Filtered Search Results
Search results for "fisher bioreagent water"
Water, Molecular Biology Grade, Fisher BioReagents
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 18.015 InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N Synonym: dihydrogen oxide,dihydrogen monoxide PubChem CID: 962 ChEBI: CHEBI:15377 IUPAC Name: oxidane SMILES: O
| PubChem CID | 962 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 18.015 |
| ChEBI | CHEBI:15377 |
| SMILES | O |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| IUPAC Name | oxidane |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
Dimethyl Sulfoxide, Fisher BioReagents™
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 IUPAC Name: methylsulfinylmethane SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| IUPAC Name | methylsulfinylmethane |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
Water, (DNASE, RNASE free), Fisher BioReagents™
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 18.015 InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N Synonym: dihydrogen oxide,dihydrogen monoxide PubChem CID: 962 ChEBI: CHEBI:15377 IUPAC Name: oxidane SMILES: O
| PubChem CID | 962 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 18.015 |
| ChEBI | CHEBI:15377 |
| SMILES | O |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| IUPAC Name | oxidane |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
Water, (For RNA Work) (DEPC-Treated, DNASE, RNASE free/Mol. Biol.), Fisher BioReagents™
DEPC-treated and autoclaved | CAS: 7732-18-5 | H2O | 18.015 g/mol
Polysorbate 20, Fisher BioReagents™
Non-ionic detergent | CAS: 9005-64-5 | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 | 522.68 g/mol
| Water | 3% max. |
|---|---|
| Viscosity | 400 mPa/s at 25°C |
| Boiling Point | 100°C |
| Ignition Residue | 0.25% max. |
| Molecular Weight (g/mol) | 522.68 |
| Hydroxyl Value | 96 to 108 |
| Color | Amber |
| Physical Form | Viscous Liquid |
| Chemical Name or Material | Polysorbate 20 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Identification | Pass Test |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| ChemAlert Storage Symbol | Gray |
| Density | 1.100g/cm³ |
| PubChem CID | 443314 |
| CAS | 9005-64-5 |
| Health Hazard 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:1 Flammability:1 Instability:0 |
| MDL Number | MFCD00165986 |
| Health Hazard 2 | CAUTION! |
| pH | 6 |
| Synonym | Polyoxyethylene-20-sorbitan Monolaurate,Polyoxyethylenesorbitan monolaurate |
| Recommended Storage | RT |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
Sodium Dodecyl Sulfate (SDS), White Powder, Electrophoresis, Fisher BioReagents™
Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Sodium Lauryl Sulfate,SDS PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC Name: sodium dodecyl sulfate SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | Sodium Lauryl Sulfate,SDS |
| IUPAC Name | sodium dodecyl sulfate |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Ethylene Glycol, Fisher BioReagents™
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Glycerol (Molecular Biology), Fisher BioReagents™
CAS: 56-81-5 Molecular Formula: C3H8O3 Molecular Weight (g/mol): 92.09 MDL Number: MFCD00004722 InChI Key: PEDCQBHIVMGVHV-UHFFFAOYSA-N Synonym: glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn PubChem CID: 753 ChEBI: CHEBI:17754 IUPAC Name: propane-1,2,3-triol SMILES: OCC(O)CO
| PubChem CID | 753 |
|---|---|
| CAS | 56-81-5 |
| Molecular Weight (g/mol) | 92.09 |
| ChEBI | CHEBI:17754 |
| MDL Number | MFCD00004722 |
| SMILES | OCC(O)CO |
| Synonym | glycerol,glycerin,glycerine,1,2,3-propanetriol,glycyl alcohol,trihydroxypropane,glyceritol,propanetriol,1,2,3-trihydroxypropane,osmoglyn |
| IUPAC Name | propane-1,2,3-triol |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3 |
Sodium Chloride, Fisher BioReagents™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent | CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
| Molecular Weight (g/mol) | 238.30 |
|---|---|
| ChEBI | CHEBI:42334 |
| Color | White |
| Chemical Name or Material | HEPES |
| Grade | Molecular Biology |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Identification | Pass Test |
| DNase | DNase free |
| Merck Index | 15, 4689 |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| ChemAlert Storage Symbol | Gray |
| Assay Percent Range | ≥99 % |
| PubChem CID | 23831 |
| Absorbance | 0.01 max. (0.1M solution) at 280nm |
| Percent Purity | ≥99% |
| CAS | 7365-45-9 |
| Protease | Protease free |
| Health Hazard 3 | Emergency Overview Causes eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:2 Flammability:1 Instability:1 |
| MDL Number | MFCD00006158 |
| Health Hazard 2 | WARNING! |
| Solubility Information | Soluble in water |
| pH | 5.0 to 6.5 |
| Purity Grade Notes | DNase-, RNase- and Protease-Free |
| Recommended Storage | RT |
| Molecular Formula | C8H18N2O4S |
| Color | Colorless |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Tris-EDTA |
| Grade | Molecular Biology |
| DNase | DNase free |
| Filtered Through | Filtered through a 5-micron filter. |
| ChemAlert Storage Symbol | Gray |
| Name Note | 1X Solution, pH 8.0 |
| CAS | 7732-18-5 |
| Protease | Protease free |
| Health Hazard 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Avoid contact with skin and eyes. Do not breathe dust. Do not breathe vapors or spray mist. Wash off immediately with soap and plenty of water removing all contaminated clothes and shoes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Remove from exposure, lie down. Move to fresh air. If breathing is difficult, give oxygen. If not breathing, give artificial respiration. If not breathing, give artificial respiration. Obtain medical attention. NFPA Health:1 Flammability:0 Instability:0 |
| Health Hazard 2 | CAUTION! |
| pH | 7.4 to 8.1 |
| Synonym | TE |
| Recommended Storage | RT |
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Potassium Phosphate Dibasic (Fine White Crystalline Powder), Fisher BioReagents™
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.17 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.17 |
| ChEBI | CHEBI:32031 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |