,dibutyl acid phosphate,di-n-butylphosphoric acid,dp 4 coupling agent,di-n-butyl hydrogen phosphate,unii-0072nn74tn,phosphoric acid di-n-butyl ester,phosphoric acid dibutyl ester |
| InChI Key | JYFHYPJRHGVZDY-UHFFFAOYSA-N |
| Molecular Formula | C8H19O4P |