Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Diethylamine hydrochloride, 99%, Thermo Scientific Chemicals
CAS: 660-68-4 MDL Number: MFCD00012499 InChI Key: HDITUCONWLWUJR-UHFFFAOYSA-N Synonym: diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl PubChem CID: 10197650 IUPAC Name: N-ethylethanamine;hydrochloride SMILES: CCNCC.Cl
| PubChem CID | 10197650 |
|---|---|
| CAS | 660-68-4 |
| MDL Number | MFCD00012499 |
| SMILES | CCNCC.Cl |
| Synonym | diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl |
| IUPAC Name | N-ethylethanamine;hydrochloride |
| InChI Key | HDITUCONWLWUJR-UHFFFAOYSA-N |
| Boiling Point | 152°C to 153°C |
|---|---|
| Molecular Weight (g/mol) | 284.48 |
| Color | Colorless or White to Yellow |
| Physical Form | Liquid or Powder |
| Chemical Name or Material | Methyl heptadecanoate |
| CAS | 1731-92-6 |
| Infrared Spectrum | Conforms |
| MDL Number | 00009001 |
| Packaging | Glass bottle |
| Flash Point | >110°C |
| Alpha Vector | METHYLHEPTADECANOATE |
| Synonym | Methyl margarate |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C18 H36 O2 |
| EINECS Number | 217-055-3 |
| Melting Point | 29°C to 30°C |
Nickel(II) trifluoromethanesulfonate, 96%, Thermo Scientific Chemicals
CAS: 60871-84-3 Molecular Formula: C2F6NiO6S2 Molecular Weight (g/mol): 356.82 MDL Number: MFCD00673740 InChI Key: KVRSDIJOUNNFMZ-UHFFFAOYSA-L Synonym: nickel ii trifluoromethanesulfonate,nickel ii triflate,nickel 2+ ditriflate,trifluoromethanesulfonic acid nickel ii salt,nickel triflate,acmc-209mmw,ni otf 2,nickelous trifluoromethanesulfonate,nickel 2+ ion ditriflate PubChem CID: 9820095 IUPAC Name: nickel(2+);trifluoromethanesulfonate SMILES: [Ni++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 9820095 |
|---|---|
| CAS | 60871-84-3 |
| Molecular Weight (g/mol) | 356.82 |
| MDL Number | MFCD00673740 |
| SMILES | [Ni++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | nickel ii trifluoromethanesulfonate,nickel ii triflate,nickel 2+ ditriflate,trifluoromethanesulfonic acid nickel ii salt,nickel triflate,acmc-209mmw,ni otf 2,nickelous trifluoromethanesulfonate,nickel 2+ ion ditriflate |
| IUPAC Name | nickel(2+);trifluoromethanesulfonate |
| InChI Key | KVRSDIJOUNNFMZ-UHFFFAOYSA-L |
| Molecular Formula | C2F6NiO6S2 |
Oleyl alcohol, tech. 80-85%, Thermo Scientific Chemicals
CAS: 143-28-2 Molecular Formula: C18H36O Molecular Weight (g/mol): 268.49 MDL Number: MFCD00002993 InChI Key: ALSTYHKOOCGGFT-KTKRTIGZSA-N Synonym: oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol PubChem CID: 5284499 ChEBI: CHEBI:73504 IUPAC Name: (9Z)-octadec-9-en-1-ol SMILES: CCCCCCCC\C=C/CCCCCCCCO
| PubChem CID | 5284499 |
|---|---|
| CAS | 143-28-2 |
| Molecular Weight (g/mol) | 268.49 |
| ChEBI | CHEBI:73504 |
| MDL Number | MFCD00002993 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Synonym | oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol |
| IUPAC Name | (9Z)-octadec-9-en-1-ol |
| InChI Key | ALSTYHKOOCGGFT-KTKRTIGZSA-N |
| Molecular Formula | C18H36O |
Deoxycholic acid, 99%, Thermo Scientific Chemicals
CAS: 83-44-3 Molecular Formula: C24H40O4 Molecular Weight (g/mol): 392.58 MDL Number: MFCD00003673 InChI Key: KXGVEGMKQFWNSR-LLQZFEROSA-N Synonym: deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol PubChem CID: 222528 ChEBI: CHEBI:28834 IUPAC Name: (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid SMILES: [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| PubChem CID | 222528 |
|---|---|
| CAS | 83-44-3 |
| Molecular Weight (g/mol) | 392.58 |
| ChEBI | CHEBI:28834 |
| MDL Number | MFCD00003673 |
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| Synonym | deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI Key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
| Molecular Formula | C24H40O4 |
Coelenterazine, native, Aequorea sp., Thermo Scientific Chemicals
CAS: 55779-48-1 Molecular Formula: C26H21N3O3 Molecular Weight (g/mol): 423.472 MDL Number: MFCD00467176 InChI Key: YHIPILPTUVMWQT-UHFFFAOYSA-N Synonym: coelenterazine,oplophorus luciferin,unii-3o1cb88rrd,clzn,coelenterate luciferin,coelenterazine, native,3o1cb88rrd,8-benzyl-2-4-hydroxybenzyl-6-4-hydroxyphenyl imidazo 1,2-a pyrazin-3 7h-one,2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazo 1,2-a pyrazin-3-7h-one,3,2-dihydro-2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazolo 1,2-a pyrazin-3-one PubChem CID: 2830 ChEBI: CHEBI:2311 IUPAC Name: 8-benzyl-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-7H-imidazo[1,2-a]pyrazin-3-one SMILES: C1=CC=C(C=C1)CC2=C3N=C(C(=O)N3C=C(N2)C4=CC=C(C=C4)O)CC5=CC=C(C=C5)O
| PubChem CID | 2830 |
|---|---|
| CAS | 55779-48-1 |
| Molecular Weight (g/mol) | 423.472 |
| ChEBI | CHEBI:2311 |
| MDL Number | MFCD00467176 |
| SMILES | C1=CC=C(C=C1)CC2=C3N=C(C(=O)N3C=C(N2)C4=CC=C(C=C4)O)CC5=CC=C(C=C5)O |
| Synonym | coelenterazine,oplophorus luciferin,unii-3o1cb88rrd,clzn,coelenterate luciferin,coelenterazine, native,3o1cb88rrd,8-benzyl-2-4-hydroxybenzyl-6-4-hydroxyphenyl imidazo 1,2-a pyrazin-3 7h-one,2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazo 1,2-a pyrazin-3-7h-one,3,2-dihydro-2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazolo 1,2-a pyrazin-3-one |
| IUPAC Name | 8-benzyl-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-7H-imidazo[1,2-a]pyrazin-3-one |
| InChI Key | YHIPILPTUVMWQT-UHFFFAOYSA-N |
| Molecular Formula | C26H21N3O3 |
5-Formyl-2-furancarboxylic acid, Thermo Scientific Chemicals
CAS: 13529-17-4 Molecular Formula: C6H3O4 Molecular Weight (g/mol): 139.09 InChI Key: SHNRXUWGUKDPMA-UHFFFAOYSA-M IUPAC Name: 5-formylfuran-2-carboxylate SMILES: [O-]C(=O)C1=CC=C(O1)C=O
| CAS | 13529-17-4 |
|---|---|
| Molecular Weight (g/mol) | 139.09 |
| SMILES | [O-]C(=O)C1=CC=C(O1)C=O |
| IUPAC Name | 5-formylfuran-2-carboxylate |
| InChI Key | SHNRXUWGUKDPMA-UHFFFAOYSA-M |
| Molecular Formula | C6H3O4 |
Citric acid, trilithium salt tetrahydrate, 98%, pure, Thermo Scientific Chemicals
CAS: 6080-58-6 MDL Number: MFCD00150030 InChI Key: HXGWMCJZLNWEBC-UHFFFAOYSA-K Synonym: lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate PubChem CID: 2724118 ChEBI: CHEBI:64754 IUPAC Name: trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate SMILES: [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O
| PubChem CID | 2724118 |
|---|---|
| CAS | 6080-58-6 |
| ChEBI | CHEBI:64754 |
| MDL Number | MFCD00150030 |
| SMILES | [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O |
| Synonym | lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate |
| IUPAC Name | trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate |
| InChI Key | HXGWMCJZLNWEBC-UHFFFAOYSA-K |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
4-(tert-Butyl)phenyl isocyanate, 97%, Thermo Scientific™
CAS: 1943-67-5 Molecular Formula: C11H13NO Molecular Weight (g/mol): 175.231 MDL Number: MFCD00040718 InChI Key: WUWBDQJTQTVBSQ-UHFFFAOYSA-N Synonym: 4-tert-butylphenyl isocyanate,4-tert-butylphenylisocyanate,benzene, 1-1,1-dimethylethyl-4-isocyanato,4-tert-butylphenyl-isocyanate,4-tert-butyl phenyl isocyanate,1-tert-butyl-4-isocyanato-benzene,benzene,1-1,1-dimethylethyl-4-isocyanato,4-t-butylphenylisocyanate,acmc-209ey5,4-tertbutylphenyl isocyanate PubChem CID: 2735695 IUPAC Name: 1-tert-butyl-4-isocyanatobenzene SMILES: CC(C)(C)C1=CC=C(C=C1)N=C=O
| PubChem CID | 2735695 |
|---|---|
| CAS | 1943-67-5 |
| Molecular Weight (g/mol) | 175.231 |
| MDL Number | MFCD00040718 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N=C=O |
| Synonym | 4-tert-butylphenyl isocyanate,4-tert-butylphenylisocyanate,benzene, 1-1,1-dimethylethyl-4-isocyanato,4-tert-butylphenyl-isocyanate,4-tert-butyl phenyl isocyanate,1-tert-butyl-4-isocyanato-benzene,benzene,1-1,1-dimethylethyl-4-isocyanato,4-t-butylphenylisocyanate,acmc-209ey5,4-tertbutylphenyl isocyanate |
| IUPAC Name | 1-tert-butyl-4-isocyanatobenzene |
| InChI Key | WUWBDQJTQTVBSQ-UHFFFAOYSA-N |
| Molecular Formula | C11H13NO |
NADPH tetrasodium salt hydrate, 93%, extra pure, Thermo Scientific Chemicals
CAS: 2646-71-1 Molecular Formula: C21H26N7Na4O17P3 Molecular Weight (g/mol): 833.35 MDL Number: MFCD10567216 InChI Key: WYWWVJHQDVCHKF-NRTBITFTNA-J Synonym: nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form PubChem CID: 131673986 IUPAC Name: [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium SMILES: [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131673986 |
|---|---|
| CAS | 2646-71-1 |
| Molecular Weight (g/mol) | 833.35 |
| MDL Number | MFCD10567216 |
| SMILES | [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |
| InChI Key | WYWWVJHQDVCHKF-NRTBITFTNA-J |
| Molecular Formula | C21H26N7Na4O17P3 |
Poly(vinyl alcohol), 88% hydrolyzed, average M.W. 85,000 to 120,000, Thermo Scientific Chemicals
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |