Filtered Search Results
N-tert-Butyl-alpha-phenylnitrone, 98%
CAS: 3376-24-7 Molecular Formula: C11H15NO Molecular Weight (g/mol): 177.25 MDL Number: MFCD00008799 InChI Key: IYSYLWYGCWTJSG-FMIVXFBMSA-N Synonym: e-n-benzylidene-2-methylpropan-2-amine oxide PubChem CID: 10313352 IUPAC Name: N-tert-butyl-1-phenylmethanimine oxide SMILES: CC(C)(C)[N+](=CC1=CC=CC=C1)[O-]
| PubChem CID | 10313352 |
|---|---|
| CAS | 3376-24-7 |
| Molecular Weight (g/mol) | 177.25 |
| MDL Number | MFCD00008799 |
| SMILES | CC(C)(C)[N+](=CC1=CC=CC=C1)[O-] |
| Synonym | e-n-benzylidene-2-methylpropan-2-amine oxide |
| IUPAC Name | N-tert-butyl-1-phenylmethanimine oxide |
| InChI Key | IYSYLWYGCWTJSG-FMIVXFBMSA-N |
| Molecular Formula | C11H15NO |
Sodium thiomethoxide, 95%, pure
CAS: 5188-07-8 Molecular Formula: CH3NaS Molecular Weight (g/mol): 70.09 MDL Number: MFCD00174316 InChI Key: RMBAVIFYHOYIFM-UHFFFAOYSA-M PubChem CID: 4378561 SMILES: C[S-].[Na+]
| PubChem CID | 4378561 |
|---|---|
| CAS | 5188-07-8 |
| Molecular Weight (g/mol) | 70.09 |
| MDL Number | MFCD00174316 |
| SMILES | C[S-].[Na+] |
| InChI Key | RMBAVIFYHOYIFM-UHFFFAOYSA-M |
| Molecular Formula | CH3NaS |
N-tert-Butyl-alpha-phenylnitrone, 97%
CAS: 3376-24-7 Molecular Formula: C11H15NO Molecular Weight (g/mol): 177.247 MDL Number: MFCD00008799 InChI Key: IYSYLWYGCWTJSG-FMIVXFBMSA-N Synonym: e-n-benzylidene-2-methylpropan-2-amine oxide PubChem CID: 10313352 IUPAC Name: N-tert-butyl-1-phenylmethanimine oxide SMILES: CC(C)(C)[N+](=CC1=CC=CC=C1)[O-]
| PubChem CID | 10313352 |
|---|---|
| CAS | 3376-24-7 |
| Molecular Weight (g/mol) | 177.247 |
| MDL Number | MFCD00008799 |
| SMILES | CC(C)(C)[N+](=CC1=CC=CC=C1)[O-] |
| Synonym | e-n-benzylidene-2-methylpropan-2-amine oxide |
| IUPAC Name | N-tert-butyl-1-phenylmethanimine oxide |
| InChI Key | IYSYLWYGCWTJSG-FMIVXFBMSA-N |
| Molecular Formula | C11H15NO |
2,4,6-Triphenylpyrylium tetrafluoroborate, 97%
CAS: 448-61-3 Molecular Formula: C23H17BF4O Molecular Weight (g/mol): 396.19 MDL Number: MFCD00012001 InChI Key: VQYPWMWEJGDSTF-UHFFFAOYSA-N Synonym: 2,4,6-triphenylpyrylium tetrafluoroborate,2,4,6-triphenyl-1??-pyran-1-ylium tetrafluoroborate,2,4,6-triphenylpyryliumtetrafluoroborate,pyrylium, 2,4,6-triphenyl-, tetrafluoroborate 1-,2,4,6-triphenyl-pyrylium tetrafluoroborate PubChem CID: 9930615 IUPAC Name: 2,4,6-triphenylpyrylium;tetrafluoroborate SMILES: F[B-](F)(F)F.C1=CC=C(C=C1)C1=CC(=[O+]C(=C1)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9930615 |
|---|---|
| CAS | 448-61-3 |
| Molecular Weight (g/mol) | 396.19 |
| MDL Number | MFCD00012001 |
| SMILES | F[B-](F)(F)F.C1=CC=C(C=C1)C1=CC(=[O+]C(=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2,4,6-triphenylpyrylium tetrafluoroborate,2,4,6-triphenyl-1??-pyran-1-ylium tetrafluoroborate,2,4,6-triphenylpyryliumtetrafluoroborate,pyrylium, 2,4,6-triphenyl-, tetrafluoroborate 1-,2,4,6-triphenyl-pyrylium tetrafluoroborate |
| IUPAC Name | 2,4,6-triphenylpyrylium;tetrafluoroborate |
| InChI Key | VQYPWMWEJGDSTF-UHFFFAOYSA-N |
| Molecular Formula | C23H17BF4O |
Tri-n-butyltin methoxide, 97%
CAS: 1067-52-3 Molecular Formula: C13H30OSn Molecular Weight (g/mol): 321.07 MDL Number: MFCD00009419 InChI Key: KJGLZJQPMKQFIK-UHFFFAOYSA-N Synonym: tributyltin methoxide,stannane, tributylmethoxy,unii-9cff2afn2v,tri-n-butyltin methanolate,9cff2afn2v,methoxytributyltin,tin, tributylmethoxy,tributyltin methanolate,stannane,tributylmethoxy,stannane, methoxytributyl PubChem CID: 16683411 IUPAC Name: tributyl(methoxy)stannane SMILES: CCCC[Sn](CCCC)(CCCC)OC
| PubChem CID | 16683411 |
|---|---|
| CAS | 1067-52-3 |
| Molecular Weight (g/mol) | 321.07 |
| MDL Number | MFCD00009419 |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC |
| Synonym | tributyltin methoxide,stannane, tributylmethoxy,unii-9cff2afn2v,tri-n-butyltin methanolate,9cff2afn2v,methoxytributyltin,tin, tributylmethoxy,tributyltin methanolate,stannane,tributylmethoxy,stannane, methoxytributyl |
| IUPAC Name | tributyl(methoxy)stannane |
| InChI Key | KJGLZJQPMKQFIK-UHFFFAOYSA-N |
| Molecular Formula | C13H30OSn |
Scandium(III) bis(trifluoromethylsulfonyl)imide
CAS: 176726-07-1 Molecular Formula: C6F18N3O12S6Sc Molecular Weight (g/mol): 885.362 MDL Number: MFCD03427000 InChI Key: FUXLYEZEIZAKTL-UHFFFAOYSA-N Synonym: scandium iii trifluoromethanesulfonimide PubChem CID: 131875098 IUPAC Name: bis(trifluoromethylsulfonyl)azanide;scandium(3+) SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Sc+3]
| PubChem CID | 131875098 |
|---|---|
| CAS | 176726-07-1 |
| Molecular Weight (g/mol) | 885.362 |
| MDL Number | MFCD03427000 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Sc+3] |
| Synonym | scandium iii trifluoromethanesulfonimide |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;scandium(3+) |
| InChI Key | FUXLYEZEIZAKTL-UHFFFAOYSA-N |
| Molecular Formula | C6F18N3O12S6Sc |
2,6-Dichloro-3-nitrobenzonitrile, 98%, Thermo Scientific Chemicals
CAS: 5866-98-8 Molecular Formula: C7H2Cl2N2O2 Molecular Weight (g/mol): 217.005 MDL Number: MFCD00051513 InChI Key: NSKVWZIEYFSHIM-UHFFFAOYSA-N Synonym: 2,6-dichloro-3-nitrobenzenecarbonitrile,benzonitrile, 2,6-dichloro-3-nitro,acmc-1ala2,dichloronitrobenzenecarbonitrile,2,6-dichloro-3-nitorbenzonitirle,2,6-bis chloranyl-3-nitro-benzenecarbonitrile PubChem CID: 4461932 IUPAC Name: 2,6-dichloro-3-nitrobenzonitrile SMILES: C1=CC(=C(C(=C1[N+](=O)[O-])Cl)C#N)Cl
| PubChem CID | 4461932 |
|---|---|
| CAS | 5866-98-8 |
| Molecular Weight (g/mol) | 217.005 |
| MDL Number | MFCD00051513 |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)C#N)Cl |
| Synonym | 2,6-dichloro-3-nitrobenzenecarbonitrile,benzonitrile, 2,6-dichloro-3-nitro,acmc-1ala2,dichloronitrobenzenecarbonitrile,2,6-dichloro-3-nitorbenzonitirle,2,6-bis chloranyl-3-nitro-benzenecarbonitrile |
| IUPAC Name | 2,6-dichloro-3-nitrobenzonitrile |
| InChI Key | NSKVWZIEYFSHIM-UHFFFAOYSA-N |
| Molecular Formula | C7H2Cl2N2O2 |
Di-tert-butylphenylphosphonium tetrafluoroborate, 99%, Thermo Scientific Chemicals
CAS: 612088-55-8 Molecular Formula: C14H24BF4P Molecular Weight (g/mol): 310.12 MDL Number: MFCD08704553 InChI Key: HRDPEVWZXUWEFR-UHFFFAOYSA-O Synonym: di-tert-butylphenylphosphonium tetrafluoroborate,di-tert-butyl phenyl phosphonium tetrafluoroborate,di-tert-butyl phenyl phosphanium tetrafluoroborate,acmc-20al46,di tert-butyl phenylphosphonium tetrafluoroborate PubChem CID: 11220595 IUPAC Name: ditert-butyl(phenyl)phosphanium;tetrafluoroborate SMILES: F[B-](F)(F)F.CC(C)(C)[PH+](C1=CC=CC=C1)C(C)(C)C
| PubChem CID | 11220595 |
|---|---|
| CAS | 612088-55-8 |
| Molecular Weight (g/mol) | 310.12 |
| MDL Number | MFCD08704553 |
| SMILES | F[B-](F)(F)F.CC(C)(C)[PH+](C1=CC=CC=C1)C(C)(C)C |
| Synonym | di-tert-butylphenylphosphonium tetrafluoroborate,di-tert-butyl phenyl phosphonium tetrafluoroborate,di-tert-butyl phenyl phosphanium tetrafluoroborate,acmc-20al46,di tert-butyl phenylphosphonium tetrafluoroborate |
| IUPAC Name | ditert-butyl(phenyl)phosphanium;tetrafluoroborate |
| InChI Key | HRDPEVWZXUWEFR-UHFFFAOYSA-O |
| Molecular Formula | C14H24BF4P |
Dibenzyl phosphite, 90+%, technical
CAS: 17176-77-1 Molecular Formula: C14H14O3P Molecular Weight (g/mol): 261.24 MDL Number: MFCD00004774 InChI Key: RQKYHDHLEMEVDR-UHFFFAOYSA-N Synonym: dibenzyl phosphonate,phosphonic acid dibenzyl ester,unii-1o720l5h5a,phosphonic acid, bis phenylmethyl ester,dibenzylphosphit,dibenzylphosphonate,phosphonic acid bis phenylmethyl ester,oxo-bis phenylmethoxy phosphanium,mibxhgzaarwagi-uhfffaoysa-n,dibenzyl phosphite, technical grade PubChem CID: 6334615 SMILES: O=[P+](OCC1=CC=CC=C1)OCC1=CC=CC=C1
| PubChem CID | 6334615 |
|---|---|
| CAS | 17176-77-1 |
| Molecular Weight (g/mol) | 261.24 |
| MDL Number | MFCD00004774 |
| SMILES | O=[P+](OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
| Synonym | dibenzyl phosphonate,phosphonic acid dibenzyl ester,unii-1o720l5h5a,phosphonic acid, bis phenylmethyl ester,dibenzylphosphit,dibenzylphosphonate,phosphonic acid bis phenylmethyl ester,oxo-bis phenylmethoxy phosphanium,mibxhgzaarwagi-uhfffaoysa-n,dibenzyl phosphite, technical grade |
| InChI Key | RQKYHDHLEMEVDR-UHFFFAOYSA-N |
| Molecular Formula | C14H14O3P |
Cacodylic acid sodium salt trihydrate 98+%
CAS: 6131-99-3 Molecular Formula: C2H12AsNaO5 Molecular Weight (g/mol): 214.024 MDL Number: MFCD00149079 InChI Key: RLGWPHBPRCROJO-UHFFFAOYSA-M Synonym: sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate PubChem CID: 23679059 IUPAC Name: sodium;dimethylarsinate;trihydrate SMILES: C[As](=O)(C)[O-].O.O.O.[Na+]
| PubChem CID | 23679059 |
|---|---|
| CAS | 6131-99-3 |
| Molecular Weight (g/mol) | 214.024 |
| MDL Number | MFCD00149079 |
| SMILES | C[As](=O)(C)[O-].O.O.O.[Na+] |
| Synonym | sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate |
| IUPAC Name | sodium;dimethylarsinate;trihydrate |
| InChI Key | RLGWPHBPRCROJO-UHFFFAOYSA-M |
| Molecular Formula | C2H12AsNaO5 |
Dimethylanilinium Tetrakis (pentafluorophenyl)borate, 98%
CAS: 118612-00-3 Molecular Formula: C32H12BF20N Molecular Weight (g/mol): 801.23 MDL Number: MFCD01074420 InChI Key: BRHZQNMGSKUUMN-UHFFFAOYSA-O Synonym: dimethylanilinium tetrakis pentafluorophenyl borate,unii-h8r86l92nd,n,n-dimethylanilinium tetrakis pentafluorophenyl borate,n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate,n,n-dimethylanilinium tetra pentafluorophenyl borate,benzene, pentafluoro-, boron complex,n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-,benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-,dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate,borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 PubChem CID: 10996402 IUPAC Name: dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide SMILES: [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1
| PubChem CID | 10996402 |
|---|---|
| CAS | 118612-00-3 |
| Molecular Weight (g/mol) | 801.23 |
| MDL Number | MFCD01074420 |
| SMILES | [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1 |
| Synonym | dimethylanilinium tetrakis pentafluorophenyl borate,unii-h8r86l92nd,n,n-dimethylanilinium tetrakis pentafluorophenyl borate,n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate,n,n-dimethylanilinium tetra pentafluorophenyl borate,benzene, pentafluoro-, boron complex,n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-,benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-,dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate,borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 |
| IUPAC Name | dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChI Key | BRHZQNMGSKUUMN-UHFFFAOYSA-O |
| Molecular Formula | C32H12BF20N |
Dibutyl phosphite, 14.5-16% P
CAS: 1809-19-4 Molecular Formula: C8H19O3P Molecular Weight (g/mol): 194.21 MDL Number: MFCD00066633 InChI Key: OSPSWZSRKYCQPF-UHFFFAOYSA-N Synonym: dibutyl phosphite,dibutyl phosphonate,phosphonic acid, dibutyl ester,di-n-butylphosphite,dibutoxyphosphine oxide,mobil dbhp,dibutyl hydrogen phosphonate,di-n-butyl hydrogen phosphite,dibutylfosfit,phosphorous acid, dibutyl ester PubChem CID: 6327349 IUPAC Name: dibutoxy(oxo)phosphanium SMILES: CCCCO[P+](=O)OCCCC
| PubChem CID | 6327349 |
|---|---|
| CAS | 1809-19-4 |
| Molecular Weight (g/mol) | 194.21 |
| MDL Number | MFCD00066633 |
| SMILES | CCCCO[P+](=O)OCCCC |
| Synonym | dibutyl phosphite,dibutyl phosphonate,phosphonic acid, dibutyl ester,di-n-butylphosphite,dibutoxyphosphine oxide,mobil dbhp,dibutyl hydrogen phosphonate,di-n-butyl hydrogen phosphite,dibutylfosfit,phosphorous acid, dibutyl ester |
| IUPAC Name | dibutoxy(oxo)phosphanium |
| InChI Key | OSPSWZSRKYCQPF-UHFFFAOYSA-N |
| Molecular Formula | C8H19O3P |
Tricarbonylnitrosylcobalt
CAS: 14096-82-3 MDL Number: MFCD00016014 Synonym: cobalt tricarbonyl nitrosyl,tricarbonyl-nitrosyl-cobalt
| CAS | 14096-82-3 |
|---|---|
| MDL Number | MFCD00016014 |
| Synonym | cobalt tricarbonyl nitrosyl,tricarbonyl-nitrosyl-cobalt |
p-Toluenesulfinic acid, sodium salt hydrate, 98+%
CAS: 207801-20-5 Molecular Formula: C7H7NaO2S Molecular Weight (g/mol): 178.18 MDL Number: MFCD00149640 InChI Key: KFZUDNZQQCWGKF-UHFFFAOYSA-M Synonym: sodium p-toluenesulfinate hydrate,benzenesulfinic acid, 4-methyl-, sodium salt, hydrate,c7h7o2s.na.h2o,p-toluenesulfinic acid sodium salt,sodium 4-toluenesulphinate monohydrate,p-toluenesulfinic acid sodium salt hydrate,sodium 4-methylbenzenesulfinate hydrate,p-toluenesulfinic acid sodium salt dry wt. , water PubChem CID: 23682957 IUPAC Name: sodium;4-methylbenzenesulfinate;hydrate SMILES: [Na+].CC1=CC=C(C=C1)S([O-])=O
| PubChem CID | 23682957 |
|---|---|
| CAS | 207801-20-5 |
| Molecular Weight (g/mol) | 178.18 |
| MDL Number | MFCD00149640 |
| SMILES | [Na+].CC1=CC=C(C=C1)S([O-])=O |
| Synonym | sodium p-toluenesulfinate hydrate,benzenesulfinic acid, 4-methyl-, sodium salt, hydrate,c7h7o2s.na.h2o,p-toluenesulfinic acid sodium salt,sodium 4-toluenesulphinate monohydrate,p-toluenesulfinic acid sodium salt hydrate,sodium 4-methylbenzenesulfinate hydrate,p-toluenesulfinic acid sodium salt dry wt. , water |
| IUPAC Name | sodium;4-methylbenzenesulfinate;hydrate |
| InChI Key | KFZUDNZQQCWGKF-UHFFFAOYSA-M |
| Molecular Formula | C7H7NaO2S |
Bis(p-tolyl)phosphine oxide, 98%
CAS: 2409-61-2 Molecular Formula: C14H14OP+ Molecular Weight (g/mol): 229.239 MDL Number: MFCD01445489 InChI Key: ZHIPXAFNKGZMSC-UHFFFAOYSA-N Synonym: bis p-tolyl phosphine oxide,di-p-tolylphosphine oxide,bis 4-methylphenyl phosphine oxide,di p-tolyl phosphine oxide,phosphine oxide, bis 4-methylphenyl,1-methyl-4-4-methylphenylphosphoroso benzene,bis-p-tolylphosphine oxide,oxo bis-p-tolyl phosphonium,bis 4-tolyl phosphine oxide,ksc916e3n PubChem CID: 13357841 IUPAC Name: bis(4-methylphenyl)-oxophosphanium SMILES: CC1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)C
| PubChem CID | 13357841 |
|---|---|
| CAS | 2409-61-2 |
| Molecular Weight (g/mol) | 229.239 |
| MDL Number | MFCD01445489 |
| SMILES | CC1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)C |
| Synonym | bis p-tolyl phosphine oxide,di-p-tolylphosphine oxide,bis 4-methylphenyl phosphine oxide,di p-tolyl phosphine oxide,phosphine oxide, bis 4-methylphenyl,1-methyl-4-4-methylphenylphosphoroso benzene,bis-p-tolylphosphine oxide,oxo bis-p-tolyl phosphonium,bis 4-tolyl phosphine oxide,ksc916e3n |
| IUPAC Name | bis(4-methylphenyl)-oxophosphanium |
| InChI Key | ZHIPXAFNKGZMSC-UHFFFAOYSA-N |
| Molecular Formula | C14H14OP+ |