Filtered Search Results
1,2-Bis(dicyclohexylphosphino)ethane, 98%
CAS: 23743-26-2 Molecular Formula: C26H48P2 Molecular Weight (g/mol): 422.61 MDL Number: MFCD00015521 InChI Key: BOUYBUIVMHNXQB-UHFFFAOYSA-N Synonym: 1,2-bis dicyclohexylphosphino ethane,ethylenebis dicyclohexylphosphine,phosphine, 1,2-ethanediylbis dicyclohexyl,1,2-ethanediylbis dicyclohexyl phosphine,dicyclohexyl 2-dicyclohexylphosphanylethyl phosphane,bis 1,2-dicyclohexylphosphino ethane,pubchem6558,acmc-1capw,ethane-1,2-diylbis dicyclohexylphosphane,phosphine, 1,2-ethanediylbis*dicyclohexyl PubChem CID: 534202 IUPAC Name: dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane SMILES: C1CCC(CC1)P(CCP(C2CCCCC2)C3CCCCC3)C4CCCCC4
| PubChem CID | 534202 |
|---|---|
| CAS | 23743-26-2 |
| Molecular Weight (g/mol) | 422.61 |
| MDL Number | MFCD00015521 |
| SMILES | C1CCC(CC1)P(CCP(C2CCCCC2)C3CCCCC3)C4CCCCC4 |
| Synonym | 1,2-bis dicyclohexylphosphino ethane,ethylenebis dicyclohexylphosphine,phosphine, 1,2-ethanediylbis dicyclohexyl,1,2-ethanediylbis dicyclohexyl phosphine,dicyclohexyl 2-dicyclohexylphosphanylethyl phosphane,bis 1,2-dicyclohexylphosphino ethane,pubchem6558,acmc-1capw,ethane-1,2-diylbis dicyclohexylphosphane,phosphine, 1,2-ethanediylbis*dicyclohexyl |
| IUPAC Name | dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane |
| InChI Key | BOUYBUIVMHNXQB-UHFFFAOYSA-N |
| Molecular Formula | C26H48P2 |
chlorodiisopropylphosphine, 96%
CAS: 40244-90-4 Molecular Formula: C6H14ClP Molecular Weight (g/mol): 152.61 MDL Number: MFCD00015027 InChI Key: JZPDBTOWHLZQFC-UHFFFAOYSA-N Synonym: chlorodiisopropylphosphine,diisopropylchlorophosphine,di-i-propylchlorophosphine,phosphinous chloride, bis 1-methylethyl,ipr2pcl,pubchem6476,chlorodiisopropylphosphane,chloro diisopropylphosphine,acmc-209jc6,diisopropylphosphinyl chloride PubChem CID: 538967 IUPAC Name: chloro-di(propan-2-yl)phosphane SMILES: CC(C)P(C(C)C)Cl
| PubChem CID | 538967 |
|---|---|
| CAS | 40244-90-4 |
| Molecular Weight (g/mol) | 152.61 |
| MDL Number | MFCD00015027 |
| SMILES | CC(C)P(C(C)C)Cl |
| Synonym | chlorodiisopropylphosphine,diisopropylchlorophosphine,di-i-propylchlorophosphine,phosphinous chloride, bis 1-methylethyl,ipr2pcl,pubchem6476,chlorodiisopropylphosphane,chloro diisopropylphosphine,acmc-209jc6,diisopropylphosphinyl chloride |
| IUPAC Name | chloro-di(propan-2-yl)phosphane |
| InChI Key | JZPDBTOWHLZQFC-UHFFFAOYSA-N |
| Molecular Formula | C6H14ClP |
Tetrabutylphosphonium hydroxide, 40 wt.% solution in water
CAS: 14518-69-5 | C16H37OP | 276.45 g/mol
1,2-Bis(dichlorophosphino)ethane, 97%
CAS: 28240-69-9 Molecular Formula: C2H4Cl4P2 Molecular Weight (g/mol): 231.81 MDL Number: MFCD00009609 InChI Key: SBWAJHLQMFBNIN-UHFFFAOYSA-N Synonym: 1,2-bis dichlorophosphino ethane,phosphonous dichloride, 1,2-ethanediylbis,ethylenebis dichlorophosphine,phosphonous dichloride, p,p'-1,2-ethanediylbis,phosphonous dichloride,p,p'-1,2-ethanediylbis,dichloro 2-dichlorophosphanyl ethyl phosphane,ethylenebis phosphonous dichloride,1,2-bis dichlorophosphine ethane,1, 2-bis dichlorophosphino ethane,pubchem6472 PubChem CID: 119904 IUPAC Name: dichloro(2-dichlorophosphanylethyl)phosphane SMILES: C(CP(Cl)Cl)P(Cl)Cl
| PubChem CID | 119904 |
|---|---|
| CAS | 28240-69-9 |
| Molecular Weight (g/mol) | 231.81 |
| MDL Number | MFCD00009609 |
| SMILES | C(CP(Cl)Cl)P(Cl)Cl |
| Synonym | 1,2-bis dichlorophosphino ethane,phosphonous dichloride, 1,2-ethanediylbis,ethylenebis dichlorophosphine,phosphonous dichloride, p,p'-1,2-ethanediylbis,phosphonous dichloride,p,p'-1,2-ethanediylbis,dichloro 2-dichlorophosphanyl ethyl phosphane,ethylenebis phosphonous dichloride,1,2-bis dichlorophosphine ethane,1, 2-bis dichlorophosphino ethane,pubchem6472 |
| IUPAC Name | dichloro(2-dichlorophosphanylethyl)phosphane |
| InChI Key | SBWAJHLQMFBNIN-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl4P2 |
Tricyclohexylphosphine, 97%
CAS: 2622-14-2 Molecular Formula: C18H33P Molecular Weight (g/mol): 280.42 MDL Number: MFCD00003853 InChI Key: WLPUWLXVBWGYMZ-UHFFFAOYSA-N Synonym: tricyclohexylphosphine,tricyclohexyl phosphine,phosphine, tricyclohexyl,tricyclohexyl-phosphane,pcy3,tricyclohexylphosphine solution,tchp,p cy 3,phosphorus tricyclohexyl,tricyclohexylphosphine, dissolved in toluene concentration PubChem CID: 75806 IUPAC Name: tricyclohexylphosphane SMILES: C1CCC(CC1)P(C2CCCCC2)C3CCCCC3
| PubChem CID | 75806 |
|---|---|
| CAS | 2622-14-2 |
| Molecular Weight (g/mol) | 280.42 |
| MDL Number | MFCD00003853 |
| SMILES | C1CCC(CC1)P(C2CCCCC2)C3CCCCC3 |
| Synonym | tricyclohexylphosphine,tricyclohexyl phosphine,phosphine, tricyclohexyl,tricyclohexyl-phosphane,pcy3,tricyclohexylphosphine solution,tchp,p cy 3,phosphorus tricyclohexyl,tricyclohexylphosphine, dissolved in toluene concentration |
| IUPAC Name | tricyclohexylphosphane |
| InChI Key | WLPUWLXVBWGYMZ-UHFFFAOYSA-N |
| Molecular Formula | C18H33P |
Thermo Scientific Chemicals Lawesson's Reagent, 97%
CAS: 19172-47-5 Molecular Formula: C14H14O2P2S4 Molecular Weight (g/mol): 404.452 MDL Number: MFCD00005171 InChI Key: CFHGBZLNZZVTAY-UHFFFAOYSA-N Synonym: lawesson's reagent,lawesson reagent,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide,unii-a4125mq8rx,1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide,2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide,4-methoxyphenylthiophosphoric cyclic di thioanhydride PubChem CID: 87949 IUPAC Name: 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane SMILES: COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC
| PubChem CID | 87949 |
|---|---|
| CAS | 19172-47-5 |
| Molecular Weight (g/mol) | 404.452 |
| MDL Number | MFCD00005171 |
| SMILES | COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC |
| Synonym | lawesson's reagent,lawesson reagent,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide,unii-a4125mq8rx,1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide,2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide,4-methoxyphenylthiophosphoric cyclic di thioanhydride |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane |
| InChI Key | CFHGBZLNZZVTAY-UHFFFAOYSA-N |
| Molecular Formula | C14H14O2P2S4 |
1,4-Bis(diphenylphosphino)butane, 98%
CAS: 7688-25-7 Molecular Formula: C28H28P2 Molecular Weight (g/mol): 426.48 MDL Number: MFCD00003051 InChI Key: BCJVBDBJSMFBRW-UHFFFAOYSA-N Synonym: 1,4-bis diphenylphosphino butane,dppb,phosphine, 1,4-butanediylbis diphenyl,4-diphenylphosphanyl butyl diphenylphosphane,unii-35hp6ltd2d,tetramethylenebis diphenylphosphine,35hp6ltd2d,4-diphenylphosphanylbutyl diphenyl phosphane,1,4-bis-diphenylphosphino butane PubChem CID: 82124 IUPAC Name: 4-diphenylphosphanylbutyl(diphenyl)phosphane SMILES: C(CCP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 82124 |
|---|---|
| CAS | 7688-25-7 |
| Molecular Weight (g/mol) | 426.48 |
| MDL Number | MFCD00003051 |
| SMILES | C(CCP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,4-bis diphenylphosphino butane,dppb,phosphine, 1,4-butanediylbis diphenyl,4-diphenylphosphanyl butyl diphenylphosphane,unii-35hp6ltd2d,tetramethylenebis diphenylphosphine,35hp6ltd2d,4-diphenylphosphanylbutyl diphenyl phosphane,1,4-bis-diphenylphosphino butane |
| IUPAC Name | 4-diphenylphosphanylbutyl(diphenyl)phosphane |
| InChI Key | BCJVBDBJSMFBRW-UHFFFAOYSA-N |
| Molecular Formula | C28H28P2 |
Tetrakis(hydroxymethyl)phosphonium chloride, approx. 75-85% solution in water
CAS: 124-64-1 | C4H12ClO4P | 190.56 g/mol
| Boiling Point | 115.0°C |
|---|---|
| Molecular Weight (g/mol) | 190.56 |
| Color | Green-Yellow or Pink |
| Physical Form | Solution |
| Chemical Name or Material | Tetrakis(hydroxymethyl)phosphonium chloride |
| SMILES | [Cl-].OC[P+](CO)(CO)CO |
| InChI Key | AKXUUJCMWZFYMV-UHFFFAOYSA-M |
| Density | 1.3400g/mL |
| PubChem CID | 31298 |
| Percent Purity | 80.0 to 85.0% |
| CAS | 7732-18-5 |
| Infrared Spectrum | Authentic |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00031687 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Toxic if swallowed. Causes severe skin burns and eye damage. May cause an allergic skin reaction. Suspected of damaging the unborn child. Very toxic to aquatic life with lon |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Glass bottle |
| Flash Point | 96°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrakis hydroxymethyl phosphonium chloride,thpc,pyroset tkc,retardol c,tetramethylolphosphonium chloride,tetrakis hydroxymethyl phosphanium chloride,unii-58wb2xcf8i,proban cc,tetrakis hydroxymethyl phosphochloride,ccris 317 |
| IUPAC Name | tetrakis(hydroxymethyl)phosphanium;chloride |
| Molecular Formula | C4H12ClO4P |
| EINECS Number | 204-707-7 |
| Formula Weight | 190.56 |
| Specific Gravity | 1.34 |
Tetra-n-butylphosphonium bromide, 99%
CAS: 3115-68-2 Molecular Formula: C16H36BrP Molecular Weight (g/mol): 339.342 MDL Number: MFCD00011853 InChI Key: RKHXQBLJXBGEKF-UHFFFAOYSA-M Synonym: tetrabutylphosphonium bromide,tetra-n-butylphosphonium bromide,phosphonium, tetrabutyl-, bromide,px 4b,tetra butyl phosphonium bromide,tetrabutylphosphoniumbromide,tetrabutylphosphanium bromide,tetrabutyl phosphonium bromide,phosphonium, tetrabutyl-, bromide 1:1,acmc-1clh3 PubChem CID: 76564 IUPAC Name: tetrabutylphosphanium;bromide SMILES: CCCC[P+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 76564 |
|---|---|
| CAS | 3115-68-2 |
| Molecular Weight (g/mol) | 339.342 |
| MDL Number | MFCD00011853 |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylphosphonium bromide,tetra-n-butylphosphonium bromide,phosphonium, tetrabutyl-, bromide,px 4b,tetra butyl phosphonium bromide,tetrabutylphosphoniumbromide,tetrabutylphosphanium bromide,tetrabutyl phosphonium bromide,phosphonium, tetrabutyl-, bromide 1:1,acmc-1clh3 |
| IUPAC Name | tetrabutylphosphanium;bromide |
| InChI Key | RKHXQBLJXBGEKF-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrP |
(n-Hexadecyl)tri-n-butylphosphonium bromide, 98+%
CAS: 14937-45-2 Molecular Formula: C28H60BrP Molecular Weight (g/mol): 507.67 MDL Number: MFCD00011775 InChI Key: RYVBINGWVJJDPU-UHFFFAOYSA-M Synonym: tributylhexadecylphosphonium bromide,tributyl hexadecyl phosphonium bromide,cetyltributylphosphonium bromide,tributyl hexadecyl phosphanium bromide,phosphonium, tributylhexadecyl-, bromide,hexadecyltributylphosphonium bromide,phosphonium, tributylhexadecyl-, bromide 1:1,hexadecyltri-n-butylphosphonium bromide,n-hexadecyl tri-n-butylphosphonium bromide,tbhdpb PubChem CID: 84716 SMILES: [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC
| PubChem CID | 84716 |
|---|---|
| CAS | 14937-45-2 |
| Molecular Weight (g/mol) | 507.67 |
| MDL Number | MFCD00011775 |
| SMILES | [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC |
| Synonym | tributylhexadecylphosphonium bromide,tributyl hexadecyl phosphonium bromide,cetyltributylphosphonium bromide,tributyl hexadecyl phosphanium bromide,phosphonium, tributylhexadecyl-, bromide,hexadecyltributylphosphonium bromide,phosphonium, tributylhexadecyl-, bromide 1:1,hexadecyltri-n-butylphosphonium bromide,n-hexadecyl tri-n-butylphosphonium bromide,tbhdpb |
| InChI Key | RYVBINGWVJJDPU-UHFFFAOYSA-M |
| Molecular Formula | C28H60BrP |
Bis(tri-tert-butylphosphine)palladium(0), 98%
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
1,3-Bis(diphenylphosphino)propane, 97%
CAS: 6737-42-4 Molecular Formula: C27H26P2 Molecular Weight (g/mol): 412.45 MDL Number: MFCD00003050 InChI Key: LVEYOSJUKRVCCF-UHFFFAOYSA-N Synonym: 1,3-bis diphenylphosphino propane,dppp,trimethylenebis diphenylphosphine,phosphine, 1,3-propanediylbis diphenyl,3-diphenylphosphanyl propyl diphenylphosphane,3-diphenylphosphanylpropyl diphenyl phosphane,1,3-bis diphenyphosphino propane,1,3-bis diphenylphosphino propane dppp,bis 1,3-diphenylphosphino propane,1,3-bis-diphenylphosphino propane PubChem CID: 81219 SMILES: C(CP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 81219 |
|---|---|
| CAS | 6737-42-4 |
| Molecular Weight (g/mol) | 412.45 |
| MDL Number | MFCD00003050 |
| SMILES | C(CP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,3-bis diphenylphosphino propane,dppp,trimethylenebis diphenylphosphine,phosphine, 1,3-propanediylbis diphenyl,3-diphenylphosphanyl propyl diphenylphosphane,3-diphenylphosphanylpropyl diphenyl phosphane,1,3-bis diphenyphosphino propane,1,3-bis diphenylphosphino propane dppp,bis 1,3-diphenylphosphino propane,1,3-bis-diphenylphosphino propane |
| InChI Key | LVEYOSJUKRVCCF-UHFFFAOYSA-N |
| Molecular Formula | C27H26P2 |
Triisopropyl phosphite, 96%, Thermo Scientific Chemicals
CAS: 116-17-6 Molecular Formula: C9H21O3P Molecular Weight (g/mol): 208.24 InChI Key: SJHCUXCOGGKFAI-UHFFFAOYSA-N Synonym: triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite PubChem CID: 8304 IUPAC Name: tripropan-2-yl phosphite SMILES: CC(C)OP(OC(C)C)OC(C)C
| PubChem CID | 8304 |
|---|---|
| CAS | 116-17-6 |
| Molecular Weight (g/mol) | 208.24 |
| SMILES | CC(C)OP(OC(C)C)OC(C)C |
| Synonym | triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite |
| IUPAC Name | tripropan-2-yl phosphite |
| InChI Key | SJHCUXCOGGKFAI-UHFFFAOYSA-N |
| Molecular Formula | C9H21O3P |
Tris(hydroxymethyl)phosphine, 95%
CAS: 2767-80-8 Molecular Formula: C3H9O3P Molecular Weight (g/mol): 124.08 MDL Number: MFCD00055382 InChI Key: JMXMXKRNIYCNRV-UHFFFAOYSA-N Synonym: tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci PubChem CID: 76001 IUPAC Name: bis(hydroxymethyl)phosphanylmethanol SMILES: C(O)P(CO)CO
| PubChem CID | 76001 |
|---|---|
| CAS | 2767-80-8 |
| Molecular Weight (g/mol) | 124.08 |
| MDL Number | MFCD00055382 |
| SMILES | C(O)P(CO)CO |
| Synonym | tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci |
| IUPAC Name | bis(hydroxymethyl)phosphanylmethanol |
| InChI Key | JMXMXKRNIYCNRV-UHFFFAOYSA-N |
| Molecular Formula | C3H9O3P |