Filtered Search Results
Phloroglucinol, 99+%, anhydrous
CAS: 108-73-6 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.1 InChI Key: QCDYQQDYXPDABM-UHFFFAOYSA-N Synonym: phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy PubChem CID: 359 ChEBI: CHEBI:16204 IUPAC Name: benzene-1,3,5-triol SMILES: C1=C(C=C(C=C1O)O)O
| PubChem CID | 359 |
|---|---|
| CAS | 108-73-6 |
| Molecular Weight (g/mol) | 126.1 |
| ChEBI | CHEBI:16204 |
| SMILES | C1=C(C=C(C=C1O)O)O |
| Synonym | phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy |
| IUPAC Name | benzene-1,3,5-triol |
| InChI Key | QCDYQQDYXPDABM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
CAS: 333338-18-4 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 333338-18-4 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |
Tetraacetylethylenediamine, 90%
CAS: 10543-57-4 Molecular Formula: C10H16N2O4 Molecular Weight (g/mol): 228.25 MDL Number: MFCD00014967 InChI Key: BGRWYDHXPHLNKA-UHFFFAOYSA-N Synonym: tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide PubChem CID: 66347 IUPAC Name: N-acetyl-N-[2-(diacetylamino)ethyl]acetamide SMILES: CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C
| PubChem CID | 66347 |
|---|---|
| CAS | 10543-57-4 |
| Molecular Weight (g/mol) | 228.25 |
| MDL Number | MFCD00014967 |
| SMILES | CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C |
| Synonym | tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide |
| IUPAC Name | N-acetyl-N-[2-(diacetylamino)ethyl]acetamide |
| InChI Key | BGRWYDHXPHLNKA-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O4 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.13 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Methanesulfonic acid, 99%, extra pure
CAS: 75-75-2 Molecular Formula: CH4O3S Molecular Weight (g/mol): 96.1 MDL Number: MFCD00007518 InChI Key: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC Name: methanesulfonic acid SMILES: CS(=O)(=O)O
| PubChem CID | 6395 |
|---|---|
| CAS | 75-75-2 |
| Molecular Weight (g/mol) | 96.1 |
| ChEBI | CHEBI:27376 |
| MDL Number | MFCD00007518 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| IUPAC Name | methanesulfonic acid |
| InChI Key | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| Molecular Formula | CH4O3S |
Citric acid, trisodium salt dihydrate, 99%, pure
CAS: 1545801 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.1 MDL Number: MFCD00150031 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 1545801 |
| Molecular Weight (g/mol) | 294.1 |
| ChEBI | CHEBI:32142 |
| MDL Number | MFCD00150031 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Phenylpropiolic acid, 98+%
CAS: 637-44-5 Molecular Formula: C9H6O2 Molecular Weight (g/mol): 146.15 MDL Number: MFCD00004361 InChI Key: XNERWVPQCYSMLC-UHFFFAOYSA-N Synonym: phenylpropiolic acid,3-phenylpropiolic acid,phenylpropynoic acid,3-phenylpropynoic acid,2-propynoic acid, 3-phenyl,phenylacetylenecarboxylic acid,3-phenyl-2-propynoic acid,phenylacetylene monocarboxylic acid,propiolic acid, 3-phenyl,phenyl propiolic acid PubChem CID: 69475 IUPAC Name: 3-phenylprop-2-ynoic acid SMILES: OC(=O)C#CC1=CC=CC=C1
| PubChem CID | 69475 |
|---|---|
| CAS | 637-44-5 |
| Molecular Weight (g/mol) | 146.15 |
| MDL Number | MFCD00004361 |
| SMILES | OC(=O)C#CC1=CC=CC=C1 |
| Synonym | phenylpropiolic acid,3-phenylpropiolic acid,phenylpropynoic acid,3-phenylpropynoic acid,2-propynoic acid, 3-phenyl,phenylacetylenecarboxylic acid,3-phenyl-2-propynoic acid,phenylacetylene monocarboxylic acid,propiolic acid, 3-phenyl,phenyl propiolic acid |
| IUPAC Name | 3-phenylprop-2-ynoic acid |
| InChI Key | XNERWVPQCYSMLC-UHFFFAOYSA-N |
| Molecular Formula | C9H6O2 |
Ethyl cyanoacetate, 98+%
CAS: 105-56-6 Molecular Formula: C5H7NO2 Molecular Weight (g/mol): 113.12 MDL Number: MFCD00001940 InChI Key: ZIUSEGSNTOUIPT-UHFFFAOYSA-N Synonym: ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate PubChem CID: 7764 IUPAC Name: ethyl 2-cyanoacetate SMILES: CCOC(=O)CC#N
| PubChem CID | 7764 |
|---|---|
| CAS | 105-56-6 |
| Molecular Weight (g/mol) | 113.12 |
| MDL Number | MFCD00001940 |
| SMILES | CCOC(=O)CC#N |
| Synonym | ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate |
| IUPAC Name | ethyl 2-cyanoacetate |
| InChI Key | ZIUSEGSNTOUIPT-UHFFFAOYSA-N |
| Molecular Formula | C5H7NO2 |
Benzyl acetate, 99%
CAS: 140-11-4 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00008712 InChI Key: QUKGYYKBILRGFE-UHFFFAOYSA-N Synonym: acetic acid benzyl ester,benzyl ethanoate,acetic acid, phenylmethyl ester,phenylmethyl acetate,acetic acid, benzyl ester,alpha-acetoxytoluene,phenylmethyl ethanoate,acetoxymethyl benzene,benzylester kyseliny octove,caswell no. 081ea PubChem CID: 8785 ChEBI: CHEBI:52051 IUPAC Name: benzyl acetate SMILES: CC(=O)OCC1=CC=CC=C1
| PubChem CID | 8785 |
|---|---|
| CAS | 140-11-4 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:52051 |
| MDL Number | MFCD00008712 |
| SMILES | CC(=O)OCC1=CC=CC=C1 |
| Synonym | acetic acid benzyl ester,benzyl ethanoate,acetic acid, phenylmethyl ester,phenylmethyl acetate,acetic acid, benzyl ester,alpha-acetoxytoluene,phenylmethyl ethanoate,acetoxymethyl benzene,benzylester kyseliny octove,caswell no. 081ea |
| IUPAC Name | benzyl acetate |
| InChI Key | QUKGYYKBILRGFE-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Diphenylamine-4-sulfonic acid, sodium salt, ACS reagent
CAS: 6152-67-6 Molecular Formula: C12H11NNaO3S Molecular Weight (g/mol): 272.27 MDL Number: MFCD00036468 InChI Key: VMVSDVIYIMNZBS-UHFFFAOYSA-N Synonym: sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt PubChem CID: 517002 IUPAC Name: sodium;4-anilinobenzenesulfonate SMILES: [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 517002 |
|---|---|
| CAS | 6152-67-6 |
| Molecular Weight (g/mol) | 272.27 |
| MDL Number | MFCD00036468 |
| SMILES | [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt |
| IUPAC Name | sodium;4-anilinobenzenesulfonate |
| InChI Key | VMVSDVIYIMNZBS-UHFFFAOYSA-N |
| Molecular Formula | C12H11NNaO3S |
1-Naphthyl phosphate monosodium salt monohydrate, 98+%
CAS: 81012-89-7 Molecular Formula: C10H7O4P Molecular Weight (g/mol): 222.14 MDL Number: MFCD00150615 InChI Key: YNXICDMQCQPQEW-UHFFFAOYSA-L Synonym: 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc PubChem CID: 45055387 IUPAC Name: naphthalen-1-yl dihydrogen phosphate;sodium;hydrate SMILES: [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1
| PubChem CID | 45055387 |
|---|---|
| CAS | 81012-89-7 |
| Molecular Weight (g/mol) | 222.14 |
| MDL Number | MFCD00150615 |
| SMILES | [O-]P([O-])(=O)OC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthyl phosphate monosodium salt monohydrate,sodium naphthalen-1-yl hydrogenphosphate hydrate,alpha-naphthyl acid phosphate monosodium,sodium hydrate naphthalen-1-yl hydrogen phosphate,1-naphthyl phosphate sodium salt monohydrate,c10h8po4.na.h2o,sodium 1-naphthyl phosphate monohydrate,1-naphthyl phosphate, monosodium salt monohydrate,naphthalen-1-yloxy sodiooxy phosphinic acid hydrate,1-naphthyl phosphate monosodium salt monohydrate hplc |
| IUPAC Name | naphthalen-1-yl dihydrogen phosphate;sodium;hydrate |
| InChI Key | YNXICDMQCQPQEW-UHFFFAOYSA-L |
| Molecular Formula | C10H7O4P |
Methyl cinnamate, predominantly trans, 99%
CAS: 103-26-4 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.188 MDL Number: MFCD00008458 InChI Key: CCRCUPLGCSFEDV-BQYQJAHWSA-N Synonym: methyl cinnamate,methyl trans-cinnamate,methyl e-cinnamate,cinnamic acid methyl ester,methyl cinnamylate,methyl 3-phenylacrylate,methyl e-3-phenylprop-2-enoate,methyl 3-phenylpropenoate,trans-cinnamic acid methyl ester,trans-methyl cinnamate PubChem CID: 637520 ChEBI: CHEBI:6857 IUPAC Name: methyl (E)-3-phenylprop-2-enoate SMILES: COC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637520 |
|---|---|
| CAS | 103-26-4 |
| Molecular Weight (g/mol) | 162.188 |
| ChEBI | CHEBI:6857 |
| MDL Number | MFCD00008458 |
| SMILES | COC(=O)C=CC1=CC=CC=C1 |
| Synonym | methyl cinnamate,methyl trans-cinnamate,methyl e-cinnamate,cinnamic acid methyl ester,methyl cinnamylate,methyl 3-phenylacrylate,methyl e-3-phenylprop-2-enoate,methyl 3-phenylpropenoate,trans-cinnamic acid methyl ester,trans-methyl cinnamate |
| IUPAC Name | methyl (E)-3-phenylprop-2-enoate |
| InChI Key | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
| Molecular Formula | C10H10O2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.154 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.154 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |
4-Hydroxybutyl acrylate, 95%, stab. with ca 500ppm 4-methoxyphenol
CAS: 2478-10-6 MDL Number: MFCD00010261
| CAS | 2478-10-6 |
|---|---|
| MDL Number | MFCD00010261 |
Methacrylic acid, 99%, stab. with 100-250ppm hydroquinone or 4-methoxyphenol
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |