Resins and Supports
- (1)
- (4)
- (7)
- (1)
- (31)
- (1)
- (30)
- (5)
- (7)
- (8)
- (4)
- (34)
- (38)
- (3)
- (5)
- (3)
- (2)
- (19)
- (5)
- (3)
- (3)
- (7)
- (8)
- (3)
- (3)
- (2)
- (3)
- (3)
- (3)
- (3)
- (3)
- (3)
- (6)
- (14)
- (6)
- (7)
Filtered Search Results
| CAS | 11128-95-3 |
|---|---|
| MDL Number | MFCD00145822 |
Amberlyst™ 15, (dry) ion-exchange resin
CAS: 9037-24-5 Molecular Formula: MFCD00145841 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00145841 InChI Key: YZUPZGFPHUVJKC-UHFFFAOYSA-N PubChem CID: 80972 SMILES: *
| PubChem CID | 80972 |
|---|---|
| CAS | 9037-24-5 |
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00145841 |
| SMILES | * |
| InChI Key | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
| Molecular Formula | MFCD00145841 |
| CAS | 197809-12-4 |
|---|---|
| MDL Number | MFCD00802695 |
| CAS | 37380-43-1 |
|---|---|
| MDL Number | MFCD00132705 |
Triphenylphosphine resin, 1% crossl. with DVB, 1.0-1.5 mmol/g, 100-200 mesh
CAS: 39319-11-4 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 39319-11-4 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
| CAS | 9049-93-8 |
|---|---|
| MDL Number | MFCD00145842 |
| CAS | 52439-77-7 |
|---|---|
| MDL Number | MFCD00145564 |
AmberChrom™, 50WX8, 100-200 mesh, H-form, Thermo Scientific™
CAS: 69011-20-7 Molecular Formula: C28H30 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00132722 InChI Key: NWUYHJFMYQTDRP-UHFFFAOYSA-N IUPAC Name: 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene SMILES: *
| CAS | 69011-20-7 |
|---|---|
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00132722 |
| SMILES | * |
| IUPAC Name | 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene |
| InChI Key | NWUYHJFMYQTDRP-UHFFFAOYSA-N |
| Molecular Formula | C28H30 |
Amberlite™ XAD-1180, polymeric adsorbent
CAS: 9003-69-4 Molecular Formula: C10H10 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00132704 InChI Key: MYRTYDVEIRVNKP-UHFFFAOYSA-N Synonym: divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb PubChem CID: 66666 SMILES: *
| PubChem CID | 66666 |
|---|---|
| CAS | 9003-69-4 |
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00132704 |
| SMILES | * |
| Synonym | divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb |
| InChI Key | MYRTYDVEIRVNKP-UHFFFAOYSA-N |
| Molecular Formula | C10H10 |
Silica gel, for chromatography, 0.075-0.250 mm, 150 A
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
AmberChrom™, 50WX8, 200-400 mesh, H-form, Thermo Scientific™
CAS: 69011-20-7 Molecular Formula: C28H30 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00132722 InChI Key: NWUYHJFMYQTDRP-UHFFFAOYSA-N IUPAC Name: 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene SMILES: *
| CAS | 69011-20-7 |
|---|---|
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00132722 |
| SMILES | * |
| IUPAC Name | 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene |
| InChI Key | NWUYHJFMYQTDRP-UHFFFAOYSA-N |
| Molecular Formula | C28H30 |
AmberChrom™, 1x8, 100-200 mesh, Cl-form, Thermo Scientific™
CAS: 69011-19-4 Molecular Formula: C31H39N Molecular Weight (g/mol): 0.00 MDL Number: MFCD00146763 InChI Key: HADXLRSCRPYPJJ-UHFFFAOYSA-N IUPAC Name: 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene; trimethylamine SMILES: *
| CAS | 69011-19-4 |
|---|---|
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00146763 |
| SMILES | * |
| IUPAC Name | 1,2-diethenylbenzene; 1-ethenyl-2-ethylbenzene; ethenylbenzene; trimethylamine |
| InChI Key | HADXLRSCRPYPJJ-UHFFFAOYSA-N |
| Molecular Formula | C31H39N |
| CAS | 9002-26-0 |
|---|---|
| MDL Number | MFCD00132710 |
| Particle Size | 90 Micron |
|---|---|
| Loading | 0.2 to 0.3mmol/g |
| MDL Number | MFCD00217899 |
| Color | White to Yellow |
| Physical Form | Powder |
| Chemical Name or Material | TentaGel™ S-NH2 |
| Synonym | O-(2-Aminoethyl)polyethylene glycol polymer bound |
| Particle Size | Uniformity coefficient:max. 2.00, Harmonic mean size:0.450 to 0.650mm, Particle size (<0.300mm): max. 2.0%, (>1.180mm): max. 5.0% |
|---|---|
| Ion Exchange Capacity | Total exchange capacity (H):min. 2.60 eq/L |
| CAS | 7732-18-5 |
| Color | Yellow |
| MDL Number | MFCD08460528 |
| Packaging | Plastic bottle |
| Physical Form | Beads |
| Chemical Name or Material | Amberlite™ FPC3500 |
| Water Retention Capacity | Moisture hold cont.(H):60.0 to 70.0% |