Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Phenyl sulfone, 97%
CAS: 127-63-9 Molecular Formula: C12H10O2S Molecular Weight (g/mol): 218.27 MDL Number: MFCD00007548 InChI Key: KZTYYGOKRVBIMI-UHFFFAOYSA-N Synonym: diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone PubChem CID: 31386 ChEBI: CHEBI:78360 SMILES: O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 31386 |
|---|---|
| CAS | 127-63-9 |
| Molecular Weight (g/mol) | 218.27 |
| ChEBI | CHEBI:78360 |
| MDL Number | MFCD00007548 |
| SMILES | O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone |
| InChI Key | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2S |
2-Phenyl-2-propanol, 99%
CAS: 617-94-7 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.19 MDL Number: MFCD00004456 InChI Key: BDCFWIDZNLCTMF-UHFFFAOYSA-N Synonym: 2-phenyl-2-propanol,dimethylphenylcarbinol,1-hydroxycumene,dimethylphenylmethanol,alpha-cumyl alcohol,phenyldimethylcarbinol,2-propanol, 2-phenyl,2-phenylisopropanol,alpha,alpha-dimethylbenzyl alcohol,2-phenyl-propan-2-ol PubChem CID: 12053 IUPAC Name: 2-phenylpropan-2-ol SMILES: CC(C)(O)C1=CC=CC=C1
| PubChem CID | 12053 |
|---|---|
| CAS | 617-94-7 |
| Molecular Weight (g/mol) | 136.19 |
| MDL Number | MFCD00004456 |
| SMILES | CC(C)(O)C1=CC=CC=C1 |
| Synonym | 2-phenyl-2-propanol,dimethylphenylcarbinol,1-hydroxycumene,dimethylphenylmethanol,alpha-cumyl alcohol,phenyldimethylcarbinol,2-propanol, 2-phenyl,2-phenylisopropanol,alpha,alpha-dimethylbenzyl alcohol,2-phenyl-propan-2-ol |
| IUPAC Name | 2-phenylpropan-2-ol |
| InChI Key | BDCFWIDZNLCTMF-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
Methylene di-p-phenyl diisocyanate, 98%, flakes
CAS: 101-68-8 Molecular Formula: C15H10N2O2 Molecular Weight (g/mol): 250.26 MDL Number: MFCD00036131 InChI Key: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC Name: 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
| PubChem CID | 7570 |
|---|---|
| CAS | 101-68-8 |
| Molecular Weight (g/mol) | 250.26 |
| ChEBI | CHEBI:53218 |
| MDL Number | MFCD00036131 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Molecular Formula | C15H10N2O2 |
4-(tert-Butyl)phenyl isocyanate, 97%, Thermo Scientific™
CAS: 1943-67-5 Molecular Formula: C11H13NO Molecular Weight (g/mol): 175.231 MDL Number: MFCD00040718 InChI Key: WUWBDQJTQTVBSQ-UHFFFAOYSA-N Synonym: 4-tert-butylphenyl isocyanate,4-tert-butylphenylisocyanate,benzene, 1-1,1-dimethylethyl-4-isocyanato,4-tert-butylphenyl-isocyanate,4-tert-butyl phenyl isocyanate,1-tert-butyl-4-isocyanato-benzene,benzene,1-1,1-dimethylethyl-4-isocyanato,4-t-butylphenylisocyanate,acmc-209ey5,4-tertbutylphenyl isocyanate PubChem CID: 2735695 IUPAC Name: 1-tert-butyl-4-isocyanatobenzene SMILES: CC(C)(C)C1=CC=C(C=C1)N=C=O
| PubChem CID | 2735695 |
|---|---|
| CAS | 1943-67-5 |
| Molecular Weight (g/mol) | 175.231 |
| MDL Number | MFCD00040718 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N=C=O |
| Synonym | 4-tert-butylphenyl isocyanate,4-tert-butylphenylisocyanate,benzene, 1-1,1-dimethylethyl-4-isocyanato,4-tert-butylphenyl-isocyanate,4-tert-butyl phenyl isocyanate,1-tert-butyl-4-isocyanato-benzene,benzene,1-1,1-dimethylethyl-4-isocyanato,4-t-butylphenylisocyanate,acmc-209ey5,4-tertbutylphenyl isocyanate |
| IUPAC Name | 1-tert-butyl-4-isocyanatobenzene |
| InChI Key | WUWBDQJTQTVBSQ-UHFFFAOYSA-N |
| Molecular Formula | C11H13NO |
N-Phenyl-1-naphthylamine, 98%
CAS: 90-30-2 Molecular Formula: C16H13N Molecular Weight (g/mol): 219.29 MDL Number: MFCD00003878 InChI Key: XQVWYOYUZDUNRW-UHFFFAOYSA-N Synonym: n-phenyl-1-naphthylamine,1-anilinonaphthalene,pana,antioxidant pan,n-1-naphthyl aniline,neozone a,1-naphthalenamine, n-phenyl,phenylnaphthylamine,nonox a,aceto pan PubChem CID: 7013 ChEBI: CHEBI:34876 IUPAC Name: N-phenylnaphthalen-1-amine SMILES: C1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32
| PubChem CID | 7013 |
|---|---|
| CAS | 90-30-2 |
| Molecular Weight (g/mol) | 219.29 |
| ChEBI | CHEBI:34876 |
| MDL Number | MFCD00003878 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32 |
| Synonym | n-phenyl-1-naphthylamine,1-anilinonaphthalene,pana,antioxidant pan,n-1-naphthyl aniline,neozone a,1-naphthalenamine, n-phenyl,phenylnaphthylamine,nonox a,aceto pan |
| IUPAC Name | N-phenylnaphthalen-1-amine |
| InChI Key | XQVWYOYUZDUNRW-UHFFFAOYSA-N |
| Molecular Formula | C16H13N |
Phenyl chloroformate, 99%
CAS: 1885-14-9 Molecular Formula: C7H5ClO2 Molecular Weight (g/mol): 156.57 MDL Number: MFCD00000637 InChI Key: AHWALFGBDFAJAI-UHFFFAOYSA-N Synonym: phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y PubChem CID: 15891 IUPAC Name: phenyl carbonochloridate SMILES: ClC(=O)OC1=CC=CC=C1
| PubChem CID | 15891 |
|---|---|
| CAS | 1885-14-9 |
| Molecular Weight (g/mol) | 156.57 |
| MDL Number | MFCD00000637 |
| SMILES | ClC(=O)OC1=CC=CC=C1 |
| Synonym | phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y |
| IUPAC Name | phenyl carbonochloridate |
| InChI Key | AHWALFGBDFAJAI-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO2 |
Phenyl isothiocyanate, 98%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
Phenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.21 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.21 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Phenyl bromoacetate, 98%
CAS: 620-72-4 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.046 MDL Number: MFCD00192391 InChI Key: UEWYUCGVQMZMGY-UHFFFAOYSA-N Synonym: phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b PubChem CID: 564919 IUPAC Name: phenyl 2-bromoacetate SMILES: C1=CC=C(C=C1)OC(=O)CBr
| PubChem CID | 564919 |
|---|---|
| CAS | 620-72-4 |
| Molecular Weight (g/mol) | 215.046 |
| MDL Number | MFCD00192391 |
| SMILES | C1=CC=C(C=C1)OC(=O)CBr |
| Synonym | phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b |
| IUPAC Name | phenyl 2-bromoacetate |
| InChI Key | UEWYUCGVQMZMGY-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
Phenyl isothiocyanate, 97%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
Glycidyl phenyl ether, 99%
CAS: 122-60-1 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00005133,MFCD31699959 InChI Key: FQYUMYWMJTYZTK-UHFFFAOYNA-N Synonym: glycidyl phenyl ether,phenyl glycidyl ether,2-phenoxymethyl oxirane,1,2-epoxy-3-phenoxypropane,oxirane, phenoxymethyl,phenylglycidyl ether,2,3-epoxypropyl phenyl ether,phenoxypropene oxide,phenylglycydyl ether,ether, phenylglycidyl PubChem CID: 31217 ChEBI: CHEBI:82367 IUPAC Name: 2-(phenoxymethyl)oxirane SMILES: C(OC1=CC=CC=C1)C1CO1
| PubChem CID | 31217 |
|---|---|
| CAS | 122-60-1 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:82367 |
| MDL Number | MFCD00005133,MFCD31699959 |
| SMILES | C(OC1=CC=CC=C1)C1CO1 |
| Synonym | glycidyl phenyl ether,phenyl glycidyl ether,2-phenoxymethyl oxirane,1,2-epoxy-3-phenoxypropane,oxirane, phenoxymethyl,phenylglycidyl ether,2,3-epoxypropyl phenyl ether,phenoxypropene oxide,phenylglycydyl ether,ether, phenylglycidyl |
| IUPAC Name | 2-(phenoxymethyl)oxirane |
| InChI Key | FQYUMYWMJTYZTK-UHFFFAOYNA-N |
| Molecular Formula | C9H10O2 |
Phenyl formate, 95%
CAS: 1864-94-4 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00014126 InChI Key: GEOWCLRLLWTHDN-UHFFFAOYSA-N Synonym: formic acid phenyl ester,formic acid, phenyl ester,phocho,formic acid, phenylester,acmc-1box2,phenyl formate gc PubChem CID: 74626 IUPAC Name: phenyl formate SMILES: C1=CC=C(C=C1)OC=O
| PubChem CID | 74626 |
|---|---|
| CAS | 1864-94-4 |
| Molecular Weight (g/mol) | 122.123 |
| MDL Number | MFCD00014126 |
| SMILES | C1=CC=C(C=C1)OC=O |
| Synonym | formic acid phenyl ester,formic acid, phenyl ester,phocho,formic acid, phenylester,acmc-1box2,phenyl formate gc |
| IUPAC Name | phenyl formate |
| InChI Key | GEOWCLRLLWTHDN-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Phenyl disulfide, 99%
CAS: 882-33-7 Molecular Formula: C12H10S2 Molecular Weight (g/mol): 218.33 MDL Number: MFCD00003065 InChI Key: GUUVPOWQJOLRAS-UHFFFAOYSA-N Synonym: diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene PubChem CID: 13436 IUPAC Name: (phenyldisulfanyl)benzene SMILES: C1=CC=C(C=C1)SSC2=CC=CC=C2
| PubChem CID | 13436 |
|---|---|
| CAS | 882-33-7 |
| Molecular Weight (g/mol) | 218.33 |
| MDL Number | MFCD00003065 |
| SMILES | C1=CC=C(C=C1)SSC2=CC=CC=C2 |
| Synonym | diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene |
| IUPAC Name | (phenyldisulfanyl)benzene |
| InChI Key | GUUVPOWQJOLRAS-UHFFFAOYSA-N |
| Molecular Formula | C12H10S2 |
Phenyl salicylate, 99%
CAS: 118-55-8 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 InChI Key: ZQBAKBUEJOMQEX-UHFFFAOYSA-N Synonym: phenyl salicylate,salol,phenol salicylate,salphenyl,musol,2-phenoxycarbonylphenol,benzoic acid, 2-hydroxy-, phenyl ester,salicylic acid, phenyl ester,2-hydroxybenzoic acid phenyl ester,phenyl-2-hydroxybenzoate PubChem CID: 8361 ChEBI: CHEBI:34918 IUPAC Name: phenyl 2-hydroxybenzoate SMILES: C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O
| PubChem CID | 8361 |
|---|---|
| CAS | 118-55-8 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:34918 |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O |
| Synonym | phenyl salicylate,salol,phenol salicylate,salphenyl,musol,2-phenoxycarbonylphenol,benzoic acid, 2-hydroxy-, phenyl ester,salicylic acid, phenyl ester,2-hydroxybenzoic acid phenyl ester,phenyl-2-hydroxybenzoate |
| IUPAC Name | phenyl 2-hydroxybenzoate |
| InChI Key | ZQBAKBUEJOMQEX-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
Phenyl chlorothionoformate, 98+%
CAS: 1005-56-7 Molecular Formula: C7H5ClOS Molecular Weight (g/mol): 172.63 MDL Number: MFCD00004920 InChI Key: KOSYAAIZOGNATQ-UHFFFAOYSA-N Synonym: o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate PubChem CID: 70498 SMILES: ClC(=S)OC1=CC=CC=C1
| PubChem CID | 70498 |
|---|---|
| CAS | 1005-56-7 |
| Molecular Weight (g/mol) | 172.63 |
| MDL Number | MFCD00004920 |
| SMILES | ClC(=S)OC1=CC=CC=C1 |
| Synonym | o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate |
| InChI Key | KOSYAAIZOGNATQ-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClOS |