Sulfoxides
Filtered Search Results
2-(Methylsulfinyl)benzeneboronic acid, 97%
CAS: 850567-97-4 Molecular Formula: C7H9BO3S Molecular Weight (g/mol): 184.02 MDL Number: MFCD03095261 InChI Key: PHORKVSBWZGTEX-UHFFFAOYNA-N Synonym: 2-methylsulfinyl phenylboronic acid,2-methylsulfinyl phenyl boronic acid,2-methylsulfinylphenyl boronic acid,2-methylsulphinyl benzeneboronic acid,2-methanesulfinylphenylboronic acid,1-borono-2-methylsulphinyl benzene,2-methylsulfinyl benzeneboronic acid,pubchem1874,acmc-209q0z PubChem CID: 2773529 IUPAC Name: (2-methylsulfinylphenyl)boronic acid SMILES: CS(=O)C1=CC=CC=C1B(O)O
| PubChem CID | 2773529 |
|---|---|
| CAS | 850567-97-4 |
| Molecular Weight (g/mol) | 184.02 |
| MDL Number | MFCD03095261 |
| SMILES | CS(=O)C1=CC=CC=C1B(O)O |
| Synonym | 2-methylsulfinyl phenylboronic acid,2-methylsulfinyl phenyl boronic acid,2-methylsulfinylphenyl boronic acid,2-methylsulphinyl benzeneboronic acid,2-methanesulfinylphenylboronic acid,1-borono-2-methylsulphinyl benzene,2-methylsulfinyl benzeneboronic acid,pubchem1874,acmc-209q0z |
| IUPAC Name | (2-methylsulfinylphenyl)boronic acid |
| InChI Key | PHORKVSBWZGTEX-UHFFFAOYNA-N |
| Molecular Formula | C7H9BO3S |
2,2'-Sulfinyldiethanol, TRC
CAS: 3085-45-8 Molecular Formula: C4 H10 O3 S Molecular Weight (g/mol): 138.19 Synonym: 2,2'-Sulfinyldiethanol,Beta,beta'-Dihydroxydiethyl sulphoxide,ethanol, 2,2'sulfinylbis- IUPAC Name: 2-(2-hydroxyethylsulfinyl)ethanol SMILES: OCCS(=O)CCO
| CAS | 3085-45-8 |
|---|---|
| Molecular Weight (g/mol) | 138.19 |
| SMILES | OCCS(=O)CCO |
| Synonym | 2,2'-Sulfinyldiethanol,Beta,beta'-Dihydroxydiethyl sulphoxide,ethanol, 2,2'sulfinylbis- |
| IUPAC Name | 2-(2-hydroxyethylsulfinyl)ethanol |
| Molecular Formula | C4 H10 O3 S |
Tetrahydrothiophene 1-oxide, 97%
CAS: 1600-44-8 Molecular Formula: C4H8OS Molecular Weight (g/mol): 104.167 MDL Number: MFCD00005477 InChI Key: ISXOBTBCNRIIQO-UHFFFAOYSA-N Synonym: tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide PubChem CID: 1128 IUPAC Name: thiolane 1-oxide SMILES: C1CCS(=O)C1
| PubChem CID | 1128 |
|---|---|
| CAS | 1600-44-8 |
| Molecular Weight (g/mol) | 104.167 |
| MDL Number | MFCD00005477 |
| SMILES | C1CCS(=O)C1 |
| Synonym | tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide |
| IUPAC Name | thiolane 1-oxide |
| InChI Key | ISXOBTBCNRIIQO-UHFFFAOYSA-N |
| Molecular Formula | C4H8OS |
Tetramethylene sulfoxide, 97%
CAS: 1600-44-8 Molecular Formula: C4H8OS Molecular Weight (g/mol): 104.17 MDL Number: MFCD00005477 InChI Key: ISXOBTBCNRIIQO-UHFFFAOYSA-N Synonym: tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide PubChem CID: 1128 IUPAC Name: thiolane 1-oxide SMILES: C1CCS(=O)C1
| PubChem CID | 1128 |
|---|---|
| CAS | 1600-44-8 |
| Molecular Weight (g/mol) | 104.17 |
| MDL Number | MFCD00005477 |
| SMILES | C1CCS(=O)C1 |
| Synonym | tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide |
| IUPAC Name | thiolane 1-oxide |
| InChI Key | ISXOBTBCNRIIQO-UHFFFAOYSA-N |
| Molecular Formula | C4H8OS |
Phenyl sulfoxide, 97%
CAS: 945-51-7 Molecular Formula: C12H10OS Molecular Weight (g/mol): 202.27 MDL Number: MFCD00002085 InChI Key: JJHHIJFTHRNPIK-UHFFFAOYSA-N Synonym: diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene PubChem CID: 13679 IUPAC Name: benzenesulfinylbenzene SMILES: C1=CC=C(C=C1)S(=O)C2=CC=CC=C2
| PubChem CID | 13679 |
|---|---|
| CAS | 945-51-7 |
| Molecular Weight (g/mol) | 202.27 |
| MDL Number | MFCD00002085 |
| SMILES | C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 |
| Synonym | diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene |
| IUPAC Name | benzenesulfinylbenzene |
| InChI Key | JJHHIJFTHRNPIK-UHFFFAOYSA-N |
| Molecular Formula | C12H10OS |
Methyl phenyl sulfoxide, 98+%
CAS: 1193-82-4 Molecular Formula: C7H8OS Molecular Weight (g/mol): 140.21 MDL Number: MFCD00002088 InChI Key: JXTGICXCHWMCPM-UHFFFAOYSA-N Synonym: methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene PubChem CID: 14516 IUPAC Name: methylsulfinylbenzene SMILES: CS(=O)C1=CC=CC=C1
| PubChem CID | 14516 |
|---|---|
| CAS | 1193-82-4 |
| Molecular Weight (g/mol) | 140.21 |
| MDL Number | MFCD00002088 |
| SMILES | CS(=O)C1=CC=CC=C1 |
| Synonym | methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene |
| IUPAC Name | methylsulfinylbenzene |
| InChI Key | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| Molecular Formula | C7H8OS |
Demeton-S Sulfoxide, TRC
CAS: 2496-92-6 Molecular Formula: C8 H19 O4 P S2 Molecular Weight (g/mol): 274.34 Synonym: Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide IUPAC Name: 1-diethoxyphosphorylsulfanyl-2-ethylsulfinylethane SMILES: CCOP(=O)(OCC)SCCS(=O)CC
| CAS | 2496-92-6 |
|---|---|
| Molecular Weight (g/mol) | 274.34 |
| SMILES | CCOP(=O)(OCC)SCCS(=O)CC |
| Synonym | Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide |
| IUPAC Name | 1-diethoxyphosphorylsulfanyl-2-ethylsulfinylethane |
| Molecular Formula | C8 H19 O4 P S2 |
Perphenazine Sulfoxide, TRC
CAS: 10078-25-8 Molecular Formula: C21 H26 Cl N3 O2 S Molecular Weight (g/mol): 419.97 Synonym: 2-[4-[3-(2-Chloro-5-oxido-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol,Perphenazine Imp. A (EP),Perphenazine Sulphoxide IUPAC Name: 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol SMILES: OCCN1CCN(CCCN2c3ccccc3S(=O)c4ccc(Cl)cc24)CC1
| CAS | 10078-25-8 |
|---|---|
| Molecular Weight (g/mol) | 419.97 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3S(=O)c4ccc(Cl)cc24)CC1 |
| Synonym | 2-[4-[3-(2-Chloro-5-oxido-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol,Perphenazine Imp. A (EP),Perphenazine Sulphoxide |
| IUPAC Name | 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
| Molecular Formula | C21 H26 Cl N3 O2 S |
Iberin, TRC
CAS: 505-44-2 Molecular Formula: C5 H9 N O S2 Molecular Weight (g/mol): 163.26 Synonym: 1-Isothiocyanato-3-(methylsulfinyl)-propane,3-Methylsulfinylpropyl Isothiocyanate,NSC 321801; IUPAC Name: 1-isothiocyanato-3-methylsulfinylpropane SMILES: CS(=O)CCCN=C=S
| CAS | 505-44-2 |
|---|---|
| Molecular Weight (g/mol) | 163.26 |
| SMILES | CS(=O)CCCN=C=S |
| Synonym | 1-Isothiocyanato-3-(methylsulfinyl)-propane,3-Methylsulfinylpropyl Isothiocyanate,NSC 321801; |
| IUPAC Name | 1-isothiocyanato-3-methylsulfinylpropane |
| Molecular Formula | C5 H9 N O S2 |
Methyl phenyl sulfoxide, 98+%
CAS: 1193-82-4 Molecular Formula: C7H8OS Molecular Weight (g/mol): 140.2 MDL Number: MFCD00002088 InChI Key: JXTGICXCHWMCPM-UHFFFAOYSA-N Synonym: methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene PubChem CID: 14516 IUPAC Name: methylsulfinylbenzene SMILES: CS(=O)C1=CC=CC=C1
| PubChem CID | 14516 |
|---|---|
| CAS | 1193-82-4 |
| Molecular Weight (g/mol) | 140.2 |
| MDL Number | MFCD00002088 |
| SMILES | CS(=O)C1=CC=CC=C1 |
| Synonym | methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene |
| IUPAC Name | methylsulfinylbenzene |
| InChI Key | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| Molecular Formula | C7H8OS |
(R)-4-(Methylsulfinyl)-1-butylamine, TRC
CAS: 84104-30-3 Molecular Formula: C5H13NOS Molecular Weight (g/mol): 135.23 Synonym: (R)-4-(Methylsulfinyl)butylamine SMILES: CS(=O)CCCCN
| CAS | 84104-30-3 |
|---|---|
| Molecular Weight (g/mol) | 135.23 |
| SMILES | CS(=O)CCCCN |
| Synonym | (R)-4-(Methylsulfinyl)butylamine |
| Molecular Formula | C5H13NOS |
S-Methyl-N,N-diethylthiocarbamate Sulfoxide, TRC
CAS: 140703-15-7 Molecular Formula: C6 H13 N O2 S Molecular Weight (g/mol): 163.24 Synonym: Disulfiram Impurity 4 IUPAC Name: N,N-diethyl-1-methylsulfinylformamide SMILES: CCN(CC)C(=O)S(=O)C
| CAS | 140703-15-7 |
|---|---|
| Molecular Weight (g/mol) | 163.24 |
| SMILES | CCN(CC)C(=O)S(=O)C |
| Synonym | Disulfiram Impurity 4 |
| IUPAC Name | N,N-diethyl-1-methylsulfinylformamide |
| Molecular Formula | C6 H13 N O2 S |
6-Methylsulfinylhexyl Isothiocyanate, TRC
CAS: 4430-35-7 Molecular Formula: C8 H15 N O S2 Molecular Weight (g/mol): 205.34 Synonym: Isothiocyanic Acid 6-(Methylsulfinyl)hexyl Ester,1-Isothiocyanato-6-(methylsulfinyl)hexane,Hesperin IUPAC Name: 1-isothiocyanato-6-methylsulfinyl-hexane SMILES: CS(=O)CCCCCCN=C=S
| CAS | 4430-35-7 |
|---|---|
| Molecular Weight (g/mol) | 205.34 |
| SMILES | CS(=O)CCCCCCN=C=S |
| Synonym | Isothiocyanic Acid 6-(Methylsulfinyl)hexyl Ester,1-Isothiocyanato-6-(methylsulfinyl)hexane,Hesperin |
| IUPAC Name | 1-isothiocyanato-6-methylsulfinyl-hexane |
| Molecular Formula | C8 H15 N O S2 |
Phorate Oxon Sulfoxide, TRC
CAS: 2588-05-8 Molecular Formula: C7 H17 O4 P S2 Molecular Weight (g/mol): 260.31 Synonym: Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate IUPAC Name: 1-[ethoxy(ethylsulfinylmethylsulfanyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)SCS(=O)CC
| CAS | 2588-05-8 |
|---|---|
| Molecular Weight (g/mol) | 260.31 |
| SMILES | CCOP(=O)(OCC)SCS(=O)CC |
| Synonym | Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate |
| IUPAC Name | 1-[ethoxy(ethylsulfinylmethylsulfanyl)phosphoryl]oxyethane |
| Molecular Formula | C7 H17 O4 P S2 |